Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=10675
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=10700", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=10650", "results": [ { "id": 10666, "identifier": "DB01297", "identifier_type": "str", "name": "Practolol", "properties": { "url": "http://www.drugbank.ca/drugs/DB01297", "inchi": "InChI=1S/C14H22N2O3/c1-10(2)15-8-13(18)9-19-14-6-4-12(5-7-14)16-11(3)17/h4-7,10,13,15,18H,8-9H2,1-3H3,(H,16,17)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=DURULFYMVIFBIR-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 10667, "identifier": "GO:0042559", "identifier_type": "str", "name": "pteridine-containing compound biosynthetic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0042559", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 10668, "identifier": "C1456329", "identifier_type": "str", "name": "Stomach dilation procedure", "properties": { "url": "http://identifiers.org/umls/C1456329", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 10669, "identifier": "55015", "identifier_type": "int", "name": "PRPF39", "properties": { "url": "http://identifiers.org/ncbigene/55015", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "14", "description": "pre-mRNA processing factor 39" }, "metanode": "Gene" }, { "id": 10670, "identifier": "GO:0031436", "identifier_type": "str", "name": "BRCA1-BARD1 complex", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0031436", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 10671, "identifier": "UBERON:0001648", "identifier_type": "str", "name": "vestibulocochlear nerve", "properties": { "url": "http://purl.obolibrary.org/obo/UBERON_0001648", "bto_id": "BTO:0003490", "source": "Uberon", "license": "CC BY 3.0", "mesh_id": "D000159" }, "metanode": "Anatomy" }, { "id": 10672, "identifier": "115727", "identifier_type": "int", "name": "RASGRP4", "properties": { "url": "http://identifiers.org/ncbigene/115727", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "RAS guanyl releasing protein 4" }, "metanode": "Gene" }, { "id": 10673, "identifier": "GO:0019367", "identifier_type": "str", "name": "fatty acid elongation, saturated fatty acid", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0019367", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 10674, "identifier": "7318", "identifier_type": "int", "name": "UBA7", "properties": { "url": "http://identifiers.org/ncbigene/7318", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "ubiquitin-like modifier activating enzyme 7" }, "metanode": "Gene" }, { "id": 10675, "identifier": "GO:0046933", "identifier_type": "str", "name": "proton-transporting ATP synthase activity, rotational mechanism", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0046933", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 10676, "identifier": "92291", "identifier_type": "int", "name": "CAPN13", "properties": { "url": "http://identifiers.org/ncbigene/92291", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "calpain 13" }, "metanode": "Gene" }, { "id": 10677, "identifier": "732265", "identifier_type": "int", "name": "LOC732265", "properties": { "url": "http://identifiers.org/ncbigene/732265", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "15", "description": "uncharacterized LOC732265" }, "metanode": "Gene" }, { "id": 10678, "identifier": "C0014718", "identifier_type": "str", "name": "Intertrigo candida", "properties": { "url": "http://identifiers.org/umls/C0014718", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 10679, "identifier": "GO:0051350", "identifier_type": "str", "name": "negative regulation of lyase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0051350", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 10680, "identifier": "26155", "identifier_type": "int", "name": "NOC2L", "properties": { "url": "http://identifiers.org/ncbigene/26155", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "nucleolar complex associated 2 homolog (S. cerevisiae)" }, "metanode": "Gene" }, { "id": 10681, "identifier": "55697", "identifier_type": "int", "name": "VAC14", "properties": { "url": "http://identifiers.org/ncbigene/55697", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "Vac14 homolog (S. cerevisiae)" }, "metanode": "Gene" }, { "id": 10682, "identifier": "100128569", "identifier_type": "int", "name": "C19orf71", "properties": { "url": "http://identifiers.org/ncbigene/100128569", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "chromosome 19 open reading frame 71" }, "metanode": "Gene" }, { "id": 10683, "identifier": "100532731", "identifier_type": "int", "name": "COMMD3-BMI1", "properties": { "url": "http://identifiers.org/ncbigene/100532731", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "10", "description": "COMMD3-BMI1 readthrough" }, "metanode": "Gene" }, { "id": 10684, "identifier": "9014", "identifier_type": "int", "name": "TAF1B", "properties": { "url": "http://identifiers.org/ncbigene/9014", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "TATA box binding protein (TBP)-associated factor, RNA polymerase I, B, 63kDa" }, "metanode": "Gene" }, { "id": 10685, "identifier": "GO:0014866", "identifier_type": "str", "name": "skeletal myofibril assembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0014866", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 10686, "identifier": "GO:0097105", "identifier_type": "str", "name": "presynaptic membrane assembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0097105", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 10687, "identifier": "27109", "identifier_type": "int", "name": "ATP5S", "properties": { "url": "http://identifiers.org/ncbigene/27109", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "14", "description": "ATP synthase, H+ transporting, mitochondrial Fo complex, subunit s (factor B)" }, "metanode": "Gene" }, { "id": 10688, "identifier": "2832", "identifier_type": "int", "name": "NPBWR2", "properties": { "url": "http://identifiers.org/ncbigene/2832", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "neuropeptides B/W receptor 2" }, "metanode": "Gene" }, { "id": 10689, "identifier": "DB06706", "identifier_type": "str", "name": "Isometheptene", "properties": { "url": "http://www.drugbank.ca/drugs/DB06706", "inchi": "InChI=1S/C9H19N/c1-8(2)6-5-7-9(3)10-4/h6,9-10H,5,7H2,1-4H3", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=XVQUOJBERHHONY-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 10690, "identifier": "57393", "identifier_type": "int", "name": "TMEM27", "properties": { "url": "http://identifiers.org/ncbigene/57393", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "transmembrane protein 27" }, "metanode": "Gene" } ] }