Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=10675
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=10700",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=10650",
    "results": [
        {
            "id": 10666,
            "identifier": "DB01297",
            "identifier_type": "str",
            "name": "Practolol",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB01297",
                "inchi": "InChI=1S/C14H22N2O3/c1-10(2)15-8-13(18)9-19-14-6-4-12(5-7-14)16-11(3)17/h4-7,10,13,15,18H,8-9H2,1-3H3,(H,16,17)",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=DURULFYMVIFBIR-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 10667,
            "identifier": "GO:0042559",
            "identifier_type": "str",
            "name": "pteridine-containing compound biosynthetic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0042559",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 10668,
            "identifier": "C1456329",
            "identifier_type": "str",
            "name": "Stomach dilation procedure",
            "properties": {
                "url": "http://identifiers.org/umls/C1456329",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 10669,
            "identifier": "55015",
            "identifier_type": "int",
            "name": "PRPF39",
            "properties": {
                "url": "http://identifiers.org/ncbigene/55015",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "14",
                "description": "pre-mRNA processing factor 39"
            },
            "metanode": "Gene"
        },
        {
            "id": 10670,
            "identifier": "GO:0031436",
            "identifier_type": "str",
            "name": "BRCA1-BARD1 complex",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0031436",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 10671,
            "identifier": "UBERON:0001648",
            "identifier_type": "str",
            "name": "vestibulocochlear nerve",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/UBERON_0001648",
                "bto_id": "BTO:0003490",
                "source": "Uberon",
                "license": "CC BY 3.0",
                "mesh_id": "D000159"
            },
            "metanode": "Anatomy"
        },
        {
            "id": 10672,
            "identifier": "115727",
            "identifier_type": "int",
            "name": "RASGRP4",
            "properties": {
                "url": "http://identifiers.org/ncbigene/115727",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "RAS guanyl releasing protein 4"
            },
            "metanode": "Gene"
        },
        {
            "id": 10673,
            "identifier": "GO:0019367",
            "identifier_type": "str",
            "name": "fatty acid elongation, saturated fatty acid",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0019367",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 10674,
            "identifier": "7318",
            "identifier_type": "int",
            "name": "UBA7",
            "properties": {
                "url": "http://identifiers.org/ncbigene/7318",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "ubiquitin-like modifier activating enzyme 7"
            },
            "metanode": "Gene"
        },
        {
            "id": 10675,
            "identifier": "GO:0046933",
            "identifier_type": "str",
            "name": "proton-transporting ATP synthase activity, rotational mechanism",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0046933",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 10676,
            "identifier": "92291",
            "identifier_type": "int",
            "name": "CAPN13",
            "properties": {
                "url": "http://identifiers.org/ncbigene/92291",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "calpain 13"
            },
            "metanode": "Gene"
        },
        {
            "id": 10677,
            "identifier": "732265",
            "identifier_type": "int",
            "name": "LOC732265",
            "properties": {
                "url": "http://identifiers.org/ncbigene/732265",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "15",
                "description": "uncharacterized LOC732265"
            },
            "metanode": "Gene"
        },
        {
            "id": 10678,
            "identifier": "C0014718",
            "identifier_type": "str",
            "name": "Intertrigo candida",
            "properties": {
                "url": "http://identifiers.org/umls/C0014718",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 10679,
            "identifier": "GO:0051350",
            "identifier_type": "str",
            "name": "negative regulation of lyase activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0051350",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 10680,
            "identifier": "26155",
            "identifier_type": "int",
            "name": "NOC2L",
            "properties": {
                "url": "http://identifiers.org/ncbigene/26155",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "nucleolar complex associated 2 homolog (S. cerevisiae)"
            },
            "metanode": "Gene"
        },
        {
            "id": 10681,
            "identifier": "55697",
            "identifier_type": "int",
            "name": "VAC14",
            "properties": {
                "url": "http://identifiers.org/ncbigene/55697",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "16",
                "description": "Vac14 homolog (S. cerevisiae)"
            },
            "metanode": "Gene"
        },
        {
            "id": 10682,
            "identifier": "100128569",
            "identifier_type": "int",
            "name": "C19orf71",
            "properties": {
                "url": "http://identifiers.org/ncbigene/100128569",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "chromosome 19 open reading frame 71"
            },
            "metanode": "Gene"
        },
        {
            "id": 10683,
            "identifier": "100532731",
            "identifier_type": "int",
            "name": "COMMD3-BMI1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/100532731",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "10",
                "description": "COMMD3-BMI1 readthrough"
            },
            "metanode": "Gene"
        },
        {
            "id": 10684,
            "identifier": "9014",
            "identifier_type": "int",
            "name": "TAF1B",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9014",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "TATA box binding protein (TBP)-associated factor, RNA polymerase I, B, 63kDa"
            },
            "metanode": "Gene"
        },
        {
            "id": 10685,
            "identifier": "GO:0014866",
            "identifier_type": "str",
            "name": "skeletal myofibril assembly",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0014866",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 10686,
            "identifier": "GO:0097105",
            "identifier_type": "str",
            "name": "presynaptic membrane assembly",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0097105",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 10687,
            "identifier": "27109",
            "identifier_type": "int",
            "name": "ATP5S",
            "properties": {
                "url": "http://identifiers.org/ncbigene/27109",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "14",
                "description": "ATP synthase, H+ transporting, mitochondrial Fo complex, subunit s (factor B)"
            },
            "metanode": "Gene"
        },
        {
            "id": 10688,
            "identifier": "2832",
            "identifier_type": "int",
            "name": "NPBWR2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/2832",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "neuropeptides B/W receptor 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 10689,
            "identifier": "DB06706",
            "identifier_type": "str",
            "name": "Isometheptene",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB06706",
                "inchi": "InChI=1S/C9H19N/c1-8(2)6-5-7-9(3)10-4/h6,9-10H,5,7H2,1-4H3",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=XVQUOJBERHHONY-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 10690,
            "identifier": "57393",
            "identifier_type": "int",
            "name": "TMEM27",
            "properties": {
                "url": "http://identifiers.org/ncbigene/57393",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "X",
                "description": "transmembrane protein 27"
            },
            "metanode": "Gene"
        }
    ]
}