Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=1150
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=1175",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=1125",
    "results": [
        {
            "id": 1148,
            "identifier": "GO:0071898",
            "identifier_type": "str",
            "name": "regulation of estrogen receptor binding",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071898",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 1149,
            "identifier": "9235",
            "identifier_type": "int",
            "name": "IL32",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9235",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "16",
                "description": "interleukin 32"
            },
            "metanode": "Gene"
        },
        {
            "id": 1150,
            "identifier": "5305",
            "identifier_type": "int",
            "name": "PIP4K2A",
            "properties": {
                "url": "http://identifiers.org/ncbigene/5305",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "10",
                "description": "phosphatidylinositol-5-phosphate 4-kinase, type II, alpha"
            },
            "metanode": "Gene"
        },
        {
            "id": 1151,
            "identifier": "GO:0004526",
            "identifier_type": "str",
            "name": "ribonuclease P activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0004526",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 1152,
            "identifier": "112476",
            "identifier_type": "int",
            "name": "PRRT2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/112476",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "16",
                "description": "proline-rich transmembrane protein 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 1153,
            "identifier": "27330",
            "identifier_type": "int",
            "name": "RPS6KA6",
            "properties": {
                "url": "http://identifiers.org/ncbigene/27330",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "X",
                "description": "ribosomal protein S6 kinase, 90kDa, polypeptide 6"
            },
            "metanode": "Gene"
        },
        {
            "id": 1154,
            "identifier": "C0235966",
            "identifier_type": "str",
            "name": "Dreaming excessive",
            "properties": {
                "url": "http://identifiers.org/umls/C0235966",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 1155,
            "identifier": "57630",
            "identifier_type": "int",
            "name": "SH3RF1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/57630",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "4",
                "description": "SH3 domain containing ring finger 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 1156,
            "identifier": "DOID:11612",
            "identifier_type": "str",
            "name": "polycystic ovary syndrome",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/DOID_11612",
                "source": "Disease Ontology",
                "license": "CC BY 3.0"
            },
            "metanode": "Disease"
        },
        {
            "id": 1157,
            "identifier": "GO:1901021",
            "identifier_type": "str",
            "name": "positive regulation of calcium ion transmembrane transporter activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1901021",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 1158,
            "identifier": "100507462",
            "identifier_type": "int",
            "name": "LOC100507462",
            "properties": {
                "url": "http://identifiers.org/ncbigene/100507462",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "uncharacterized LOC100507462"
            },
            "metanode": "Gene"
        },
        {
            "id": 1159,
            "identifier": "29799",
            "identifier_type": "int",
            "name": "YPEL1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/29799",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "22",
                "description": "yippee-like 1 (Drosophila)"
            },
            "metanode": "Gene"
        },
        {
            "id": 1160,
            "identifier": "5522",
            "identifier_type": "int",
            "name": "PPP2R2C",
            "properties": {
                "url": "http://identifiers.org/ncbigene/5522",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "4",
                "description": "protein phosphatase 2, regulatory subunit B, gamma"
            },
            "metanode": "Gene"
        },
        {
            "id": 1161,
            "identifier": "DB06827",
            "identifier_type": "str",
            "name": "Viomycin",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB06827",
                "inchi": "InChI=1/C25H43N13O10/c26-3-1-2-10(27)4-16(41)32-12-6-30-23(47)18(11-5-17(42)37-24(28)36-11)38-20(44)13(7-31-25(29)48)33-21(45)14(8-39)35-22(46)15(9-40)34-19(12)43/h7,10-12,14-15,17-18,39-40,42H,1-6,8-9,26-27H2,(H,30,47)(H,32,41)(H,33,45)(H,34,43)(H,35,46)(H,38,44)(H3,28,36,37)(H3,29,31,48)/b13-7-/t10-,11+,12-,14-,15-,17-,18-/s2",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=GXFAIFRPOKBQRV-WPJXMGAWNA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 1162,
            "identifier": "375318",
            "identifier_type": "int",
            "name": "AQP12A",
            "properties": {
                "url": "http://identifiers.org/ncbigene/375318",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "aquaporin 12A"
            },
            "metanode": "Gene"
        },
        {
            "id": 1163,
            "identifier": "23617",
            "identifier_type": "int",
            "name": "TSSK2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/23617",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "22",
                "description": "testis-specific serine kinase 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 1164,
            "identifier": "7991",
            "identifier_type": "int",
            "name": "TUSC3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/7991",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "8",
                "description": "tumor suppressor candidate 3"
            },
            "metanode": "Gene"
        },
        {
            "id": 1165,
            "identifier": "53917",
            "identifier_type": "int",
            "name": "RAB24",
            "properties": {
                "url": "http://identifiers.org/ncbigene/53917",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "5",
                "description": "RAB24, member RAS oncogene family"
            },
            "metanode": "Gene"
        },
        {
            "id": 1166,
            "identifier": "105372493",
            "identifier_type": "int",
            "name": "LOC105372493",
            "properties": {
                "url": "http://identifiers.org/ncbigene/105372493",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "uncharacterized LOC105372493"
            },
            "metanode": "Gene"
        },
        {
            "id": 1167,
            "identifier": "C0263445",
            "identifier_type": "str",
            "name": "Acne fulminans",
            "properties": {
                "url": "http://identifiers.org/umls/C0263445",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 1168,
            "identifier": "84457",
            "identifier_type": "int",
            "name": "PHYHIPL",
            "properties": {
                "url": "http://identifiers.org/ncbigene/84457",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "10",
                "description": "phytanoyl-CoA 2-hydroxylase interacting protein-like"
            },
            "metanode": "Gene"
        },
        {
            "id": 1169,
            "identifier": "GO:0000228",
            "identifier_type": "str",
            "name": "nuclear chromosome",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0000228",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 1170,
            "identifier": "GO:0030175",
            "identifier_type": "str",
            "name": "filopodium",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0030175",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 1171,
            "identifier": "114885",
            "identifier_type": "int",
            "name": "OSBPL11",
            "properties": {
                "url": "http://identifiers.org/ncbigene/114885",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "oxysterol binding protein-like 11"
            },
            "metanode": "Gene"
        },
        {
            "id": 1172,
            "identifier": "GO:0071673",
            "identifier_type": "str",
            "name": "positive regulation of smooth muscle cell chemotaxis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071673",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        }
    ]
}