Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=1175
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=1200",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=1150",
    "results": [
        {
            "id": 1173,
            "identifier": "D017109",
            "identifier_type": "str",
            "name": "Akathisia, Drug-Induced",
            "properties": {
                "url": "http://identifiers.org/mesh/D017109",
                "source": "MeSH",
                "license": "CC0 1.0"
            },
            "metanode": "Symptom"
        },
        {
            "id": 1174,
            "identifier": "6476",
            "identifier_type": "int",
            "name": "SI",
            "properties": {
                "url": "http://identifiers.org/ncbigene/6476",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "sucrase-isomaltase (alpha-glucosidase)"
            },
            "metanode": "Gene"
        },
        {
            "id": 1175,
            "identifier": "PC7_5988",
            "identifier_type": "str",
            "name": "Nuclear Pore Complex (NPC) Disassembly",
            "properties": {
                "source": "Reactome via Pathway Commons",
                "license": "CC BY 4.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 1176,
            "identifier": "337967",
            "identifier_type": "int",
            "name": "KRTAP6-2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/337967",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "21",
                "description": "keratin associated protein 6-2"
            },
            "metanode": "Gene"
        },
        {
            "id": 1177,
            "identifier": "GO:1901616",
            "identifier_type": "str",
            "name": "organic hydroxy compound catabolic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1901616",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 1178,
            "identifier": "GO:1902624",
            "identifier_type": "str",
            "name": "positive regulation of neutrophil migration",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1902624",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 1179,
            "identifier": "1052",
            "identifier_type": "int",
            "name": "CEBPD",
            "properties": {
                "url": "http://identifiers.org/ncbigene/1052",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "8",
                "description": "CCAAT/enhancer binding protein (C/EBP), delta"
            },
            "metanode": "Gene"
        },
        {
            "id": 1180,
            "identifier": "9815",
            "identifier_type": "int",
            "name": "GIT2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9815",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "G protein-coupled receptor kinase interacting ArfGAP 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 1181,
            "identifier": "51074",
            "identifier_type": "int",
            "name": "APIP",
            "properties": {
                "url": "http://identifiers.org/ncbigene/51074",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "11",
                "description": "APAF1 interacting protein"
            },
            "metanode": "Gene"
        },
        {
            "id": 1182,
            "identifier": "220323",
            "identifier_type": "int",
            "name": "OAF",
            "properties": {
                "url": "http://identifiers.org/ncbigene/220323",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "11",
                "description": "OAF homolog (Drosophila)"
            },
            "metanode": "Gene"
        },
        {
            "id": 1183,
            "identifier": "WP2363_r84552",
            "identifier_type": "str",
            "name": "Gastric Cancer Network 2",
            "properties": {
                "url": "http://www.wikipathways.org/instance/WP2363_r84552",
                "source": "WikiPathways",
                "license": "CC BY 3.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 1184,
            "identifier": "GO:0043461",
            "identifier_type": "str",
            "name": "proton-transporting ATP synthase complex assembly",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0043461",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 1185,
            "identifier": "PC7_6466",
            "identifier_type": "str",
            "name": "Phosphorylation of proteins involved in the G2/M transition by Cyclin A:Cdc2 complexes",
            "properties": {
                "source": "Reactome via Pathway Commons",
                "license": "CC BY 4.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 1186,
            "identifier": "DB01132",
            "identifier_type": "str",
            "name": "Pioglitazone",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB01132",
                "inchi": "InChI=1S/C19H20N2O3S/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23)",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=HYAFETHFCAUJAY-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 1187,
            "identifier": "101060017",
            "identifier_type": "int",
            "name": "LOC101060017",
            "properties": {
                "url": "http://identifiers.org/ncbigene/101060017",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "50 kDa spicule matrix protein-like"
            },
            "metanode": "Gene"
        },
        {
            "id": 1188,
            "identifier": "GO:0048592",
            "identifier_type": "str",
            "name": "eye morphogenesis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0048592",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 1189,
            "identifier": "GO:0045646",
            "identifier_type": "str",
            "name": "regulation of erythrocyte differentiation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0045646",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 1190,
            "identifier": "PC7_2679",
            "identifier_type": "str",
            "name": "Constitutive PI3K/AKT Signaling in Cancer",
            "properties": {
                "source": "Reactome via Pathway Commons",
                "license": "CC BY 4.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 1191,
            "identifier": "6102",
            "identifier_type": "int",
            "name": "RP2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/6102",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "X",
                "description": "retinitis pigmentosa 2 (X-linked recessive)"
            },
            "metanode": "Gene"
        },
        {
            "id": 1192,
            "identifier": "10497",
            "identifier_type": "int",
            "name": "UNC13B",
            "properties": {
                "url": "http://identifiers.org/ncbigene/10497",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "9",
                "description": "unc-13 homolog B (C. elegans)"
            },
            "metanode": "Gene"
        },
        {
            "id": 1193,
            "identifier": "GO:0003163",
            "identifier_type": "str",
            "name": "sinoatrial node development",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0003163",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 1194,
            "identifier": "353219",
            "identifier_type": "int",
            "name": "KAAG1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/353219",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "kidney associated antigen 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 1195,
            "identifier": "D019547",
            "identifier_type": "str",
            "name": "Neck Pain",
            "properties": {
                "url": "http://identifiers.org/mesh/D019547",
                "source": "MeSH",
                "license": "CC0 1.0"
            },
            "metanode": "Symptom"
        },
        {
            "id": 1196,
            "identifier": "GO:0071013",
            "identifier_type": "str",
            "name": "catalytic step 2 spliceosome",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071013",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 1197,
            "identifier": "GO:0071577",
            "identifier_type": "str",
            "name": "zinc II ion transmembrane transport",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071577",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        }
    ]
}