Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=12975
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=13000", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=12950", "results": [ { "id": 12965, "identifier": "105375116", "identifier_type": "int", "name": "LOC105375116", "properties": { "url": "http://identifiers.org/ncbigene/105375116", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "TRIO and F-actin-binding protein-like" }, "metanode": "Gene" }, { "id": 12966, "identifier": "22898", "identifier_type": "int", "name": "DENND3", "properties": { "url": "http://identifiers.org/ncbigene/22898", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "DENN/MADD domain containing 3" }, "metanode": "Gene" }, { "id": 12967, "identifier": "7384", "identifier_type": "int", "name": "UQCRC1", "properties": { "url": "http://identifiers.org/ncbigene/7384", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "ubiquinol-cytochrome c reductase core protein I" }, "metanode": "Gene" }, { "id": 12968, "identifier": "GO:0071245", "identifier_type": "str", "name": "cellular response to carbon monoxide", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0071245", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 12969, "identifier": "GO:0046717", "identifier_type": "str", "name": "acid secretion", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0046717", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 12970, "identifier": "GO:0004335", "identifier_type": "str", "name": "galactokinase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0004335", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 12971, "identifier": "1960", "identifier_type": "int", "name": "EGR3", "properties": { "url": "http://identifiers.org/ncbigene/1960", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "early growth response 3" }, "metanode": "Gene" }, { "id": 12972, "identifier": "55779", "identifier_type": "int", "name": "CFAP44", "properties": { "url": "http://identifiers.org/ncbigene/55779", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "cilia and flagella associated protein 44" }, "metanode": "Gene" }, { "id": 12973, "identifier": "55750", "identifier_type": "int", "name": "AGK", "properties": { "url": "http://identifiers.org/ncbigene/55750", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "acylglycerol kinase" }, "metanode": "Gene" }, { "id": 12974, "identifier": "DB01080", "identifier_type": "str", "name": "Vigabatrin", "properties": { "url": "http://www.drugbank.ca/drugs/DB01080", "inchi": "InChI=1S/C6H11NO2/c1-2-5(7)3-4-6(8)9/h2,5H,1,3-4,7H2,(H,8,9)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=PJDFLNIOAUIZSL-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 12975, "identifier": "C0853761", "identifier_type": "str", "name": "Blood potassium decreased", "properties": { "url": "http://identifiers.org/umls/C0853761", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 12976, "identifier": "GO:1990712", "identifier_type": "str", "name": "HFE-transferrin receptor complex", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1990712", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 12977, "identifier": "9080", "identifier_type": "int", "name": "CLDN9", "properties": { "url": "http://identifiers.org/ncbigene/9080", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "claudin 9" }, "metanode": "Gene" }, { "id": 12978, "identifier": "440345", "identifier_type": "int", "name": "NPIPB4", "properties": { "url": "http://identifiers.org/ncbigene/440345", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "nuclear pore complex interacting protein family, member B4" }, "metanode": "Gene" }, { "id": 12979, "identifier": "728378", "identifier_type": "int", "name": "POTEF", "properties": { "url": "http://identifiers.org/ncbigene/728378", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "POTE ankyrin domain family, member F" }, "metanode": "Gene" }, { "id": 12980, "identifier": "GO:0004222", "identifier_type": "str", "name": "metalloendopeptidase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0004222", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 12981, "identifier": "127707", "identifier_type": "int", "name": "KLHDC7A", "properties": { "url": "http://identifiers.org/ncbigene/127707", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "kelch domain containing 7A" }, "metanode": "Gene" }, { "id": 12982, "identifier": "105375355", "identifier_type": "int", "name": "LOC105375355", "properties": { "url": "http://identifiers.org/ncbigene/105375355", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "uroplakin-3b" }, "metanode": "Gene" }, { "id": 12983, "identifier": "2914", "identifier_type": "int", "name": "GRM4", "properties": { "url": "http://identifiers.org/ncbigene/2914", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "glutamate receptor, metabotropic 4" }, "metanode": "Gene" }, { "id": 12984, "identifier": "80010", "identifier_type": "int", "name": "RMI1", "properties": { "url": "http://identifiers.org/ncbigene/80010", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "9", "description": "RecQ mediated genome instability 1" }, "metanode": "Gene" }, { "id": 12985, "identifier": "5255", "identifier_type": "int", "name": "PHKA1", "properties": { "url": "http://identifiers.org/ncbigene/5255", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "phosphorylase kinase, alpha 1 (muscle)" }, "metanode": "Gene" }, { "id": 12986, "identifier": "GO:0090312", "identifier_type": "str", "name": "positive regulation of protein deacetylation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0090312", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 12987, "identifier": "51309", "identifier_type": "int", "name": "ARMCX1", "properties": { "url": "http://identifiers.org/ncbigene/51309", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "armadillo repeat containing, X-linked 1" }, "metanode": "Gene" }, { "id": 12988, "identifier": "GO:0030478", "identifier_type": "str", "name": "actin cap", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0030478", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 12989, "identifier": "100132800", "identifier_type": "int", "name": "LOC100132800", "properties": { "url": "http://identifiers.org/ncbigene/100132800", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "uncharacterized LOC100132800" }, "metanode": "Gene" } ] }