Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=14500
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=14525", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=14475", "results": [ { "id": 14491, "identifier": "627", "identifier_type": "int", "name": "BDNF", "properties": { "url": "http://identifiers.org/ncbigene/627", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "brain-derived neurotrophic factor" }, "metanode": "Gene" }, { "id": 14492, "identifier": "9134", "identifier_type": "int", "name": "CCNE2", "properties": { "url": "http://identifiers.org/ncbigene/9134", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "cyclin E2" }, "metanode": "Gene" }, { "id": 14493, "identifier": "50649", "identifier_type": "int", "name": "ARHGEF4", "properties": { "url": "http://identifiers.org/ncbigene/50649", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "Rho guanine nucleotide exchange factor (GEF) 4" }, "metanode": "Gene" }, { "id": 14494, "identifier": "PC7_5271", "identifier_type": "str", "name": "Meiosis", "properties": { "source": "Reactome via Pathway Commons", "license": "CC BY 4.0" }, "metanode": "Pathway" }, { "id": 14495, "identifier": "GO:2001303", "identifier_type": "str", "name": "lipoxin A4 biosynthetic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_2001303", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14496, "identifier": "DB06623", "identifier_type": "str", "name": "Flupirtine", "properties": { "url": "http://www.drugbank.ca/drugs/DB06623", "inchi": "InChI=1S/C15H17FN4O2/c1-2-22-15(21)19-12-7-8-13(20-14(12)17)18-9-10-3-5-11(16)6-4-10/h3-8H,2,9H2,1H3,(H,19,21)(H3,17,18,20)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=JUUFBMODXQKSTD-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 14497, "identifier": "27229", "identifier_type": "int", "name": "TUBGCP4", "properties": { "url": "http://identifiers.org/ncbigene/27229", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "15", "description": "tubulin, gamma complex associated protein 4" }, "metanode": "Gene" }, { "id": 14498, "identifier": "GO:0019551", "identifier_type": "str", "name": "glutamate catabolic process to 2-oxoglutarate", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0019551", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14499, "identifier": "57513", "identifier_type": "int", "name": "CASKIN2", "properties": { "url": "http://identifiers.org/ncbigene/57513", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "CASK interacting protein 2" }, "metanode": "Gene" }, { "id": 14500, "identifier": "105370367", "identifier_type": "int", "name": "LOC105370367", "properties": { "url": "http://identifiers.org/ncbigene/105370367", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "13", "description": "collagen alpha-2(VIII) chain-like" }, "metanode": "Gene" }, { "id": 14501, "identifier": "C0037383", "identifier_type": "str", "name": "Sneezing", "properties": { "url": "http://identifiers.org/umls/C0037383", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 14502, "identifier": "80176", "identifier_type": "int", "name": "SPSB1", "properties": { "url": "http://identifiers.org/ncbigene/80176", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "splA/ryanodine receptor domain and SOCS box containing 1" }, "metanode": "Gene" }, { "id": 14503, "identifier": "GO:0043527", "identifier_type": "str", "name": "tRNA methyltransferase complex", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0043527", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 14504, "identifier": "654502", "identifier_type": "int", "name": "IQCJ", "properties": { "url": "http://identifiers.org/ncbigene/654502", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "IQ motif containing J" }, "metanode": "Gene" }, { "id": 14505, "identifier": "GO:0032276", "identifier_type": "str", "name": "regulation of gonadotropin secretion", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0032276", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14506, "identifier": "51347", "identifier_type": "int", "name": "TAOK3", "properties": { "url": "http://identifiers.org/ncbigene/51347", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "TAO kinase 3" }, "metanode": "Gene" }, { "id": 14507, "identifier": "GO:0050853", "identifier_type": "str", "name": "B cell receptor signaling pathway", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0050853", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14508, "identifier": "UBERON:0000056", "identifier_type": "str", "name": "ureter", "properties": { "url": "http://purl.obolibrary.org/obo/UBERON_0000056", "bto_id": "BTO:0001409", "source": "Uberon", "license": "CC BY 3.0", "mesh_id": "D014513" }, "metanode": "Anatomy" }, { "id": 14509, "identifier": "GO:0051018", "identifier_type": "str", "name": "protein kinase A binding", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0051018", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 14510, "identifier": "GO:0022602", "identifier_type": "str", "name": "ovulation cycle process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0022602", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14511, "identifier": "GO:0019369", "identifier_type": "str", "name": "arachidonic acid metabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0019369", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14512, "identifier": "105374091", "identifier_type": "int", "name": "LOC105374091", "properties": { "url": "http://identifiers.org/ncbigene/105374091", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "uncharacterized LOC105374091" }, "metanode": "Gene" }, { "id": 14513, "identifier": "GO:0035371", "identifier_type": "str", "name": "microtubule plus-end", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0035371", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 14514, "identifier": "GO:0043031", "identifier_type": "str", "name": "negative regulation of macrophage activation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0043031", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14515, "identifier": "6375", "identifier_type": "int", "name": "XCL1", "properties": { "url": "http://identifiers.org/ncbigene/6375", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "chemokine (C motif) ligand 1" }, "metanode": "Gene" } ] }