Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=14975
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=15000", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=14950", "results": [ { "id": 14965, "identifier": "9810", "identifier_type": "int", "name": "RNF40", "properties": { "url": "http://identifiers.org/ncbigene/9810", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "ring finger protein 40, E3 ubiquitin protein ligase" }, "metanode": "Gene" }, { "id": 14966, "identifier": "GO:0019221", "identifier_type": "str", "name": "cytokine-mediated signaling pathway", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0019221", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14967, "identifier": "GO:0060971", "identifier_type": "str", "name": "embryonic heart tube left/right pattern formation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0060971", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14968, "identifier": "116039", "identifier_type": "int", "name": "OSR2", "properties": { "url": "http://identifiers.org/ncbigene/116039", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "odd-skipped related transciption factor 2" }, "metanode": "Gene" }, { "id": 14969, "identifier": "GO:0008191", "identifier_type": "str", "name": "metalloendopeptidase inhibitor activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0008191", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 14970, "identifier": "3516", "identifier_type": "int", "name": "RBPJ", "properties": { "url": "http://identifiers.org/ncbigene/3516", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "4", "description": "recombination signal binding protein for immunoglobulin kappa J region" }, "metanode": "Gene" }, { "id": 14971, "identifier": "GO:0006814", "identifier_type": "str", "name": "sodium ion transport", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0006814", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14972, "identifier": "C0079731", "identifier_type": "str", "name": "B-cell lymphoma", "properties": { "url": "http://identifiers.org/umls/C0079731", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 14973, "identifier": "GO:0003160", "identifier_type": "str", "name": "endocardium morphogenesis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0003160", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14974, "identifier": "GO:2001301", "identifier_type": "str", "name": "lipoxin biosynthetic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_2001301", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14975, "identifier": "6097", "identifier_type": "int", "name": "RORC", "properties": { "url": "http://identifiers.org/ncbigene/6097", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "RAR-related orphan receptor C" }, "metanode": "Gene" }, { "id": 14976, "identifier": "DB06204", "identifier_type": "str", "name": "Tapentadol", "properties": { "url": "http://www.drugbank.ca/drugs/DB06204", "inchi": "InChI=1S/C14H23NO/c1-5-14(11(2)10-15(3)4)12-7-6-8-13(16)9-12/h6-9,11,14,16H,5,10H2,1-4H3/t11-,14+/m0/s1", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=KWTWDQCKEHXFFR-SMDDNHRTSA-N" }, "metanode": "Compound" }, { "id": 14977, "identifier": "GO:0005136", "identifier_type": "str", "name": "interleukin-4 receptor binding", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0005136", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 14978, "identifier": "54492", "identifier_type": "int", "name": "NEURL1B", "properties": { "url": "http://identifiers.org/ncbigene/54492", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "neuralized E3 ubiquitin protein ligase 1B" }, "metanode": "Gene" }, { "id": 14979, "identifier": "GO:0046915", "identifier_type": "str", "name": "transition metal ion transmembrane transporter activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0046915", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 14980, "identifier": "GO:0010727", "identifier_type": "str", "name": "negative regulation of hydrogen peroxide metabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0010727", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14981, "identifier": "PC7_1850", "identifier_type": "str", "name": "Attenuation phase", "properties": { "source": "Reactome via Pathway Commons", "license": "CC BY 4.0" }, "metanode": "Pathway" }, { "id": 14982, "identifier": "6795", "identifier_type": "int", "name": "AURKC", "properties": { "url": "http://identifiers.org/ncbigene/6795", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "aurora kinase C" }, "metanode": "Gene" }, { "id": 14983, "identifier": "GO:0070417", "identifier_type": "str", "name": "cellular response to cold", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0070417", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14984, "identifier": "56945", "identifier_type": "int", "name": "MRPS22", "properties": { "url": "http://identifiers.org/ncbigene/56945", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "mitochondrial ribosomal protein S22" }, "metanode": "Gene" }, { "id": 14985, "identifier": "GO:0030060", "identifier_type": "str", "name": "L-malate dehydrogenase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0030060", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 14986, "identifier": "GO:0090265", "identifier_type": "str", "name": "positive regulation of immune complex clearance by monocytes and macrophages", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0090265", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 14987, "identifier": "101234261", "identifier_type": "int", "name": "LSINCT5", "properties": { "url": "http://identifiers.org/ncbigene/101234261", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "long stress-induced non-coding transcript 5" }, "metanode": "Gene" }, { "id": 14988, "identifier": "388564", "identifier_type": "int", "name": "TMEM238", "properties": { "url": "http://identifiers.org/ncbigene/388564", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "transmembrane protein 238" }, "metanode": "Gene" }, { "id": 14989, "identifier": "DB00677", "identifier_type": "str", "name": "Isoflurophate", "properties": { "url": "http://www.drugbank.ca/drugs/DB00677", "inchi": "InChI=1S/C6H14FO3P/c1-5(2)9-11(7,8)10-6(3)4/h5-6H,1-4H3", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=MUCZHBLJLSDCSD-UHFFFAOYSA-N" }, "metanode": "Compound" } ] }