Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=1500
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=1525", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=1475", "results": [ { "id": 1497, "identifier": "DB06707", "identifier_type": "str", "name": "Levonordefrin", "properties": { "url": "http://www.drugbank.ca/drugs/DB06707", "inchi": "InChI=1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3/t5-,9-/m0/s1", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=GEFQWZLICWMTKF-CDUCUWFYSA-N" }, "metanode": "Compound" }, { "id": 1498, "identifier": "3484", "identifier_type": "int", "name": "IGFBP1", "properties": { "url": "http://identifiers.org/ncbigene/3484", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "insulin-like growth factor binding protein 1" }, "metanode": "Gene" }, { "id": 1499, "identifier": "GO:0004822", "identifier_type": "str", "name": "isoleucine-tRNA ligase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0004822", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 1500, "identifier": "GO:0051186", "identifier_type": "str", "name": "cofactor metabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0051186", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 1501, "identifier": "100130175", "identifier_type": "int", "name": "LOC100130175", "properties": { "url": "http://identifiers.org/ncbigene/100130175", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "10", "description": "uncharacterized LOC100130175" }, "metanode": "Gene" }, { "id": 1502, "identifier": "GO:0007195", "identifier_type": "str", "name": "adenylate cyclase-inhibiting dopamine receptor signaling pathway", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0007195", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 1503, "identifier": "5937", "identifier_type": "int", "name": "RBMS1", "properties": { "url": "http://identifiers.org/ncbigene/5937", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "RNA binding motif, single stranded interacting protein 1" }, "metanode": "Gene" }, { "id": 1504, "identifier": "60626", "identifier_type": "int", "name": "RIC8A", "properties": { "url": "http://identifiers.org/ncbigene/60626", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "RIC8 guanine nucleotide exchange factor A" }, "metanode": "Gene" }, { "id": 1505, "identifier": "653519", "identifier_type": "int", "name": "GPR89A", "properties": { "url": "http://identifiers.org/ncbigene/653519", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "G protein-coupled receptor 89A" }, "metanode": "Gene" }, { "id": 1506, "identifier": "GO:2000567", "identifier_type": "str", "name": "regulation of memory T cell activation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_2000567", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 1507, "identifier": "4438", "identifier_type": "int", "name": "MSH4", "properties": { "url": "http://identifiers.org/ncbigene/4438", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "mutS homolog 4" }, "metanode": "Gene" }, { "id": 1508, "identifier": "54332", "identifier_type": "int", "name": "GDAP1", "properties": { "url": "http://identifiers.org/ncbigene/54332", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "ganglioside induced differentiation associated protein 1" }, "metanode": "Gene" }, { "id": 1509, "identifier": "254879", "identifier_type": "int", "name": "OR2T6", "properties": { "url": "http://identifiers.org/ncbigene/254879", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "olfactory receptor, family 2, subfamily T, member 6" }, "metanode": "Gene" }, { "id": 1510, "identifier": "100500938", "identifier_type": "int", "name": "CCDC179", "properties": { "url": "http://identifiers.org/ncbigene/100500938", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "coiled-coil domain containing 179" }, "metanode": "Gene" }, { "id": 1511, "identifier": "6891", "identifier_type": "int", "name": "TAP2", "properties": { "url": "http://identifiers.org/ncbigene/6891", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "transporter 2, ATP-binding cassette, sub-family B (MDR/TAP)" }, "metanode": "Gene" }, { "id": 1512, "identifier": "56913", "identifier_type": "int", "name": "C1GALT1", "properties": { "url": "http://identifiers.org/ncbigene/56913", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "core 1 synthase, glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1" }, "metanode": "Gene" }, { "id": 1513, "identifier": "168391", "identifier_type": "int", "name": "GALNTL5", "properties": { "url": "http://identifiers.org/ncbigene/168391", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "polypeptide N-acetylgalactosaminyltransferase-like 5" }, "metanode": "Gene" }, { "id": 1514, "identifier": "GO:0016316", "identifier_type": "str", "name": "phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0016316", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 1515, "identifier": "6949", "identifier_type": "int", "name": "TCOF1", "properties": { "url": "http://identifiers.org/ncbigene/6949", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "Treacher Collins-Franceschetti syndrome 1" }, "metanode": "Gene" }, { "id": 1516, "identifier": "GO:1902963", "identifier_type": "str", "name": "negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1902963", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 1517, "identifier": "GO:0032525", "identifier_type": "str", "name": "somite rostral/caudal axis specification", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0032525", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 1518, "identifier": "GO:0019355", "identifier_type": "str", "name": "nicotinamide nucleotide biosynthetic process from aspartate", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0019355", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 1519, "identifier": "GO:0043066", "identifier_type": "str", "name": "negative regulation of apoptotic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0043066", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 1520, "identifier": "4048", "identifier_type": "int", "name": "LTA4H", "properties": { "url": "http://identifiers.org/ncbigene/4048", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "leukotriene A4 hydrolase" }, "metanode": "Gene" }, { "id": 1521, "identifier": "8459", "identifier_type": "int", "name": "TPST2", "properties": { "url": "http://identifiers.org/ncbigene/8459", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "22", "description": "tyrosylprotein sulfotransferase 2" }, "metanode": "Gene" } ] }