Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=17575
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=17600", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=17550", "results": [ { "id": 17565, "identifier": "5578", "identifier_type": "int", "name": "PRKCA", "properties": { "url": "http://identifiers.org/ncbigene/5578", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "protein kinase C, alpha" }, "metanode": "Gene" }, { "id": 17566, "identifier": "GO:0012502", "identifier_type": "str", "name": "induction of programmed cell death", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0012502", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 17567, "identifier": "113230", "identifier_type": "int", "name": "LOC113230", "properties": { "url": "http://identifiers.org/ncbigene/113230", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "uncharacterized protein LOC113230" }, "metanode": "Gene" }, { "id": 17568, "identifier": "23545", "identifier_type": "int", "name": "ATP6V0A2", "properties": { "url": "http://identifiers.org/ncbigene/23545", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "ATPase, H+ transporting, lysosomal V0 subunit a2" }, "metanode": "Gene" }, { "id": 17569, "identifier": "C0016385", "identifier_type": "str", "name": "Cardiac flutter", "properties": { "url": "http://identifiers.org/umls/C0016385", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 17570, "identifier": "GO:0071549", "identifier_type": "str", "name": "cellular response to dexamethasone stimulus", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0071549", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 17571, "identifier": "64756", "identifier_type": "int", "name": "ATPAF1", "properties": { "url": "http://identifiers.org/ncbigene/64756", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "ATP synthase mitochondrial F1 complex assembly factor 1" }, "metanode": "Gene" }, { "id": 17572, "identifier": "DB01033", "identifier_type": "str", "name": "Mercaptopurine", "properties": { "url": "http://www.drugbank.ca/drugs/DB01033", "inchi": "InChI=1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=GLVAUDGFNGKCSF-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 17573, "identifier": "84166", "identifier_type": "int", "name": "NLRC5", "properties": { "url": "http://identifiers.org/ncbigene/84166", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "NLR family, CARD domain containing 5" }, "metanode": "Gene" }, { "id": 17574, "identifier": "6276", "identifier_type": "int", "name": "S100A5", "properties": { "url": "http://identifiers.org/ncbigene/6276", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "S100 calcium binding protein A5" }, "metanode": "Gene" }, { "id": 17575, "identifier": "27249", "identifier_type": "int", "name": "MMADHC", "properties": { "url": "http://identifiers.org/ncbigene/27249", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "methylmalonic aciduria (cobalamin deficiency) cblD type, with homocystinuria" }, "metanode": "Gene" }, { "id": 17576, "identifier": "101929798", "identifier_type": "int", "name": "LOC101929798", "properties": { "url": "http://identifiers.org/ncbigene/101929798", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "myomegalin-like" }, "metanode": "Gene" }, { "id": 17577, "identifier": "GO:0009298", "identifier_type": "str", "name": "GDP-mannose biosynthetic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0009298", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 17578, "identifier": "2802", "identifier_type": "int", "name": "GOLGA3", "properties": { "url": "http://identifiers.org/ncbigene/2802", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "golgin A3" }, "metanode": "Gene" }, { "id": 17579, "identifier": "GO:0051382", "identifier_type": "str", "name": "kinetochore assembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0051382", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 17580, "identifier": "386682", "identifier_type": "int", "name": "KRTAP10-3", "properties": { "url": "http://identifiers.org/ncbigene/386682", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "21", "description": "keratin associated protein 10-3" }, "metanode": "Gene" }, { "id": 17581, "identifier": "1108", "identifier_type": "int", "name": "CHD4", "properties": { "url": "http://identifiers.org/ncbigene/1108", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "chromodomain helicase DNA binding protein 4" }, "metanode": "Gene" }, { "id": 17582, "identifier": "9615", "identifier_type": "int", "name": "GDA", "properties": { "url": "http://identifiers.org/ncbigene/9615", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "9", "description": "guanine deaminase" }, "metanode": "Gene" }, { "id": 17583, "identifier": "51002", "identifier_type": "int", "name": "TPRKB", "properties": { "url": "http://identifiers.org/ncbigene/51002", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "TP53RK binding protein" }, "metanode": "Gene" }, { "id": 17584, "identifier": "C0278034", "identifier_type": "str", "name": "Cloudy urine", "properties": { "url": "http://identifiers.org/umls/C0278034", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 17585, "identifier": "GO:0008310", "identifier_type": "str", "name": "single-stranded DNA 3'-5' exodeoxyribonuclease activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0008310", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 17586, "identifier": "203238", "identifier_type": "int", "name": "CCDC171", "properties": { "url": "http://identifiers.org/ncbigene/203238", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "9", "description": "coiled-coil domain containing 171" }, "metanode": "Gene" }, { "id": 17587, "identifier": "253260", "identifier_type": "int", "name": "RICTOR", "properties": { "url": "http://identifiers.org/ncbigene/253260", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "RPTOR independent companion of MTOR, complex 2" }, "metanode": "Gene" }, { "id": 17588, "identifier": "GO:0046855", "identifier_type": "str", "name": "inositol phosphate dephosphorylation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0046855", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 17589, "identifier": "5902", "identifier_type": "int", "name": "RANBP1", "properties": { "url": "http://identifiers.org/ncbigene/5902", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "22", "description": "RAN binding protein 1" }, "metanode": "Gene" } ] }