Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=17575
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=17600",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=17550",
    "results": [
        {
            "id": 17565,
            "identifier": "5578",
            "identifier_type": "int",
            "name": "PRKCA",
            "properties": {
                "url": "http://identifiers.org/ncbigene/5578",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "17",
                "description": "protein kinase C, alpha"
            },
            "metanode": "Gene"
        },
        {
            "id": 17566,
            "identifier": "GO:0012502",
            "identifier_type": "str",
            "name": "induction of programmed cell death",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0012502",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 17567,
            "identifier": "113230",
            "identifier_type": "int",
            "name": "LOC113230",
            "properties": {
                "url": "http://identifiers.org/ncbigene/113230",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "uncharacterized protein LOC113230"
            },
            "metanode": "Gene"
        },
        {
            "id": 17568,
            "identifier": "23545",
            "identifier_type": "int",
            "name": "ATP6V0A2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/23545",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "ATPase, H+ transporting, lysosomal V0 subunit a2"
            },
            "metanode": "Gene"
        },
        {
            "id": 17569,
            "identifier": "C0016385",
            "identifier_type": "str",
            "name": "Cardiac flutter",
            "properties": {
                "url": "http://identifiers.org/umls/C0016385",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 17570,
            "identifier": "GO:0071549",
            "identifier_type": "str",
            "name": "cellular response to dexamethasone stimulus",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071549",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 17571,
            "identifier": "64756",
            "identifier_type": "int",
            "name": "ATPAF1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/64756",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "ATP synthase mitochondrial F1 complex assembly factor 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 17572,
            "identifier": "DB01033",
            "identifier_type": "str",
            "name": "Mercaptopurine",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB01033",
                "inchi": "InChI=1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10)",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=GLVAUDGFNGKCSF-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 17573,
            "identifier": "84166",
            "identifier_type": "int",
            "name": "NLRC5",
            "properties": {
                "url": "http://identifiers.org/ncbigene/84166",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "16",
                "description": "NLR family, CARD domain containing 5"
            },
            "metanode": "Gene"
        },
        {
            "id": 17574,
            "identifier": "6276",
            "identifier_type": "int",
            "name": "S100A5",
            "properties": {
                "url": "http://identifiers.org/ncbigene/6276",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "S100 calcium binding protein A5"
            },
            "metanode": "Gene"
        },
        {
            "id": 17575,
            "identifier": "27249",
            "identifier_type": "int",
            "name": "MMADHC",
            "properties": {
                "url": "http://identifiers.org/ncbigene/27249",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "methylmalonic aciduria (cobalamin deficiency) cblD type, with homocystinuria"
            },
            "metanode": "Gene"
        },
        {
            "id": 17576,
            "identifier": "101929798",
            "identifier_type": "int",
            "name": "LOC101929798",
            "properties": {
                "url": "http://identifiers.org/ncbigene/101929798",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "myomegalin-like"
            },
            "metanode": "Gene"
        },
        {
            "id": 17577,
            "identifier": "GO:0009298",
            "identifier_type": "str",
            "name": "GDP-mannose biosynthetic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0009298",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 17578,
            "identifier": "2802",
            "identifier_type": "int",
            "name": "GOLGA3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/2802",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "golgin A3"
            },
            "metanode": "Gene"
        },
        {
            "id": 17579,
            "identifier": "GO:0051382",
            "identifier_type": "str",
            "name": "kinetochore assembly",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0051382",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 17580,
            "identifier": "386682",
            "identifier_type": "int",
            "name": "KRTAP10-3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/386682",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "21",
                "description": "keratin associated protein 10-3"
            },
            "metanode": "Gene"
        },
        {
            "id": 17581,
            "identifier": "1108",
            "identifier_type": "int",
            "name": "CHD4",
            "properties": {
                "url": "http://identifiers.org/ncbigene/1108",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "chromodomain helicase DNA binding protein 4"
            },
            "metanode": "Gene"
        },
        {
            "id": 17582,
            "identifier": "9615",
            "identifier_type": "int",
            "name": "GDA",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9615",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "9",
                "description": "guanine deaminase"
            },
            "metanode": "Gene"
        },
        {
            "id": 17583,
            "identifier": "51002",
            "identifier_type": "int",
            "name": "TPRKB",
            "properties": {
                "url": "http://identifiers.org/ncbigene/51002",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "TP53RK binding protein"
            },
            "metanode": "Gene"
        },
        {
            "id": 17584,
            "identifier": "C0278034",
            "identifier_type": "str",
            "name": "Cloudy urine",
            "properties": {
                "url": "http://identifiers.org/umls/C0278034",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 17585,
            "identifier": "GO:0008310",
            "identifier_type": "str",
            "name": "single-stranded DNA 3'-5' exodeoxyribonuclease activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0008310",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 17586,
            "identifier": "203238",
            "identifier_type": "int",
            "name": "CCDC171",
            "properties": {
                "url": "http://identifiers.org/ncbigene/203238",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "9",
                "description": "coiled-coil domain containing 171"
            },
            "metanode": "Gene"
        },
        {
            "id": 17587,
            "identifier": "253260",
            "identifier_type": "int",
            "name": "RICTOR",
            "properties": {
                "url": "http://identifiers.org/ncbigene/253260",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "5",
                "description": "RPTOR independent companion of MTOR, complex 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 17588,
            "identifier": "GO:0046855",
            "identifier_type": "str",
            "name": "inositol phosphate dephosphorylation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0046855",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 17589,
            "identifier": "5902",
            "identifier_type": "int",
            "name": "RANBP1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/5902",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "22",
                "description": "RAN binding protein 1"
            },
            "metanode": "Gene"
        }
    ]
}