Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=18250
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=18275", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=18225", "results": [ { "id": 18241, "identifier": "GO:0060993", "identifier_type": "str", "name": "kidney morphogenesis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0060993", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 18242, "identifier": "84651", "identifier_type": "int", "name": "SPINK7", "properties": { "url": "http://identifiers.org/ncbigene/84651", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "serine peptidase inhibitor, Kazal type 7 (putative)" }, "metanode": "Gene" }, { "id": 18243, "identifier": "GO:0010991", "identifier_type": "str", "name": "negative regulation of SMAD protein complex assembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0010991", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 18244, "identifier": "668", "identifier_type": "int", "name": "FOXL2", "properties": { "url": "http://identifiers.org/ncbigene/668", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "forkhead box L2" }, "metanode": "Gene" }, { "id": 18245, "identifier": "GO:0016427", "identifier_type": "str", "name": "tRNA (cytosine) methyltransferase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0016427", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 18246, "identifier": "6670", "identifier_type": "int", "name": "SP3", "properties": { "url": "http://identifiers.org/ncbigene/6670", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "Sp3 transcription factor" }, "metanode": "Gene" }, { "id": 18247, "identifier": "GO:0009205", "identifier_type": "str", "name": "purine ribonucleoside triphosphate metabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0009205", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 18248, "identifier": "N0000000100", "identifier_type": "str", "name": "Estrogen Receptor Agonists", "properties": { "url": "http://purl.bioontology.org/ontology/NDFRT/N0000000100", "source": "FDA via DrugCentral", "license": "CC BY 4.0", "class_type": "Mechanism of Action" }, "metanode": "Pharmacologic Class" }, { "id": 18249, "identifier": "UBERON:0001044", "identifier_type": "str", "name": "saliva-secreting gland", "properties": { "url": "http://purl.obolibrary.org/obo/UBERON_0001044", "bto_id": "BTO:0001203", "source": "Uberon", "license": "CC BY 3.0", "mesh_id": "D012469" }, "metanode": "Anatomy" }, { "id": 18250, "identifier": "117532", "identifier_type": "int", "name": "TMC2", "properties": { "url": "http://identifiers.org/ncbigene/117532", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "transmembrane channel-like 2" }, "metanode": "Gene" }, { "id": 18251, "identifier": "388439", "identifier_type": "int", "name": "FLJ12120", "properties": { "url": "http://identifiers.org/ncbigene/388439", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "uncharacterized LOC388439" }, "metanode": "Gene" }, { "id": 18252, "identifier": "9993", "identifier_type": "int", "name": "DGCR2", "properties": { "url": "http://identifiers.org/ncbigene/9993", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "22", "description": "DiGeorge syndrome critical region gene 2" }, "metanode": "Gene" }, { "id": 18253, "identifier": "201163", "identifier_type": "int", "name": "FLCN", "properties": { "url": "http://identifiers.org/ncbigene/201163", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "folliculin" }, "metanode": "Gene" }, { "id": 18254, "identifier": "DB00945", "identifier_type": "str", "name": "Acetylsalicylic acid", "properties": { "url": "http://www.drugbank.ca/drugs/DB00945", "inchi": "InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=BSYNRYMUTXBXSQ-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 18255, "identifier": "390892", "identifier_type": "int", "name": "OR7A10", "properties": { "url": "http://identifiers.org/ncbigene/390892", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "olfactory receptor, family 7, subfamily A, member 10" }, "metanode": "Gene" }, { "id": 18256, "identifier": "3955", "identifier_type": "int", "name": "LFNG", "properties": { "url": "http://identifiers.org/ncbigene/3955", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase" }, "metanode": "Gene" }, { "id": 18257, "identifier": "8366", "identifier_type": "int", "name": "HIST1H4B", "properties": { "url": "http://identifiers.org/ncbigene/8366", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "histone cluster 1, H4b" }, "metanode": "Gene" }, { "id": 18258, "identifier": "GO:0042517", "identifier_type": "str", "name": "positive regulation of tyrosine phosphorylation of Stat3 protein", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0042517", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 18259, "identifier": "GO:0033829", "identifier_type": "str", "name": "O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0033829", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 18260, "identifier": "2184", "identifier_type": "int", "name": "FAH", "properties": { "url": "http://identifiers.org/ncbigene/2184", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "15", "description": "fumarylacetoacetate hydrolase (fumarylacetoacetase)" }, "metanode": "Gene" }, { "id": 18261, "identifier": "10947", "identifier_type": "int", "name": "AP3M2", "properties": { "url": "http://identifiers.org/ncbigene/10947", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "adaptor-related protein complex 3, mu 2 subunit" }, "metanode": "Gene" }, { "id": 18262, "identifier": "120939", "identifier_type": "int", "name": "TMEM52B", "properties": { "url": "http://identifiers.org/ncbigene/120939", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "transmembrane protein 52B" }, "metanode": "Gene" }, { "id": 18263, "identifier": "129446", "identifier_type": "int", "name": "XIRP2", "properties": { "url": "http://identifiers.org/ncbigene/129446", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "xin actin binding repeat containing 2" }, "metanode": "Gene" }, { "id": 18264, "identifier": "4653", "identifier_type": "int", "name": "MYOC", "properties": { "url": "http://identifiers.org/ncbigene/4653", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "myocilin, trabecular meshwork inducible glucocorticoid response" }, "metanode": "Gene" }, { "id": 18265, "identifier": "54675", "identifier_type": "int", "name": "CRLS1", "properties": { "url": "http://identifiers.org/ncbigene/54675", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "cardiolipin synthase 1" }, "metanode": "Gene" } ] }