Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=18250
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=18275",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=18225",
    "results": [
        {
            "id": 18241,
            "identifier": "GO:0060993",
            "identifier_type": "str",
            "name": "kidney morphogenesis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0060993",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 18242,
            "identifier": "84651",
            "identifier_type": "int",
            "name": "SPINK7",
            "properties": {
                "url": "http://identifiers.org/ncbigene/84651",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "5",
                "description": "serine peptidase inhibitor, Kazal type 7 (putative)"
            },
            "metanode": "Gene"
        },
        {
            "id": 18243,
            "identifier": "GO:0010991",
            "identifier_type": "str",
            "name": "negative regulation of SMAD protein complex assembly",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0010991",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 18244,
            "identifier": "668",
            "identifier_type": "int",
            "name": "FOXL2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/668",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "forkhead box L2"
            },
            "metanode": "Gene"
        },
        {
            "id": 18245,
            "identifier": "GO:0016427",
            "identifier_type": "str",
            "name": "tRNA (cytosine) methyltransferase activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0016427",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 18246,
            "identifier": "6670",
            "identifier_type": "int",
            "name": "SP3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/6670",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "Sp3 transcription factor"
            },
            "metanode": "Gene"
        },
        {
            "id": 18247,
            "identifier": "GO:0009205",
            "identifier_type": "str",
            "name": "purine ribonucleoside triphosphate metabolic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0009205",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 18248,
            "identifier": "N0000000100",
            "identifier_type": "str",
            "name": "Estrogen Receptor Agonists",
            "properties": {
                "url": "http://purl.bioontology.org/ontology/NDFRT/N0000000100",
                "source": "FDA via DrugCentral",
                "license": "CC BY 4.0",
                "class_type": "Mechanism of Action"
            },
            "metanode": "Pharmacologic Class"
        },
        {
            "id": 18249,
            "identifier": "UBERON:0001044",
            "identifier_type": "str",
            "name": "saliva-secreting gland",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/UBERON_0001044",
                "bto_id": "BTO:0001203",
                "source": "Uberon",
                "license": "CC BY 3.0",
                "mesh_id": "D012469"
            },
            "metanode": "Anatomy"
        },
        {
            "id": 18250,
            "identifier": "117532",
            "identifier_type": "int",
            "name": "TMC2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/117532",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "transmembrane channel-like 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 18251,
            "identifier": "388439",
            "identifier_type": "int",
            "name": "FLJ12120",
            "properties": {
                "url": "http://identifiers.org/ncbigene/388439",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "17",
                "description": "uncharacterized LOC388439"
            },
            "metanode": "Gene"
        },
        {
            "id": 18252,
            "identifier": "9993",
            "identifier_type": "int",
            "name": "DGCR2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9993",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "22",
                "description": "DiGeorge syndrome critical region gene 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 18253,
            "identifier": "201163",
            "identifier_type": "int",
            "name": "FLCN",
            "properties": {
                "url": "http://identifiers.org/ncbigene/201163",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "17",
                "description": "folliculin"
            },
            "metanode": "Gene"
        },
        {
            "id": 18254,
            "identifier": "DB00945",
            "identifier_type": "str",
            "name": "Acetylsalicylic acid",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB00945",
                "inchi": "InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=BSYNRYMUTXBXSQ-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 18255,
            "identifier": "390892",
            "identifier_type": "int",
            "name": "OR7A10",
            "properties": {
                "url": "http://identifiers.org/ncbigene/390892",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "olfactory receptor, family 7, subfamily A, member 10"
            },
            "metanode": "Gene"
        },
        {
            "id": 18256,
            "identifier": "3955",
            "identifier_type": "int",
            "name": "LFNG",
            "properties": {
                "url": "http://identifiers.org/ncbigene/3955",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "7",
                "description": "LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase"
            },
            "metanode": "Gene"
        },
        {
            "id": 18257,
            "identifier": "8366",
            "identifier_type": "int",
            "name": "HIST1H4B",
            "properties": {
                "url": "http://identifiers.org/ncbigene/8366",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "histone cluster 1, H4b"
            },
            "metanode": "Gene"
        },
        {
            "id": 18258,
            "identifier": "GO:0042517",
            "identifier_type": "str",
            "name": "positive regulation of tyrosine phosphorylation of Stat3 protein",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0042517",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 18259,
            "identifier": "GO:0033829",
            "identifier_type": "str",
            "name": "O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0033829",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 18260,
            "identifier": "2184",
            "identifier_type": "int",
            "name": "FAH",
            "properties": {
                "url": "http://identifiers.org/ncbigene/2184",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "15",
                "description": "fumarylacetoacetate hydrolase (fumarylacetoacetase)"
            },
            "metanode": "Gene"
        },
        {
            "id": 18261,
            "identifier": "10947",
            "identifier_type": "int",
            "name": "AP3M2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/10947",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "8",
                "description": "adaptor-related protein complex 3, mu 2 subunit"
            },
            "metanode": "Gene"
        },
        {
            "id": 18262,
            "identifier": "120939",
            "identifier_type": "int",
            "name": "TMEM52B",
            "properties": {
                "url": "http://identifiers.org/ncbigene/120939",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "transmembrane protein 52B"
            },
            "metanode": "Gene"
        },
        {
            "id": 18263,
            "identifier": "129446",
            "identifier_type": "int",
            "name": "XIRP2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/129446",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "xin actin binding repeat containing 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 18264,
            "identifier": "4653",
            "identifier_type": "int",
            "name": "MYOC",
            "properties": {
                "url": "http://identifiers.org/ncbigene/4653",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "myocilin, trabecular meshwork inducible glucocorticoid response"
            },
            "metanode": "Gene"
        },
        {
            "id": 18265,
            "identifier": "54675",
            "identifier_type": "int",
            "name": "CRLS1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/54675",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "cardiolipin synthase 1"
            },
            "metanode": "Gene"
        }
    ]
}