Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=19000
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=19025",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=18975",
    "results": [
        {
            "id": 18991,
            "identifier": "GO:1902804",
            "identifier_type": "str",
            "name": "negative regulation of synaptic vesicle transport",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1902804",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 18992,
            "identifier": "105371448",
            "identifier_type": "int",
            "name": "LOC105371448",
            "properties": {
                "url": "http://identifiers.org/ncbigene/105371448",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "immunoglobulin superfamily DCC subclass member 3-like"
            },
            "metanode": "Gene"
        },
        {
            "id": 18993,
            "identifier": "WP699_r70509",
            "identifier_type": "str",
            "name": "Aflatoxin B1 metabolism",
            "properties": {
                "url": "http://www.wikipathways.org/instance/WP699_r70509",
                "source": "WikiPathways",
                "license": "CC BY 3.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 18994,
            "identifier": "GO:0090279",
            "identifier_type": "str",
            "name": "regulation of calcium ion import",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0090279",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 18995,
            "identifier": "6873",
            "identifier_type": "int",
            "name": "TAF2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/6873",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "8",
                "description": "TAF2 RNA polymerase II, TATA box binding protein (TBP)-associated factor, 150kDa"
            },
            "metanode": "Gene"
        },
        {
            "id": 18996,
            "identifier": "GO:0007067",
            "identifier_type": "str",
            "name": "mitotic nuclear division",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0007067",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 18997,
            "identifier": "56911",
            "identifier_type": "int",
            "name": "MAP3K7CL",
            "properties": {
                "url": "http://identifiers.org/ncbigene/56911",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "21",
                "description": "MAP3K7 C-terminal like"
            },
            "metanode": "Gene"
        },
        {
            "id": 18998,
            "identifier": "GO:0032416",
            "identifier_type": "str",
            "name": "negative regulation of sodium:proton antiporter activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0032416",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 18999,
            "identifier": "DB00344",
            "identifier_type": "str",
            "name": "Protriptyline",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB00344",
                "inchi": "InChI=1S/C19H21N/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19/h2-5,7-10,12-13,19-20H,6,11,14H2,1H3",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=BWPIARFWQZKAIA-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 19000,
            "identifier": "GO:0031444",
            "identifier_type": "str",
            "name": "slow-twitch skeletal muscle fiber contraction",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0031444",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 19001,
            "identifier": "GO:0022838",
            "identifier_type": "str",
            "name": "substrate-specific channel activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0022838",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 19002,
            "identifier": "100287171",
            "identifier_type": "int",
            "name": "WASH1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/100287171",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "9",
                "description": "WAS protein family homolog 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 19003,
            "identifier": "10212",
            "identifier_type": "int",
            "name": "DDX39A",
            "properties": {
                "url": "http://identifiers.org/ncbigene/10212",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "DEAD (Asp-Glu-Ala-Asp) box polypeptide 39A"
            },
            "metanode": "Gene"
        },
        {
            "id": 19004,
            "identifier": "GO:0060795",
            "identifier_type": "str",
            "name": "cell fate commitment involved in formation of primary germ layer",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0060795",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 19005,
            "identifier": "128368",
            "identifier_type": "int",
            "name": "OR10Z1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/128368",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "olfactory receptor, family 10, subfamily Z, member 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 19006,
            "identifier": "GO:0000711",
            "identifier_type": "str",
            "name": "meiotic DNA repair synthesis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0000711",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 19007,
            "identifier": "4046",
            "identifier_type": "int",
            "name": "LSP1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/4046",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "11",
                "description": "lymphocyte-specific protein 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 19223,
            "identifier": "GO:0032258",
            "identifier_type": "str",
            "name": "CVT pathway",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0032258",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 19008,
            "identifier": "8569",
            "identifier_type": "int",
            "name": "MKNK1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/8569",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "MAP kinase interacting serine/threonine kinase 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 19009,
            "identifier": "GO:0046621",
            "identifier_type": "str",
            "name": "negative regulation of organ growth",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0046621",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 19010,
            "identifier": "GO:1903895",
            "identifier_type": "str",
            "name": "negative regulation of IRE1-mediated unfolded protein response",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1903895",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 19011,
            "identifier": "GO:0035965",
            "identifier_type": "str",
            "name": "cardiolipin acyl-chain remodeling",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0035965",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 19012,
            "identifier": "646817",
            "identifier_type": "int",
            "name": "SETSIP",
            "properties": {
                "url": "http://identifiers.org/ncbigene/646817",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "SET-like protein"
            },
            "metanode": "Gene"
        },
        {
            "id": 19013,
            "identifier": "GO:0006768",
            "identifier_type": "str",
            "name": "biotin metabolic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0006768",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 19014,
            "identifier": "GO:0003044",
            "identifier_type": "str",
            "name": "regulation of systemic arterial blood pressure mediated by a chemical signal",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0003044",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        }
    ]
}