Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=19000
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=19025", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=18975", "results": [ { "id": 18991, "identifier": "GO:1902804", "identifier_type": "str", "name": "negative regulation of synaptic vesicle transport", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1902804", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 18992, "identifier": "105371448", "identifier_type": "int", "name": "LOC105371448", "properties": { "url": "http://identifiers.org/ncbigene/105371448", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "immunoglobulin superfamily DCC subclass member 3-like" }, "metanode": "Gene" }, { "id": 18993, "identifier": "WP699_r70509", "identifier_type": "str", "name": "Aflatoxin B1 metabolism", "properties": { "url": "http://www.wikipathways.org/instance/WP699_r70509", "source": "WikiPathways", "license": "CC BY 3.0" }, "metanode": "Pathway" }, { "id": 18994, "identifier": "GO:0090279", "identifier_type": "str", "name": "regulation of calcium ion import", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0090279", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 18995, "identifier": "6873", "identifier_type": "int", "name": "TAF2", "properties": { "url": "http://identifiers.org/ncbigene/6873", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "TAF2 RNA polymerase II, TATA box binding protein (TBP)-associated factor, 150kDa" }, "metanode": "Gene" }, { "id": 18996, "identifier": "GO:0007067", "identifier_type": "str", "name": "mitotic nuclear division", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0007067", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 18997, "identifier": "56911", "identifier_type": "int", "name": "MAP3K7CL", "properties": { "url": "http://identifiers.org/ncbigene/56911", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "21", "description": "MAP3K7 C-terminal like" }, "metanode": "Gene" }, { "id": 18998, "identifier": "GO:0032416", "identifier_type": "str", "name": "negative regulation of sodium:proton antiporter activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0032416", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 18999, "identifier": "DB00344", "identifier_type": "str", "name": "Protriptyline", "properties": { "url": "http://www.drugbank.ca/drugs/DB00344", "inchi": "InChI=1S/C19H21N/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19/h2-5,7-10,12-13,19-20H,6,11,14H2,1H3", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=BWPIARFWQZKAIA-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 19000, "identifier": "GO:0031444", "identifier_type": "str", "name": "slow-twitch skeletal muscle fiber contraction", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0031444", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19001, "identifier": "GO:0022838", "identifier_type": "str", "name": "substrate-specific channel activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0022838", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 19002, "identifier": "100287171", "identifier_type": "int", "name": "WASH1", "properties": { "url": "http://identifiers.org/ncbigene/100287171", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "9", "description": "WAS protein family homolog 1" }, "metanode": "Gene" }, { "id": 19003, "identifier": "10212", "identifier_type": "int", "name": "DDX39A", "properties": { "url": "http://identifiers.org/ncbigene/10212", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "DEAD (Asp-Glu-Ala-Asp) box polypeptide 39A" }, "metanode": "Gene" }, { "id": 19004, "identifier": "GO:0060795", "identifier_type": "str", "name": "cell fate commitment involved in formation of primary germ layer", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0060795", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19005, "identifier": "128368", "identifier_type": "int", "name": "OR10Z1", "properties": { "url": "http://identifiers.org/ncbigene/128368", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "olfactory receptor, family 10, subfamily Z, member 1" }, "metanode": "Gene" }, { "id": 19006, "identifier": "GO:0000711", "identifier_type": "str", "name": "meiotic DNA repair synthesis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0000711", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19007, "identifier": "4046", "identifier_type": "int", "name": "LSP1", "properties": { "url": "http://identifiers.org/ncbigene/4046", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "lymphocyte-specific protein 1" }, "metanode": "Gene" }, { "id": 19223, "identifier": "GO:0032258", "identifier_type": "str", "name": "CVT pathway", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0032258", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19008, "identifier": "8569", "identifier_type": "int", "name": "MKNK1", "properties": { "url": "http://identifiers.org/ncbigene/8569", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "MAP kinase interacting serine/threonine kinase 1" }, "metanode": "Gene" }, { "id": 19009, "identifier": "GO:0046621", "identifier_type": "str", "name": "negative regulation of organ growth", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0046621", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19010, "identifier": "GO:1903895", "identifier_type": "str", "name": "negative regulation of IRE1-mediated unfolded protein response", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1903895", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19011, "identifier": "GO:0035965", "identifier_type": "str", "name": "cardiolipin acyl-chain remodeling", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0035965", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19012, "identifier": "646817", "identifier_type": "int", "name": "SETSIP", "properties": { "url": "http://identifiers.org/ncbigene/646817", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "SET-like protein" }, "metanode": "Gene" }, { "id": 19013, "identifier": "GO:0006768", "identifier_type": "str", "name": "biotin metabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0006768", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19014, "identifier": "GO:0003044", "identifier_type": "str", "name": "regulation of systemic arterial blood pressure mediated by a chemical signal", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0003044", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" } ] }