Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=19175
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=19200", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=19150", "results": [ { "id": 19165, "identifier": "80212", "identifier_type": "int", "name": "CCDC92", "properties": { "url": "http://identifiers.org/ncbigene/80212", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "coiled-coil domain containing 92" }, "metanode": "Gene" }, { "id": 19166, "identifier": "130106", "identifier_type": "int", "name": "CIB4", "properties": { "url": "http://identifiers.org/ncbigene/130106", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "calcium and integrin binding family member 4" }, "metanode": "Gene" }, { "id": 19167, "identifier": "GO:2001240", "identifier_type": "str", "name": "negative regulation of extrinsic apoptotic signaling pathway in absence of ligand", "properties": { "url": "http://purl.obolibrary.org/obo/GO_2001240", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19168, "identifier": "5441", "identifier_type": "int", "name": "POLR2L", "properties": { "url": "http://identifiers.org/ncbigene/5441", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "polymerase (RNA) II (DNA directed) polypeptide L, 7.6kDa" }, "metanode": "Gene" }, { "id": 19169, "identifier": "51255", "identifier_type": "int", "name": "RNF181", "properties": { "url": "http://identifiers.org/ncbigene/51255", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "ring finger protein 181" }, "metanode": "Gene" }, { "id": 19170, "identifier": "UBERON:0001911", "identifier_type": "str", "name": "mammary gland", "properties": { "url": "http://purl.obolibrary.org/obo/UBERON_0001911", "bto_id": "BTO:0000817", "source": "Uberon", "license": "CC BY 3.0", "mesh_id": "D008321" }, "metanode": "Anatomy" }, { "id": 19171, "identifier": "GO:1901016", "identifier_type": "str", "name": "regulation of potassium ion transmembrane transporter activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1901016", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19172, "identifier": "GO:0048554", "identifier_type": "str", "name": "positive regulation of metalloenzyme activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0048554", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19173, "identifier": "D006456", "identifier_type": "str", "name": "Hemoglobinuria", "properties": { "url": "http://identifiers.org/mesh/D006456", "source": "MeSH", "license": "CC0 1.0" }, "metanode": "Symptom" }, { "id": 19174, "identifier": "205860", "identifier_type": "int", "name": "TRIML2", "properties": { "url": "http://identifiers.org/ncbigene/205860", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "4", "description": "tripartite motif family-like 2" }, "metanode": "Gene" }, { "id": 19175, "identifier": "2079", "identifier_type": "int", "name": "ERH", "properties": { "url": "http://identifiers.org/ncbigene/2079", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "14", "description": "enhancer of rudimentary homolog (Drosophila)" }, "metanode": "Gene" }, { "id": 19176, "identifier": "23408", "identifier_type": "int", "name": "SIRT5", "properties": { "url": "http://identifiers.org/ncbigene/23408", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "sirtuin 5" }, "metanode": "Gene" }, { "id": 19177, "identifier": "10826", "identifier_type": "int", "name": "FAXDC2", "properties": { "url": "http://identifiers.org/ncbigene/10826", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "fatty acid hydroxylase domain containing 2" }, "metanode": "Gene" }, { "id": 19178, "identifier": "53836", "identifier_type": "int", "name": "GPR87", "properties": { "url": "http://identifiers.org/ncbigene/53836", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "G protein-coupled receptor 87" }, "metanode": "Gene" }, { "id": 19179, "identifier": "GO:0097531", "identifier_type": "str", "name": "mast cell migration", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0097531", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19180, "identifier": "DB00440", "identifier_type": "str", "name": "Trimethoprim", "properties": { "url": "http://www.drugbank.ca/drugs/DB00440", "inchi": "InChI=1S/C14H18N4O3/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15/h5-7H,4H2,1-3H3,(H4,15,16,17,18)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=IEDVJHCEMCRBQM-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 19181, "identifier": "6267", "identifier_type": "int", "name": "S11", "properties": { "url": "http://identifiers.org/ncbigene/6267", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "surface antigen (X-linked) 2" }, "metanode": "Gene" }, { "id": 19182, "identifier": "GO:0021626", "identifier_type": "str", "name": "central nervous system maturation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0021626", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 19183, "identifier": "DB00857", "identifier_type": "str", "name": "Terbinafine", "properties": { "url": "http://www.drugbank.ca/drugs/DB00857", "inchi": "InChI=1S/C21H25N/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19/h5-7,9-14H,16-17H2,1-4H3/b9-5+", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=DOMXUEMWDBAQBQ-WEVVVXLNSA-N" }, "metanode": "Compound" }, { "id": 19184, "identifier": "79838", "identifier_type": "int", "name": "TMC5", "properties": { "url": "http://identifiers.org/ncbigene/79838", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "transmembrane channel-like 5" }, "metanode": "Gene" }, { "id": 19185, "identifier": "971", "identifier_type": "int", "name": "CD72", "properties": { "url": "http://identifiers.org/ncbigene/971", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "9", "description": "CD72 molecule" }, "metanode": "Gene" }, { "id": 19186, "identifier": "9478", "identifier_type": "int", "name": "CABP1", "properties": { "url": "http://identifiers.org/ncbigene/9478", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "calcium binding protein 1" }, "metanode": "Gene" }, { "id": 19402, "identifier": "GO:0016589", "identifier_type": "str", "name": "NURF complex", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0016589", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 19187, "identifier": "50865", "identifier_type": "int", "name": "HEBP1", "properties": { "url": "http://identifiers.org/ncbigene/50865", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "heme binding protein 1" }, "metanode": "Gene" }, { "id": 19188, "identifier": "728888", "identifier_type": "int", "name": "NPIPB11", "properties": { "url": "http://identifiers.org/ncbigene/728888", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "nuclear pore complex interacting protein family, member B11" }, "metanode": "Gene" } ] }