Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=21775
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=21800", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=21750", "results": [ { "id": 21766, "identifier": "GO:0031644", "identifier_type": "str", "name": "regulation of neurological system process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0031644", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 21767, "identifier": "DB01609", "identifier_type": "str", "name": "Deferasirox", "properties": { "url": "http://www.drugbank.ca/drugs/DB01609", "inchi": "InChI=1S/C21H15N3O4/c25-17-7-3-1-5-15(17)19-22-20(16-6-2-4-8-18(16)26)24(23-19)14-11-9-13(10-12-14)21(27)28/h1-12,25-26H,(H,27,28)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=BOFQWVMAQOTZIW-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 21768, "identifier": "GO:0061050", "identifier_type": "str", "name": "regulation of cell growth involved in cardiac muscle cell development", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0061050", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 21769, "identifier": "1591", "identifier_type": "int", "name": "CYP24A1", "properties": { "url": "http://identifiers.org/ncbigene/1591", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "cytochrome P450, family 24, subfamily A, polypeptide 1" }, "metanode": "Gene" }, { "id": 21770, "identifier": "GO:0043025", "identifier_type": "str", "name": "neuronal cell body", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0043025", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 21771, "identifier": "PC7_5981", "identifier_type": "str", "name": "Notch signaling pathway", "properties": { "source": "PID via Pathway Commons", "license": "CC0 1.0" }, "metanode": "Pathway" }, { "id": 21772, "identifier": "GO:0061010", "identifier_type": "str", "name": "gall bladder development", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0061010", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 21773, "identifier": "8507", "identifier_type": "int", "name": "ENC1", "properties": { "url": "http://identifiers.org/ncbigene/8507", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "ectodermal-neural cortex 1 (with BTB domain)" }, "metanode": "Gene" }, { "id": 21774, "identifier": "58529", "identifier_type": "int", "name": "MYOZ1", "properties": { "url": "http://identifiers.org/ncbigene/58529", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "10", "description": "myozenin 1" }, "metanode": "Gene" }, { "id": 21775, "identifier": "GO:0002824", "identifier_type": "str", "name": "positive regulation of adaptive immune response based on somatic recombination of immune receptors built from immunoglobulin superfamily domains", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0002824", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 21776, "identifier": "GO:0031145", "identifier_type": "str", "name": "anaphase-promoting complex-dependent proteasomal ubiquitin-dependent protein catabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0031145", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 21777, "identifier": "DB00600", "identifier_type": "str", "name": "Monobenzone", "properties": { "url": "http://www.drugbank.ca/drugs/DB00600", "inchi": "InChI=1S/C13H12O2/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,14H,10H2", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=VYQNWZOUAUKGHI-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 21778, "identifier": "GO:0017112", "identifier_type": "str", "name": "Rab guanyl-nucleotide exchange factor activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0017112", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 21779, "identifier": "GO:0044539", "identifier_type": "str", "name": "long-chain fatty acid import", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0044539", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 21780, "identifier": "GO:0010008", "identifier_type": "str", "name": "endosome membrane", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0010008", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 21781, "identifier": "GO:0031208", "identifier_type": "str", "name": "POZ domain binding", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0031208", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 21782, "identifier": "286676", "identifier_type": "int", "name": "ILDR1", "properties": { "url": "http://identifiers.org/ncbigene/286676", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "immunoglobulin-like domain containing receptor 1" }, "metanode": "Gene" }, { "id": 21783, "identifier": "4794", "identifier_type": "int", "name": "NFKBIE", "properties": { "url": "http://identifiers.org/ncbigene/4794", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, epsilon" }, "metanode": "Gene" }, { "id": 21784, "identifier": "GO:0071345", "identifier_type": "str", "name": "cellular response to cytokine stimulus", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0071345", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 21785, "identifier": "GO:1901073", "identifier_type": "str", "name": "glucosamine-containing compound biosynthetic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1901073", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 21786, "identifier": "347516", "identifier_type": "int", "name": "DGAT2L6", "properties": { "url": "http://identifiers.org/ncbigene/347516", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "diacylglycerol O-acyltransferase 2-like 6" }, "metanode": "Gene" }, { "id": 21787, "identifier": "105375107", "identifier_type": "int", "name": "LOC105375107", "properties": { "url": "http://identifiers.org/ncbigene/105375107", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "uncharacterized LOC105375107" }, "metanode": "Gene" }, { "id": 21788, "identifier": "22889", "identifier_type": "int", "name": "KIAA0907", "properties": { "url": "http://identifiers.org/ncbigene/22889", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "KIAA0907" }, "metanode": "Gene" }, { "id": 21789, "identifier": "7391", "identifier_type": "int", "name": "USF1", "properties": { "url": "http://identifiers.org/ncbigene/7391", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "upstream transcription factor 1" }, "metanode": "Gene" }, { "id": 21790, "identifier": "7155", "identifier_type": "int", "name": "TOP2B", "properties": { "url": "http://identifiers.org/ncbigene/7155", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "topoisomerase (DNA) II beta 180kDa" }, "metanode": "Gene" } ] }