Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=21775
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=21800",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=21750",
    "results": [
        {
            "id": 21766,
            "identifier": "GO:0031644",
            "identifier_type": "str",
            "name": "regulation of neurological system process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0031644",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 21767,
            "identifier": "DB01609",
            "identifier_type": "str",
            "name": "Deferasirox",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB01609",
                "inchi": "InChI=1S/C21H15N3O4/c25-17-7-3-1-5-15(17)19-22-20(16-6-2-4-8-18(16)26)24(23-19)14-11-9-13(10-12-14)21(27)28/h1-12,25-26H,(H,27,28)",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=BOFQWVMAQOTZIW-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 21768,
            "identifier": "GO:0061050",
            "identifier_type": "str",
            "name": "regulation of cell growth involved in cardiac muscle cell development",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0061050",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 21769,
            "identifier": "1591",
            "identifier_type": "int",
            "name": "CYP24A1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/1591",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "cytochrome P450, family 24, subfamily A, polypeptide 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 21770,
            "identifier": "GO:0043025",
            "identifier_type": "str",
            "name": "neuronal cell body",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0043025",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 21771,
            "identifier": "PC7_5981",
            "identifier_type": "str",
            "name": "Notch signaling pathway",
            "properties": {
                "source": "PID via Pathway Commons",
                "license": "CC0 1.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 21772,
            "identifier": "GO:0061010",
            "identifier_type": "str",
            "name": "gall bladder development",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0061010",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 21773,
            "identifier": "8507",
            "identifier_type": "int",
            "name": "ENC1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/8507",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "5",
                "description": "ectodermal-neural cortex 1 (with BTB domain)"
            },
            "metanode": "Gene"
        },
        {
            "id": 21774,
            "identifier": "58529",
            "identifier_type": "int",
            "name": "MYOZ1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/58529",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "10",
                "description": "myozenin 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 21775,
            "identifier": "GO:0002824",
            "identifier_type": "str",
            "name": "positive regulation of adaptive immune response based on somatic recombination of immune receptors built from immunoglobulin superfamily domains",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0002824",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 21776,
            "identifier": "GO:0031145",
            "identifier_type": "str",
            "name": "anaphase-promoting complex-dependent proteasomal ubiquitin-dependent protein catabolic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0031145",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 21777,
            "identifier": "DB00600",
            "identifier_type": "str",
            "name": "Monobenzone",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB00600",
                "inchi": "InChI=1S/C13H12O2/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,14H,10H2",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=VYQNWZOUAUKGHI-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 21778,
            "identifier": "GO:0017112",
            "identifier_type": "str",
            "name": "Rab guanyl-nucleotide exchange factor activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0017112",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 21779,
            "identifier": "GO:0044539",
            "identifier_type": "str",
            "name": "long-chain fatty acid import",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0044539",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 21780,
            "identifier": "GO:0010008",
            "identifier_type": "str",
            "name": "endosome membrane",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0010008",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 21781,
            "identifier": "GO:0031208",
            "identifier_type": "str",
            "name": "POZ domain binding",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0031208",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 21782,
            "identifier": "286676",
            "identifier_type": "int",
            "name": "ILDR1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/286676",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "immunoglobulin-like domain containing receptor 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 21783,
            "identifier": "4794",
            "identifier_type": "int",
            "name": "NFKBIE",
            "properties": {
                "url": "http://identifiers.org/ncbigene/4794",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, epsilon"
            },
            "metanode": "Gene"
        },
        {
            "id": 21784,
            "identifier": "GO:0071345",
            "identifier_type": "str",
            "name": "cellular response to cytokine stimulus",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071345",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 21785,
            "identifier": "GO:1901073",
            "identifier_type": "str",
            "name": "glucosamine-containing compound biosynthetic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1901073",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 21786,
            "identifier": "347516",
            "identifier_type": "int",
            "name": "DGAT2L6",
            "properties": {
                "url": "http://identifiers.org/ncbigene/347516",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "X",
                "description": "diacylglycerol O-acyltransferase 2-like 6"
            },
            "metanode": "Gene"
        },
        {
            "id": 21787,
            "identifier": "105375107",
            "identifier_type": "int",
            "name": "LOC105375107",
            "properties": {
                "url": "http://identifiers.org/ncbigene/105375107",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "uncharacterized LOC105375107"
            },
            "metanode": "Gene"
        },
        {
            "id": 21788,
            "identifier": "22889",
            "identifier_type": "int",
            "name": "KIAA0907",
            "properties": {
                "url": "http://identifiers.org/ncbigene/22889",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "KIAA0907"
            },
            "metanode": "Gene"
        },
        {
            "id": 21789,
            "identifier": "7391",
            "identifier_type": "int",
            "name": "USF1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/7391",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "upstream transcription factor 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 21790,
            "identifier": "7155",
            "identifier_type": "int",
            "name": "TOP2B",
            "properties": {
                "url": "http://identifiers.org/ncbigene/7155",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "topoisomerase (DNA) II beta 180kDa"
            },
            "metanode": "Gene"
        }
    ]
}