Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=30200
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=30225",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=30175",
    "results": [
        {
            "id": 30194,
            "identifier": "GO:0004582",
            "identifier_type": "str",
            "name": "dolichyl-phosphate beta-D-mannosyltransferase activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0004582",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 30195,
            "identifier": "GO:0000993",
            "identifier_type": "str",
            "name": "RNA polymerase II core binding",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0000993",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 30231,
            "identifier": "GO:0010999",
            "identifier_type": "str",
            "name": "regulation of eIF2 alpha phosphorylation by heme",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0010999",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30196,
            "identifier": "338442",
            "identifier_type": "int",
            "name": "HCAR2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/338442",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "hydroxycarboxylic acid receptor 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 30197,
            "identifier": "GO:0009730",
            "identifier_type": "str",
            "name": "detection of carbohydrate stimulus",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0009730",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30198,
            "identifier": "148113",
            "identifier_type": "int",
            "name": "CILP2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/148113",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "cartilage intermediate layer protein 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 30199,
            "identifier": "25804",
            "identifier_type": "int",
            "name": "LSM4",
            "properties": {
                "url": "http://identifiers.org/ncbigene/25804",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "LSM4 homolog, U6 small nuclear RNA associated (S. cerevisiae)"
            },
            "metanode": "Gene"
        },
        {
            "id": 30200,
            "identifier": "1543",
            "identifier_type": "int",
            "name": "CYP1A1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/1543",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "15",
                "description": "cytochrome P450, family 1, subfamily A, polypeptide 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 30201,
            "identifier": "10162",
            "identifier_type": "int",
            "name": "LPCAT3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/10162",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "lysophosphatidylcholine acyltransferase 3"
            },
            "metanode": "Gene"
        },
        {
            "id": 30202,
            "identifier": "9180",
            "identifier_type": "int",
            "name": "OSMR",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9180",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "5",
                "description": "oncostatin M receptor"
            },
            "metanode": "Gene"
        },
        {
            "id": 30203,
            "identifier": "3996",
            "identifier_type": "int",
            "name": "LLGL1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/3996",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "17",
                "description": "lethal giant larvae homolog 1 (Drosophila)"
            },
            "metanode": "Gene"
        },
        {
            "id": 30204,
            "identifier": "8663",
            "identifier_type": "int",
            "name": "EIF3C",
            "properties": {
                "url": "http://identifiers.org/ncbigene/8663",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "16",
                "description": "eukaryotic translation initiation factor 3, subunit C"
            },
            "metanode": "Gene"
        },
        {
            "id": 30205,
            "identifier": "GO:0071506",
            "identifier_type": "str",
            "name": "cellular response to mycophenolic acid",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071506",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30206,
            "identifier": "GO:0006386",
            "identifier_type": "str",
            "name": "termination of RNA polymerase III transcription",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0006386",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30207,
            "identifier": "GO:0097033",
            "identifier_type": "str",
            "name": "mitochondrial respiratory chain complex III biogenesis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0097033",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30208,
            "identifier": "DB00237",
            "identifier_type": "str",
            "name": "Butabarbital",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB00237",
                "inchi": "InChI=1S/C10H16N2O3/c1-4-6(3)10(5-2)7(13)11-9(15)12-8(10)14/h6H,4-5H2,1-3H3,(H2,11,12,13,14,15)",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=ZRIHAIZYIMGOAB-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 30209,
            "identifier": "2353",
            "identifier_type": "int",
            "name": "FOS",
            "properties": {
                "url": "http://identifiers.org/ncbigene/2353",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "14",
                "description": "FBJ murine osteosarcoma viral oncogene homolog"
            },
            "metanode": "Gene"
        },
        {
            "id": 30210,
            "identifier": "11116",
            "identifier_type": "int",
            "name": "FGFR1OP",
            "properties": {
                "url": "http://identifiers.org/ncbigene/11116",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "FGFR1 oncogene partner"
            },
            "metanode": "Gene"
        },
        {
            "id": 30211,
            "identifier": "GO:0097061",
            "identifier_type": "str",
            "name": "dendritic spine organization",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0097061",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30212,
            "identifier": "GO:0035166",
            "identifier_type": "str",
            "name": "post-embryonic hemopoiesis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0035166",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30213,
            "identifier": "C0039446",
            "identifier_type": "str",
            "name": "Telangiectasia",
            "properties": {
                "url": "http://identifiers.org/umls/C0039446",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 30214,
            "identifier": "28955",
            "identifier_type": "int",
            "name": "DEXI",
            "properties": {
                "url": "http://identifiers.org/ncbigene/28955",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "16",
                "description": "Dexi homolog (mouse)"
            },
            "metanode": "Gene"
        },
        {
            "id": 30215,
            "identifier": "GO:0006307",
            "identifier_type": "str",
            "name": "DNA dealkylation involved in DNA repair",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0006307",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30216,
            "identifier": "7403",
            "identifier_type": "int",
            "name": "KDM6A",
            "properties": {
                "url": "http://identifiers.org/ncbigene/7403",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "X",
                "description": "lysine (K)-specific demethylase 6A"
            },
            "metanode": "Gene"
        },
        {
            "id": 30217,
            "identifier": "GO:0051272",
            "identifier_type": "str",
            "name": "positive regulation of cellular component movement",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0051272",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        }
    ]
}