Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=30200
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=30225", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=30175", "results": [ { "id": 30194, "identifier": "GO:0004582", "identifier_type": "str", "name": "dolichyl-phosphate beta-D-mannosyltransferase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0004582", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 30195, "identifier": "GO:0000993", "identifier_type": "str", "name": "RNA polymerase II core binding", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0000993", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 30231, "identifier": "GO:0010999", "identifier_type": "str", "name": "regulation of eIF2 alpha phosphorylation by heme", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0010999", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30196, "identifier": "338442", "identifier_type": "int", "name": "HCAR2", "properties": { "url": "http://identifiers.org/ncbigene/338442", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "hydroxycarboxylic acid receptor 2" }, "metanode": "Gene" }, { "id": 30197, "identifier": "GO:0009730", "identifier_type": "str", "name": "detection of carbohydrate stimulus", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0009730", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30198, "identifier": "148113", "identifier_type": "int", "name": "CILP2", "properties": { "url": "http://identifiers.org/ncbigene/148113", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "cartilage intermediate layer protein 2" }, "metanode": "Gene" }, { "id": 30199, "identifier": "25804", "identifier_type": "int", "name": "LSM4", "properties": { "url": "http://identifiers.org/ncbigene/25804", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "LSM4 homolog, U6 small nuclear RNA associated (S. cerevisiae)" }, "metanode": "Gene" }, { "id": 30200, "identifier": "1543", "identifier_type": "int", "name": "CYP1A1", "properties": { "url": "http://identifiers.org/ncbigene/1543", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "15", "description": "cytochrome P450, family 1, subfamily A, polypeptide 1" }, "metanode": "Gene" }, { "id": 30201, "identifier": "10162", "identifier_type": "int", "name": "LPCAT3", "properties": { "url": "http://identifiers.org/ncbigene/10162", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "lysophosphatidylcholine acyltransferase 3" }, "metanode": "Gene" }, { "id": 30202, "identifier": "9180", "identifier_type": "int", "name": "OSMR", "properties": { "url": "http://identifiers.org/ncbigene/9180", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "oncostatin M receptor" }, "metanode": "Gene" }, { "id": 30203, "identifier": "3996", "identifier_type": "int", "name": "LLGL1", "properties": { "url": "http://identifiers.org/ncbigene/3996", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "lethal giant larvae homolog 1 (Drosophila)" }, "metanode": "Gene" }, { "id": 30204, "identifier": "8663", "identifier_type": "int", "name": "EIF3C", "properties": { "url": "http://identifiers.org/ncbigene/8663", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "eukaryotic translation initiation factor 3, subunit C" }, "metanode": "Gene" }, { "id": 30205, "identifier": "GO:0071506", "identifier_type": "str", "name": "cellular response to mycophenolic acid", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0071506", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30206, "identifier": "GO:0006386", "identifier_type": "str", "name": "termination of RNA polymerase III transcription", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0006386", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30207, "identifier": "GO:0097033", "identifier_type": "str", "name": "mitochondrial respiratory chain complex III biogenesis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0097033", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30208, "identifier": "DB00237", "identifier_type": "str", "name": "Butabarbital", "properties": { "url": "http://www.drugbank.ca/drugs/DB00237", "inchi": "InChI=1S/C10H16N2O3/c1-4-6(3)10(5-2)7(13)11-9(15)12-8(10)14/h6H,4-5H2,1-3H3,(H2,11,12,13,14,15)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=ZRIHAIZYIMGOAB-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 30209, "identifier": "2353", "identifier_type": "int", "name": "FOS", "properties": { "url": "http://identifiers.org/ncbigene/2353", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "14", "description": "FBJ murine osteosarcoma viral oncogene homolog" }, "metanode": "Gene" }, { "id": 30210, "identifier": "11116", "identifier_type": "int", "name": "FGFR1OP", "properties": { "url": "http://identifiers.org/ncbigene/11116", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "FGFR1 oncogene partner" }, "metanode": "Gene" }, { "id": 30211, "identifier": "GO:0097061", "identifier_type": "str", "name": "dendritic spine organization", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0097061", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30212, "identifier": "GO:0035166", "identifier_type": "str", "name": "post-embryonic hemopoiesis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0035166", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30213, "identifier": "C0039446", "identifier_type": "str", "name": "Telangiectasia", "properties": { "url": "http://identifiers.org/umls/C0039446", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 30214, "identifier": "28955", "identifier_type": "int", "name": "DEXI", "properties": { "url": "http://identifiers.org/ncbigene/28955", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "Dexi homolog (mouse)" }, "metanode": "Gene" }, { "id": 30215, "identifier": "GO:0006307", "identifier_type": "str", "name": "DNA dealkylation involved in DNA repair", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0006307", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30216, "identifier": "7403", "identifier_type": "int", "name": "KDM6A", "properties": { "url": "http://identifiers.org/ncbigene/7403", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "lysine (K)-specific demethylase 6A" }, "metanode": "Gene" }, { "id": 30217, "identifier": "GO:0051272", "identifier_type": "str", "name": "positive regulation of cellular component movement", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0051272", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" } ] }