Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=30850
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=30875", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=30825", "results": [ { "id": 30843, "identifier": "5791", "identifier_type": "int", "name": "PTPRE", "properties": { "url": "http://identifiers.org/ncbigene/5791", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "10", "description": "protein tyrosine phosphatase, receptor type, E" }, "metanode": "Gene" }, { "id": 30844, "identifier": "10930", "identifier_type": "int", "name": "APOBEC2", "properties": { "url": "http://identifiers.org/ncbigene/10930", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "apolipoprotein B mRNA editing enzyme, catalytic polypeptide-like 2" }, "metanode": "Gene" }, { "id": 30845, "identifier": "C0235896", "identifier_type": "str", "name": "Lung infiltration", "properties": { "url": "http://identifiers.org/umls/C0235896", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 30846, "identifier": "26275", "identifier_type": "int", "name": "HIBCH", "properties": { "url": "http://identifiers.org/ncbigene/26275", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "3-hydroxyisobutyryl-CoA hydrolase" }, "metanode": "Gene" }, { "id": 30847, "identifier": "C0311394", "identifier_type": "str", "name": "Walking disability", "properties": { "url": "http://identifiers.org/umls/C0311394", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 30848, "identifier": "GO:0005085", "identifier_type": "str", "name": "guanyl-nucleotide exchange factor activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0005085", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 30849, "identifier": "GO:0019755", "identifier_type": "str", "name": "one-carbon compound transport", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0019755", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30850, "identifier": "GO:0006637", "identifier_type": "str", "name": "acyl-CoA metabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0006637", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30851, "identifier": "105375205", "identifier_type": "int", "name": "LOC105375205", "properties": { "url": "http://identifiers.org/ncbigene/105375205", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "uncharacterized LOC105375205" }, "metanode": "Gene" }, { "id": 30852, "identifier": "22859", "identifier_type": "int", "name": "ADGRL1", "properties": { "url": "http://identifiers.org/ncbigene/22859", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "adhesion G protein-coupled receptor L1" }, "metanode": "Gene" }, { "id": 30853, "identifier": "GO:0071514", "identifier_type": "str", "name": "genetic imprinting", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0071514", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30854, "identifier": "645836", "identifier_type": "int", "name": "USP17L3", "properties": { "url": "http://identifiers.org/ncbigene/645836", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "ubiquitin specific peptidase 17-like family member 3" }, "metanode": "Gene" }, { "id": 30855, "identifier": "122665", "identifier_type": "int", "name": "RNASE8", "properties": { "url": "http://identifiers.org/ncbigene/122665", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "14", "description": "ribonuclease, RNase A family, 8" }, "metanode": "Gene" }, { "id": 30856, "identifier": "608", "identifier_type": "int", "name": "TNFRSF17", "properties": { "url": "http://identifiers.org/ncbigene/608", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "tumor necrosis factor receptor superfamily, member 17" }, "metanode": "Gene" }, { "id": 30857, "identifier": "GO:0071025", "identifier_type": "str", "name": "RNA surveillance", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0071025", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30858, "identifier": "64375", "identifier_type": "int", "name": "IKZF4", "properties": { "url": "http://identifiers.org/ncbigene/64375", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "IKAROS family zinc finger 4 (Eos)" }, "metanode": "Gene" }, { "id": 30859, "identifier": "GO:0002176", "identifier_type": "str", "name": "male germ cell proliferation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0002176", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30860, "identifier": "GO:0030502", "identifier_type": "str", "name": "negative regulation of bone mineralization", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0030502", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30861, "identifier": "79145", "identifier_type": "int", "name": "CHCHD7", "properties": { "url": "http://identifiers.org/ncbigene/79145", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "coiled-coil-helix-coiled-coil-helix domain containing 7" }, "metanode": "Gene" }, { "id": 30862, "identifier": "DB01096", "identifier_type": "str", "name": "Oxamniquine", "properties": { "url": "http://www.drugbank.ca/drugs/DB01096", "inchi": "InChI=1S/C14H21N3O3/c1-9(2)15-7-12-4-3-10-5-11(8-18)14(17(19)20)6-13(10)16-12/h5-6,9,12,15-16,18H,3-4,7-8H2,1-2H3", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=XCGYUJZMCCFSRP-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 30863, "identifier": "WP382_r79951", "identifier_type": "str", "name": "MAPK Signaling Pathway", "properties": { "url": "http://www.wikipathways.org/instance/WP382_r79951", "source": "WikiPathways", "license": "CC BY 3.0" }, "metanode": "Pathway" }, { "id": 30864, "identifier": "GO:0015203", "identifier_type": "str", "name": "polyamine transmembrane transporter activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0015203", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 30865, "identifier": "127540", "identifier_type": "int", "name": "HMGB4", "properties": { "url": "http://identifiers.org/ncbigene/127540", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "high mobility group box 4" }, "metanode": "Gene" }, { "id": 30866, "identifier": "GO:0018230", "identifier_type": "str", "name": "peptidyl-L-cysteine S-palmitoylation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0018230", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 30867, "identifier": "2747", "identifier_type": "int", "name": "GLUD2", "properties": { "url": "http://identifiers.org/ncbigene/2747", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "glutamate dehydrogenase 2" }, "metanode": "Gene" } ] }