Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=30850
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=30875",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=30825",
    "results": [
        {
            "id": 30843,
            "identifier": "5791",
            "identifier_type": "int",
            "name": "PTPRE",
            "properties": {
                "url": "http://identifiers.org/ncbigene/5791",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "10",
                "description": "protein tyrosine phosphatase, receptor type, E"
            },
            "metanode": "Gene"
        },
        {
            "id": 30844,
            "identifier": "10930",
            "identifier_type": "int",
            "name": "APOBEC2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/10930",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "apolipoprotein B mRNA editing enzyme, catalytic polypeptide-like 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 30845,
            "identifier": "C0235896",
            "identifier_type": "str",
            "name": "Lung infiltration",
            "properties": {
                "url": "http://identifiers.org/umls/C0235896",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 30846,
            "identifier": "26275",
            "identifier_type": "int",
            "name": "HIBCH",
            "properties": {
                "url": "http://identifiers.org/ncbigene/26275",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "3-hydroxyisobutyryl-CoA hydrolase"
            },
            "metanode": "Gene"
        },
        {
            "id": 30847,
            "identifier": "C0311394",
            "identifier_type": "str",
            "name": "Walking disability",
            "properties": {
                "url": "http://identifiers.org/umls/C0311394",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 30848,
            "identifier": "GO:0005085",
            "identifier_type": "str",
            "name": "guanyl-nucleotide exchange factor activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0005085",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 30849,
            "identifier": "GO:0019755",
            "identifier_type": "str",
            "name": "one-carbon compound transport",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0019755",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30850,
            "identifier": "GO:0006637",
            "identifier_type": "str",
            "name": "acyl-CoA metabolic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0006637",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30851,
            "identifier": "105375205",
            "identifier_type": "int",
            "name": "LOC105375205",
            "properties": {
                "url": "http://identifiers.org/ncbigene/105375205",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "7",
                "description": "uncharacterized LOC105375205"
            },
            "metanode": "Gene"
        },
        {
            "id": 30852,
            "identifier": "22859",
            "identifier_type": "int",
            "name": "ADGRL1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/22859",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "adhesion G protein-coupled receptor L1"
            },
            "metanode": "Gene"
        },
        {
            "id": 30853,
            "identifier": "GO:0071514",
            "identifier_type": "str",
            "name": "genetic imprinting",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071514",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30854,
            "identifier": "645836",
            "identifier_type": "int",
            "name": "USP17L3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/645836",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "8",
                "description": "ubiquitin specific peptidase 17-like family member 3"
            },
            "metanode": "Gene"
        },
        {
            "id": 30855,
            "identifier": "122665",
            "identifier_type": "int",
            "name": "RNASE8",
            "properties": {
                "url": "http://identifiers.org/ncbigene/122665",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "14",
                "description": "ribonuclease, RNase A family, 8"
            },
            "metanode": "Gene"
        },
        {
            "id": 30856,
            "identifier": "608",
            "identifier_type": "int",
            "name": "TNFRSF17",
            "properties": {
                "url": "http://identifiers.org/ncbigene/608",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "16",
                "description": "tumor necrosis factor receptor superfamily, member 17"
            },
            "metanode": "Gene"
        },
        {
            "id": 30857,
            "identifier": "GO:0071025",
            "identifier_type": "str",
            "name": "RNA surveillance",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071025",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30858,
            "identifier": "64375",
            "identifier_type": "int",
            "name": "IKZF4",
            "properties": {
                "url": "http://identifiers.org/ncbigene/64375",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "IKAROS family zinc finger 4 (Eos)"
            },
            "metanode": "Gene"
        },
        {
            "id": 30859,
            "identifier": "GO:0002176",
            "identifier_type": "str",
            "name": "male germ cell proliferation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0002176",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30860,
            "identifier": "GO:0030502",
            "identifier_type": "str",
            "name": "negative regulation of bone mineralization",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0030502",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30861,
            "identifier": "79145",
            "identifier_type": "int",
            "name": "CHCHD7",
            "properties": {
                "url": "http://identifiers.org/ncbigene/79145",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "8",
                "description": "coiled-coil-helix-coiled-coil-helix domain containing 7"
            },
            "metanode": "Gene"
        },
        {
            "id": 30862,
            "identifier": "DB01096",
            "identifier_type": "str",
            "name": "Oxamniquine",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB01096",
                "inchi": "InChI=1S/C14H21N3O3/c1-9(2)15-7-12-4-3-10-5-11(8-18)14(17(19)20)6-13(10)16-12/h5-6,9,12,15-16,18H,3-4,7-8H2,1-2H3",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=XCGYUJZMCCFSRP-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 30863,
            "identifier": "WP382_r79951",
            "identifier_type": "str",
            "name": "MAPK Signaling Pathway",
            "properties": {
                "url": "http://www.wikipathways.org/instance/WP382_r79951",
                "source": "WikiPathways",
                "license": "CC BY 3.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 30864,
            "identifier": "GO:0015203",
            "identifier_type": "str",
            "name": "polyamine transmembrane transporter activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0015203",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 30865,
            "identifier": "127540",
            "identifier_type": "int",
            "name": "HMGB4",
            "properties": {
                "url": "http://identifiers.org/ncbigene/127540",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "high mobility group box 4"
            },
            "metanode": "Gene"
        },
        {
            "id": 30866,
            "identifier": "GO:0018230",
            "identifier_type": "str",
            "name": "peptidyl-L-cysteine S-palmitoylation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0018230",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 30867,
            "identifier": "2747",
            "identifier_type": "int",
            "name": "GLUD2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/2747",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "X",
                "description": "glutamate dehydrogenase 2"
            },
            "metanode": "Gene"
        }
    ]
}