Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=3175
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=3200", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=3150", "results": [ { "id": 3162, "identifier": "219990", "identifier_type": "int", "name": "OOSP2", "properties": { "url": "http://identifiers.org/ncbigene/219990", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "oocyte secreted protein 2" }, "metanode": "Gene" }, { "id": 3163, "identifier": "GO:0043970", "identifier_type": "str", "name": "histone H3-K9 acetylation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0043970", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 3164, "identifier": "27177", "identifier_type": "int", "name": "IL36B", "properties": { "url": "http://identifiers.org/ncbigene/27177", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "interleukin 36, beta" }, "metanode": "Gene" }, { "id": 3165, "identifier": "3172", "identifier_type": "int", "name": "HNF4A", "properties": { "url": "http://identifiers.org/ncbigene/3172", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "hepatocyte nuclear factor 4, alpha" }, "metanode": "Gene" }, { "id": 3166, "identifier": "WP466_r79981", "identifier_type": "str", "name": "DNA Replication", "properties": { "url": "http://www.wikipathways.org/instance/WP466_r79981", "source": "WikiPathways", "license": "CC BY 3.0" }, "metanode": "Pathway" }, { "id": 3167, "identifier": "C0023801", "identifier_type": "str", "name": "Lipomatosis", "properties": { "url": "http://identifiers.org/umls/C0023801", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 3168, "identifier": "131408", "identifier_type": "int", "name": "FAM131A", "properties": { "url": "http://identifiers.org/ncbigene/131408", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "family with sequence similarity 131, member A" }, "metanode": "Gene" }, { "id": 3169, "identifier": "5625", "identifier_type": "int", "name": "PRODH", "properties": { "url": "http://identifiers.org/ncbigene/5625", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "22", "description": "proline dehydrogenase (oxidase) 1" }, "metanode": "Gene" }, { "id": 3170, "identifier": "GO:0001067", "identifier_type": "str", "name": "regulatory region nucleic acid binding", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0001067", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 3171, "identifier": "51567", "identifier_type": "int", "name": "TDP2", "properties": { "url": "http://identifiers.org/ncbigene/51567", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "tyrosyl-DNA phosphodiesterase 2" }, "metanode": "Gene" }, { "id": 3172, "identifier": "GO:0031061", "identifier_type": "str", "name": "negative regulation of histone methylation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0031061", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 3173, "identifier": "GO:0005216", "identifier_type": "str", "name": "ion channel activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0005216", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 3174, "identifier": "GO:0060675", "identifier_type": "str", "name": "ureteric bud morphogenesis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0060675", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 3175, "identifier": "113277", "identifier_type": "int", "name": "TMEM106A", "properties": { "url": "http://identifiers.org/ncbigene/113277", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "transmembrane protein 106A" }, "metanode": "Gene" }, { "id": 3176, "identifier": "23464", "identifier_type": "int", "name": "GCAT", "properties": { "url": "http://identifiers.org/ncbigene/23464", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "22", "description": "glycine C-acetyltransferase" }, "metanode": "Gene" }, { "id": 3177, "identifier": "DB00967", "identifier_type": "str", "name": "Desloratadine", "properties": { "url": "http://www.drugbank.ca/drugs/DB00967", "inchi": "InChI=1S/C19H19ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-6,9,12,21H,3-4,7-8,10-11H2", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=JAUOIFJMECXRGI-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 3178, "identifier": "PC7_2519", "identifier_type": "str", "name": "Cell Cycle", "properties": { "source": "Reactome via Pathway Commons", "license": "CC BY 4.0" }, "metanode": "Pathway" }, { "id": 3179, "identifier": "143689", "identifier_type": "int", "name": "PIWIL4", "properties": { "url": "http://identifiers.org/ncbigene/143689", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "piwi-like RNA-mediated gene silencing 4" }, "metanode": "Gene" }, { "id": 3180, "identifier": "9519", "identifier_type": "int", "name": "TBPL1", "properties": { "url": "http://identifiers.org/ncbigene/9519", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "TBP-like 1" }, "metanode": "Gene" }, { "id": 3181, "identifier": "84432", "identifier_type": "int", "name": "PROK1", "properties": { "url": "http://identifiers.org/ncbigene/84432", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "prokineticin 1" }, "metanode": "Gene" }, { "id": 3182, "identifier": "GO:0045921", "identifier_type": "str", "name": "positive regulation of exocytosis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0045921", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 3183, "identifier": "6323", "identifier_type": "int", "name": "SCN1A", "properties": { "url": "http://identifiers.org/ncbigene/6323", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "sodium channel, voltage gated, type I alpha subunit" }, "metanode": "Gene" }, { "id": 3184, "identifier": "65108", "identifier_type": "int", "name": "MARCKSL1", "properties": { "url": "http://identifiers.org/ncbigene/65108", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "MARCKS-like 1" }, "metanode": "Gene" }, { "id": 3185, "identifier": "202151", "identifier_type": "int", "name": "RANBP3L", "properties": { "url": "http://identifiers.org/ncbigene/202151", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "RAN binding protein 3-like" }, "metanode": "Gene" }, { "id": 3186, "identifier": "GO:0002283", "identifier_type": "str", "name": "neutrophil activation involved in immune response", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0002283", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" } ] }