Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=3175
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=3200",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=3150",
    "results": [
        {
            "id": 3162,
            "identifier": "219990",
            "identifier_type": "int",
            "name": "OOSP2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/219990",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "11",
                "description": "oocyte secreted protein 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 3163,
            "identifier": "GO:0043970",
            "identifier_type": "str",
            "name": "histone H3-K9 acetylation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0043970",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 3164,
            "identifier": "27177",
            "identifier_type": "int",
            "name": "IL36B",
            "properties": {
                "url": "http://identifiers.org/ncbigene/27177",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "interleukin 36, beta"
            },
            "metanode": "Gene"
        },
        {
            "id": 3165,
            "identifier": "3172",
            "identifier_type": "int",
            "name": "HNF4A",
            "properties": {
                "url": "http://identifiers.org/ncbigene/3172",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "hepatocyte nuclear factor 4, alpha"
            },
            "metanode": "Gene"
        },
        {
            "id": 3166,
            "identifier": "WP466_r79981",
            "identifier_type": "str",
            "name": "DNA Replication",
            "properties": {
                "url": "http://www.wikipathways.org/instance/WP466_r79981",
                "source": "WikiPathways",
                "license": "CC BY 3.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 3167,
            "identifier": "C0023801",
            "identifier_type": "str",
            "name": "Lipomatosis",
            "properties": {
                "url": "http://identifiers.org/umls/C0023801",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 3168,
            "identifier": "131408",
            "identifier_type": "int",
            "name": "FAM131A",
            "properties": {
                "url": "http://identifiers.org/ncbigene/131408",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "family with sequence similarity 131, member A"
            },
            "metanode": "Gene"
        },
        {
            "id": 3169,
            "identifier": "5625",
            "identifier_type": "int",
            "name": "PRODH",
            "properties": {
                "url": "http://identifiers.org/ncbigene/5625",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "22",
                "description": "proline dehydrogenase (oxidase) 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 3170,
            "identifier": "GO:0001067",
            "identifier_type": "str",
            "name": "regulatory region nucleic acid binding",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0001067",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 3171,
            "identifier": "51567",
            "identifier_type": "int",
            "name": "TDP2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/51567",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "tyrosyl-DNA phosphodiesterase 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 3172,
            "identifier": "GO:0031061",
            "identifier_type": "str",
            "name": "negative regulation of histone methylation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0031061",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 3173,
            "identifier": "GO:0005216",
            "identifier_type": "str",
            "name": "ion channel activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0005216",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 3174,
            "identifier": "GO:0060675",
            "identifier_type": "str",
            "name": "ureteric bud morphogenesis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0060675",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 3175,
            "identifier": "113277",
            "identifier_type": "int",
            "name": "TMEM106A",
            "properties": {
                "url": "http://identifiers.org/ncbigene/113277",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "17",
                "description": "transmembrane protein 106A"
            },
            "metanode": "Gene"
        },
        {
            "id": 3176,
            "identifier": "23464",
            "identifier_type": "int",
            "name": "GCAT",
            "properties": {
                "url": "http://identifiers.org/ncbigene/23464",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "22",
                "description": "glycine C-acetyltransferase"
            },
            "metanode": "Gene"
        },
        {
            "id": 3177,
            "identifier": "DB00967",
            "identifier_type": "str",
            "name": "Desloratadine",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB00967",
                "inchi": "InChI=1S/C19H19ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-6,9,12,21H,3-4,7-8,10-11H2",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=JAUOIFJMECXRGI-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 3178,
            "identifier": "PC7_2519",
            "identifier_type": "str",
            "name": "Cell Cycle",
            "properties": {
                "source": "Reactome via Pathway Commons",
                "license": "CC BY 4.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 3179,
            "identifier": "143689",
            "identifier_type": "int",
            "name": "PIWIL4",
            "properties": {
                "url": "http://identifiers.org/ncbigene/143689",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "11",
                "description": "piwi-like RNA-mediated gene silencing 4"
            },
            "metanode": "Gene"
        },
        {
            "id": 3180,
            "identifier": "9519",
            "identifier_type": "int",
            "name": "TBPL1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9519",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "TBP-like 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 3181,
            "identifier": "84432",
            "identifier_type": "int",
            "name": "PROK1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/84432",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "prokineticin 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 3182,
            "identifier": "GO:0045921",
            "identifier_type": "str",
            "name": "positive regulation of exocytosis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0045921",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 3183,
            "identifier": "6323",
            "identifier_type": "int",
            "name": "SCN1A",
            "properties": {
                "url": "http://identifiers.org/ncbigene/6323",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "sodium channel, voltage gated, type I alpha subunit"
            },
            "metanode": "Gene"
        },
        {
            "id": 3184,
            "identifier": "65108",
            "identifier_type": "int",
            "name": "MARCKSL1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/65108",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "MARCKS-like 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 3185,
            "identifier": "202151",
            "identifier_type": "int",
            "name": "RANBP3L",
            "properties": {
                "url": "http://identifiers.org/ncbigene/202151",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "5",
                "description": "RAN binding protein 3-like"
            },
            "metanode": "Gene"
        },
        {
            "id": 3186,
            "identifier": "GO:0002283",
            "identifier_type": "str",
            "name": "neutrophil activation involved in immune response",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0002283",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        }
    ]
}