Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=3450
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=3475", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=3425", "results": [ { "id": 3436, "identifier": "102723859", "identifier_type": "int", "name": "LOC102723859", "properties": { "url": "http://identifiers.org/ncbigene/102723859", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "TBC1 domain family member-like" }, "metanode": "Gene" }, { "id": 3437, "identifier": "79097", "identifier_type": "int", "name": "TRIM48", "properties": { "url": "http://identifiers.org/ncbigene/79097", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "tripartite motif containing 48" }, "metanode": "Gene" }, { "id": 3438, "identifier": "105371188", "identifier_type": "int", "name": "LOC105371188", "properties": { "url": "http://identifiers.org/ncbigene/105371188", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "uncharacterized LOC105371188" }, "metanode": "Gene" }, { "id": 3439, "identifier": "DB01066", "identifier_type": "str", "name": "Cefditoren", "properties": { "url": "http://www.drugbank.ca/drugs/DB01066", "inchi": "InChI=1S/C19H18N6O5S3/c1-8-11(33-7-21-8)4-3-9-5-31-17-13(16(27)25(17)14(9)18(28)29)23-15(26)12(24-30-2)10-6-32-19(20)22-10/h3-4,6-7,13,17H,5H2,1-2H3,(H2,20,22)(H,23,26)(H,28,29)/b4-3-,24-12-/t13-,17-/m1/s1", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=KMIPKYQIOVAHOP-YLGJWRNMSA-N" }, "metanode": "Compound" }, { "id": 3440, "identifier": "246", "identifier_type": "int", "name": "ALOX15", "properties": { "url": "http://identifiers.org/ncbigene/246", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "arachidonate 15-lipoxygenase" }, "metanode": "Gene" }, { "id": 3441, "identifier": "8737", "identifier_type": "int", "name": "RIPK1", "properties": { "url": "http://identifiers.org/ncbigene/8737", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "receptor (TNFRSF)-interacting serine-threonine kinase 1" }, "metanode": "Gene" }, { "id": 3442, "identifier": "284325", "identifier_type": "int", "name": "C19orf54", "properties": { "url": "http://identifiers.org/ncbigene/284325", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "chromosome 19 open reading frame 54" }, "metanode": "Gene" }, { "id": 3443, "identifier": "GO:2001222", "identifier_type": "str", "name": "regulation of neuron migration", "properties": { "url": "http://purl.obolibrary.org/obo/GO_2001222", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 3444, "identifier": "2571", "identifier_type": "int", "name": "GAD1", "properties": { "url": "http://identifiers.org/ncbigene/2571", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "glutamate decarboxylase 1 (brain, 67kDa)" }, "metanode": "Gene" }, { "id": 3445, "identifier": "404550", "identifier_type": "int", "name": "C16orf74", "properties": { "url": "http://identifiers.org/ncbigene/404550", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "chromosome 16 open reading frame 74" }, "metanode": "Gene" }, { "id": 3446, "identifier": "GO:1900226", "identifier_type": "str", "name": "negative regulation of NLRP3 inflammasome complex assembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1900226", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 3447, "identifier": "91768", "identifier_type": "int", "name": "CABLES1", "properties": { "url": "http://identifiers.org/ncbigene/91768", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "18", "description": "Cdk5 and Abl enzyme substrate 1" }, "metanode": "Gene" }, { "id": 3448, "identifier": "GO:0038093", "identifier_type": "str", "name": "Fc receptor signaling pathway", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0038093", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 3449, "identifier": "5024", "identifier_type": "int", "name": "P2RX3", "properties": { "url": "http://identifiers.org/ncbigene/5024", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "purinergic receptor P2X, ligand gated ion channel, 3" }, "metanode": "Gene" }, { "id": 3450, "identifier": "GO:0016842", "identifier_type": "str", "name": "amidine-lyase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0016842", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 3451, "identifier": "55062", "identifier_type": "int", "name": "WIPI1", "properties": { "url": "http://identifiers.org/ncbigene/55062", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "WD repeat domain, phosphoinositide interacting 1" }, "metanode": "Gene" }, { "id": 3452, "identifier": "GO:0015926", "identifier_type": "str", "name": "glucosidase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0015926", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 3453, "identifier": "65992", "identifier_type": "int", "name": "DDRGK1", "properties": { "url": "http://identifiers.org/ncbigene/65992", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "DDRGK domain containing 1" }, "metanode": "Gene" }, { "id": 3454, "identifier": "23135", "identifier_type": "int", "name": "KDM6B", "properties": { "url": "http://identifiers.org/ncbigene/23135", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "lysine (K)-specific demethylase 6B" }, "metanode": "Gene" }, { "id": 3455, "identifier": "7621", "identifier_type": "int", "name": "ZNF70", "properties": { "url": "http://identifiers.org/ncbigene/7621", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "22", "description": "zinc finger protein 70" }, "metanode": "Gene" }, { "id": 3456, "identifier": "GO:0031497", "identifier_type": "str", "name": "chromatin assembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0031497", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 3457, "identifier": "7068", "identifier_type": "int", "name": "THRB", "properties": { "url": "http://identifiers.org/ncbigene/7068", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "thyroid hormone receptor, beta" }, "metanode": "Gene" }, { "id": 3458, "identifier": "GO:0046654", "identifier_type": "str", "name": "tetrahydrofolate biosynthetic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0046654", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 3459, "identifier": "C0302813", "identifier_type": "str", "name": "Lactase deficiency", "properties": { "url": "http://identifiers.org/umls/C0302813", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 3460, "identifier": "56000", "identifier_type": "int", "name": "NXF3", "properties": { "url": "http://identifiers.org/ncbigene/56000", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "nuclear RNA export factor 3" }, "metanode": "Gene" } ] }