Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=34675
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=34700", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=34650", "results": [ { "id": 34671, "identifier": "DB04967", "identifier_type": "str", "name": "Lucanthone", "properties": { "url": "http://www.drugbank.ca/drugs/DB04967", "inchi": "InChI=1S/C20H24N2OS/c1-4-22(5-2)13-12-21-16-11-10-14(3)20-18(16)19(23)15-8-6-7-9-17(15)24-20/h6-11,21H,4-5,12-13H2,1-3H3", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=FBQPGGIHOFZRGH-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 34672, "identifier": "DB00970", "identifier_type": "str", "name": "Dactinomycin", "properties": { "url": "http://www.drugbank.ca/drugs/DB00970", "inchi": "InChI=1S/C62H86N12O16/c1-27(2)42-59(84)73-23-17-19-36(73)57(82)69(13)25-38(75)71(15)48(29(5)6)61(86)88-33(11)44(55(80)65-42)67-53(78)35-22-21-31(9)51-46(35)64-47-40(41(63)50(77)32(10)52(47)90-51)54(79)68-45-34(12)89-62(87)49(30(7)8)72(16)39(76)26-70(14)58(83)37-20-18-24-74(37)60(85)43(28(3)4)66-56(45)81/h21-22,27-30,33-34,36-37,42-45,48-49H,17-20,23-26,63H2,1-16H3,(H,65,80)(H,66,81)(H,67,78)(H,68,79)/t33-,34-,36+,37+,42-,43-,44+,45+,48+,49+/m1/s1", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=RJURFGZVJUQBHK-IIXSONLDSA-N" }, "metanode": "Compound" }, { "id": 34673, "identifier": "29761", "identifier_type": "int", "name": "USP25", "properties": { "url": "http://identifiers.org/ncbigene/29761", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "21", "description": "ubiquitin specific peptidase 25" }, "metanode": "Gene" }, { "id": 34674, "identifier": "79090", "identifier_type": "int", "name": "TRAPPC6A", "properties": { "url": "http://identifiers.org/ncbigene/79090", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "trafficking protein particle complex 6A" }, "metanode": "Gene" }, { "id": 34675, "identifier": "GO:0001913", "identifier_type": "str", "name": "T cell mediated cytotoxicity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0001913", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 34676, "identifier": "239", "identifier_type": "int", "name": "ALOX12", "properties": { "url": "http://identifiers.org/ncbigene/239", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "arachidonate 12-lipoxygenase" }, "metanode": "Gene" }, { "id": 34677, "identifier": "GO:0030123", "identifier_type": "str", "name": "AP-3 adaptor complex", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0030123", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 34678, "identifier": "GO:0070570", "identifier_type": "str", "name": "regulation of neuron projection regeneration", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0070570", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 34679, "identifier": "PC7_2629", "identifier_type": "str", "name": "Classical antibody-mediated complement activation", "properties": { "source": "Reactome via Pathway Commons", "license": "CC BY 4.0" }, "metanode": "Pathway" }, { "id": 34680, "identifier": "GO:1990812", "identifier_type": "str", "name": "growth cone filopodium", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1990812", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 34681, "identifier": "2564", "identifier_type": "int", "name": "GABRE", "properties": { "url": "http://identifiers.org/ncbigene/2564", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "gamma-aminobutyric acid (GABA) A receptor, epsilon" }, "metanode": "Gene" }, { "id": 34682, "identifier": "11199", "identifier_type": "int", "name": "ANXA10", "properties": { "url": "http://identifiers.org/ncbigene/11199", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "4", "description": "annexin A10" }, "metanode": "Gene" }, { "id": 34683, "identifier": "C0162565", "identifier_type": "str", "name": "Porphyria acute", "properties": { "url": "http://identifiers.org/umls/C0162565", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 34684, "identifier": "C0858867", "identifier_type": "str", "name": "Reticulocytopenia", "properties": { "url": "http://identifiers.org/umls/C0858867", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 34685, "identifier": "5017", "identifier_type": "int", "name": "OVOL1", "properties": { "url": "http://identifiers.org/ncbigene/5017", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "ovo-like zinc finger 1" }, "metanode": "Gene" }, { "id": 34686, "identifier": "GO:0022401", "identifier_type": "str", "name": "negative adaptation of signaling pathway", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0022401", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 34687, "identifier": "55055", "identifier_type": "int", "name": "ZWILCH", "properties": { "url": "http://identifiers.org/ncbigene/55055", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "15", "description": "zwilch kinetochore protein" }, "metanode": "Gene" }, { "id": 34688, "identifier": "GO:0006678", "identifier_type": "str", "name": "glucosylceramide metabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0006678", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 34689, "identifier": "GO:0014738", "identifier_type": "str", "name": "regulation of muscle hyperplasia", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0014738", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 34690, "identifier": "65985", "identifier_type": "int", "name": "AACS", "properties": { "url": "http://identifiers.org/ncbigene/65985", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "acetoacetyl-CoA synthetase" }, "metanode": "Gene" }, { "id": 34691, "identifier": "23112", "identifier_type": "int", "name": "TNRC6B", "properties": { "url": "http://identifiers.org/ncbigene/23112", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "22", "description": "trinucleotide repeat containing 6B" }, "metanode": "Gene" }, { "id": 34692, "identifier": "7486", "identifier_type": "int", "name": "WRN", "properties": { "url": "http://identifiers.org/ncbigene/7486", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "Werner syndrome, RecQ helicase-like" }, "metanode": "Gene" }, { "id": 34693, "identifier": "GO:0032040", "identifier_type": "str", "name": "small-subunit processome", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0032040", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 34694, "identifier": "92856", "identifier_type": "int", "name": "IMP4", "properties": { "url": "http://identifiers.org/ncbigene/92856", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "IMP4, U3 small nucleolar ribonucleoprotein" }, "metanode": "Gene" }, { "id": 34695, "identifier": "GO:0007405", "identifier_type": "str", "name": "neuroblast proliferation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0007405", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" } ] }