Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=35550
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=35575",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=35525",
    "results": [
        {
            "id": 35545,
            "identifier": "GO:2001280",
            "identifier_type": "str",
            "name": "positive regulation of unsaturated fatty acid biosynthetic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_2001280",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 35546,
            "identifier": "7386",
            "identifier_type": "int",
            "name": "UQCRFS1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/7386",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "ubiquinol-cytochrome c reductase, Rieske iron-sulfur polypeptide 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 35547,
            "identifier": "DB08826",
            "identifier_type": "str",
            "name": "Deferiprone",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB08826",
                "inchi": "InChI=1S/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=TZXKOCQBRNJULO-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 35548,
            "identifier": "C0857122",
            "identifier_type": "str",
            "name": "Hyponatraemic",
            "properties": {
                "url": "http://identifiers.org/umls/C0857122",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 35549,
            "identifier": "126755",
            "identifier_type": "int",
            "name": "LRRC38",
            "properties": {
                "url": "http://identifiers.org/ncbigene/126755",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "leucine rich repeat containing 38"
            },
            "metanode": "Gene"
        },
        {
            "id": 35550,
            "identifier": "GO:0000212",
            "identifier_type": "str",
            "name": "meiotic spindle organization",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0000212",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 35551,
            "identifier": "WP363_r78571",
            "identifier_type": "str",
            "name": "Wnt Signaling Pathway Netpath",
            "properties": {
                "url": "http://www.wikipathways.org/instance/WP363_r78571",
                "source": "WikiPathways",
                "license": "CC BY 3.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 35552,
            "identifier": "26239",
            "identifier_type": "int",
            "name": "LCE2B",
            "properties": {
                "url": "http://identifiers.org/ncbigene/26239",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "late cornified envelope 2B"
            },
            "metanode": "Gene"
        },
        {
            "id": 35553,
            "identifier": "1962",
            "identifier_type": "int",
            "name": "EHHADH",
            "properties": {
                "url": "http://identifiers.org/ncbigene/1962",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "enoyl-CoA, hydratase/3-hydroxyacyl CoA dehydrogenase"
            },
            "metanode": "Gene"
        },
        {
            "id": 35554,
            "identifier": "55781",
            "identifier_type": "int",
            "name": "RIOK2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/55781",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "5",
                "description": "RIO kinase 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 35556,
            "identifier": "8301",
            "identifier_type": "int",
            "name": "PICALM",
            "properties": {
                "url": "http://identifiers.org/ncbigene/8301",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "11",
                "description": "phosphatidylinositol binding clathrin assembly protein"
            },
            "metanode": "Gene"
        },
        {
            "id": 35557,
            "identifier": "594855",
            "identifier_type": "int",
            "name": "CPLX3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/594855",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "15",
                "description": "complexin 3"
            },
            "metanode": "Gene"
        },
        {
            "id": 35558,
            "identifier": "DB04880",
            "identifier_type": "str",
            "name": "Enoximone",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB04880",
                "inchi": "InChI=1S/C12H12N2O2S/c1-7-10(14-12(16)13-7)11(15)8-3-5-9(17-2)6-4-8/h3-6H,1-2H3,(H2,13,14,16)",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=ZJKNESGOIKRXQY-UHFFFAOYSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 35559,
            "identifier": "105371405",
            "identifier_type": "int",
            "name": "LOC105371405",
            "properties": {
                "url": "http://identifiers.org/ncbigene/105371405",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "collagen alpha-1(XIII) chain"
            },
            "metanode": "Gene"
        },
        {
            "id": 35560,
            "identifier": "463",
            "identifier_type": "int",
            "name": "ZFHX3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/463",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "16",
                "description": "zinc finger homeobox 3"
            },
            "metanode": "Gene"
        },
        {
            "id": 35561,
            "identifier": "9082",
            "identifier_type": "int",
            "name": "XKRY",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9082",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "Y",
                "description": "XK, Kell blood group complex subunit-related, Y-linked"
            },
            "metanode": "Gene"
        },
        {
            "id": 35562,
            "identifier": "GO:0001727",
            "identifier_type": "str",
            "name": "lipid kinase activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0001727",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 35563,
            "identifier": "PC7_3902",
            "identifier_type": "str",
            "name": "Fibronectin matrix formation",
            "properties": {
                "source": "Reactome via Pathway Commons",
                "license": "CC BY 4.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 35564,
            "identifier": "N0000006806",
            "identifier_type": "str",
            "name": "Amino Acids",
            "properties": {
                "url": "http://purl.bioontology.org/ontology/NDFRT/N0000006806",
                "source": "FDA via DrugCentral",
                "license": "CC BY 4.0",
                "class_type": "Chemical/Ingredient"
            },
            "metanode": "Pharmacologic Class"
        },
        {
            "id": 35565,
            "identifier": "D003635",
            "identifier_type": "str",
            "name": "De Lange Syndrome",
            "properties": {
                "url": "http://identifiers.org/mesh/D003635",
                "source": "MeSH",
                "license": "CC0 1.0"
            },
            "metanode": "Symptom"
        },
        {
            "id": 35566,
            "identifier": "GO:0060249",
            "identifier_type": "str",
            "name": "anatomical structure homeostasis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0060249",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 35567,
            "identifier": "GO:0000478",
            "identifier_type": "str",
            "name": "endonucleolytic cleavage involved in rRNA processing",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0000478",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 35568,
            "identifier": "2916",
            "identifier_type": "int",
            "name": "GRM6",
            "properties": {
                "url": "http://identifiers.org/ncbigene/2916",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "5",
                "description": "glutamate receptor, metabotropic 6"
            },
            "metanode": "Gene"
        },
        {
            "id": 35569,
            "identifier": "GO:0034380",
            "identifier_type": "str",
            "name": "high-density lipoprotein particle assembly",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0034380",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 35570,
            "identifier": "GO:0007185",
            "identifier_type": "str",
            "name": "transmembrane receptor protein tyrosine phosphatase signaling pathway",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0007185",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        }
    ]
}