Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=35550
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=35575", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=35525", "results": [ { "id": 35545, "identifier": "GO:2001280", "identifier_type": "str", "name": "positive regulation of unsaturated fatty acid biosynthetic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_2001280", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 35546, "identifier": "7386", "identifier_type": "int", "name": "UQCRFS1", "properties": { "url": "http://identifiers.org/ncbigene/7386", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "ubiquinol-cytochrome c reductase, Rieske iron-sulfur polypeptide 1" }, "metanode": "Gene" }, { "id": 35547, "identifier": "DB08826", "identifier_type": "str", "name": "Deferiprone", "properties": { "url": "http://www.drugbank.ca/drugs/DB08826", "inchi": "InChI=1S/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=TZXKOCQBRNJULO-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 35548, "identifier": "C0857122", "identifier_type": "str", "name": "Hyponatraemic", "properties": { "url": "http://identifiers.org/umls/C0857122", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 35549, "identifier": "126755", "identifier_type": "int", "name": "LRRC38", "properties": { "url": "http://identifiers.org/ncbigene/126755", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "leucine rich repeat containing 38" }, "metanode": "Gene" }, { "id": 35550, "identifier": "GO:0000212", "identifier_type": "str", "name": "meiotic spindle organization", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0000212", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 35551, "identifier": "WP363_r78571", "identifier_type": "str", "name": "Wnt Signaling Pathway Netpath", "properties": { "url": "http://www.wikipathways.org/instance/WP363_r78571", "source": "WikiPathways", "license": "CC BY 3.0" }, "metanode": "Pathway" }, { "id": 35552, "identifier": "26239", "identifier_type": "int", "name": "LCE2B", "properties": { "url": "http://identifiers.org/ncbigene/26239", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "late cornified envelope 2B" }, "metanode": "Gene" }, { "id": 35553, "identifier": "1962", "identifier_type": "int", "name": "EHHADH", "properties": { "url": "http://identifiers.org/ncbigene/1962", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "enoyl-CoA, hydratase/3-hydroxyacyl CoA dehydrogenase" }, "metanode": "Gene" }, { "id": 35554, "identifier": "55781", "identifier_type": "int", "name": "RIOK2", "properties": { "url": "http://identifiers.org/ncbigene/55781", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "RIO kinase 2" }, "metanode": "Gene" }, { "id": 35556, "identifier": "8301", "identifier_type": "int", "name": "PICALM", "properties": { "url": "http://identifiers.org/ncbigene/8301", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "phosphatidylinositol binding clathrin assembly protein" }, "metanode": "Gene" }, { "id": 35557, "identifier": "594855", "identifier_type": "int", "name": "CPLX3", "properties": { "url": "http://identifiers.org/ncbigene/594855", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "15", "description": "complexin 3" }, "metanode": "Gene" }, { "id": 35558, "identifier": "DB04880", "identifier_type": "str", "name": "Enoximone", "properties": { "url": "http://www.drugbank.ca/drugs/DB04880", "inchi": "InChI=1S/C12H12N2O2S/c1-7-10(14-12(16)13-7)11(15)8-3-5-9(17-2)6-4-8/h3-6H,1-2H3,(H2,13,14,16)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=ZJKNESGOIKRXQY-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 35559, "identifier": "105371405", "identifier_type": "int", "name": "LOC105371405", "properties": { "url": "http://identifiers.org/ncbigene/105371405", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "collagen alpha-1(XIII) chain" }, "metanode": "Gene" }, { "id": 35560, "identifier": "463", "identifier_type": "int", "name": "ZFHX3", "properties": { "url": "http://identifiers.org/ncbigene/463", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "zinc finger homeobox 3" }, "metanode": "Gene" }, { "id": 35561, "identifier": "9082", "identifier_type": "int", "name": "XKRY", "properties": { "url": "http://identifiers.org/ncbigene/9082", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "Y", "description": "XK, Kell blood group complex subunit-related, Y-linked" }, "metanode": "Gene" }, { "id": 35562, "identifier": "GO:0001727", "identifier_type": "str", "name": "lipid kinase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0001727", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 35563, "identifier": "PC7_3902", "identifier_type": "str", "name": "Fibronectin matrix formation", "properties": { "source": "Reactome via Pathway Commons", "license": "CC BY 4.0" }, "metanode": "Pathway" }, { "id": 35564, "identifier": "N0000006806", "identifier_type": "str", "name": "Amino Acids", "properties": { "url": "http://purl.bioontology.org/ontology/NDFRT/N0000006806", "source": "FDA via DrugCentral", "license": "CC BY 4.0", "class_type": "Chemical/Ingredient" }, "metanode": "Pharmacologic Class" }, { "id": 35565, "identifier": "D003635", "identifier_type": "str", "name": "De Lange Syndrome", "properties": { "url": "http://identifiers.org/mesh/D003635", "source": "MeSH", "license": "CC0 1.0" }, "metanode": "Symptom" }, { "id": 35566, "identifier": "GO:0060249", "identifier_type": "str", "name": "anatomical structure homeostasis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0060249", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 35567, "identifier": "GO:0000478", "identifier_type": "str", "name": "endonucleolytic cleavage involved in rRNA processing", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0000478", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 35568, "identifier": "2916", "identifier_type": "int", "name": "GRM6", "properties": { "url": "http://identifiers.org/ncbigene/2916", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "5", "description": "glutamate receptor, metabotropic 6" }, "metanode": "Gene" }, { "id": 35569, "identifier": "GO:0034380", "identifier_type": "str", "name": "high-density lipoprotein particle assembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0034380", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 35570, "identifier": "GO:0007185", "identifier_type": "str", "name": "transmembrane receptor protein tyrosine phosphatase signaling pathway", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0007185", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" } ] }