Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=38575
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=38600", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=38550", "results": [ { "id": 38572, "identifier": "222389", "identifier_type": "int", "name": "BEND7", "properties": { "url": "http://identifiers.org/ncbigene/222389", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "10", "description": "BEN domain containing 7" }, "metanode": "Gene" }, { "id": 38573, "identifier": "100128795", "identifier_type": "int", "name": "LOC100128795", "properties": { "url": "http://identifiers.org/ncbigene/100128795", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "coiled-coil domain-containing protein 144A-like" }, "metanode": "Gene" }, { "id": 38574, "identifier": "GO:0016744", "identifier_type": "str", "name": "transferase activity, transferring aldehyde or ketonic groups", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0016744", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 38575, "identifier": "4829", "identifier_type": "int", "name": "NMBR", "properties": { "url": "http://identifiers.org/ncbigene/4829", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "neuromedin B receptor" }, "metanode": "Gene" }, { "id": 38576, "identifier": "54851", "identifier_type": "int", "name": "ANKRD49", "properties": { "url": "http://identifiers.org/ncbigene/54851", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "ankyrin repeat domain 49" }, "metanode": "Gene" }, { "id": 38577, "identifier": "874", "identifier_type": "int", "name": "CBR3", "properties": { "url": "http://identifiers.org/ncbigene/874", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "21", "description": "carbonyl reductase 3" }, "metanode": "Gene" }, { "id": 38578, "identifier": "84307", "identifier_type": "int", "name": "ZNF397", "properties": { "url": "http://identifiers.org/ncbigene/84307", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "18", "description": "zinc finger protein 397" }, "metanode": "Gene" }, { "id": 38579, "identifier": "146861", "identifier_type": "int", "name": "SLC35G3", "properties": { "url": "http://identifiers.org/ncbigene/146861", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "solute carrier family 35, member G3" }, "metanode": "Gene" }, { "id": 38580, "identifier": "9381", "identifier_type": "int", "name": "OTOF", "properties": { "url": "http://identifiers.org/ncbigene/9381", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "otoferlin" }, "metanode": "Gene" }, { "id": 38581, "identifier": "DB00265", "identifier_type": "str", "name": "Crotamiton", "properties": { "url": "http://www.drugbank.ca/drugs/DB00265", "inchi": "InChI=1S/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3/b8-4+", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=DNTGGZPQPQTDQF-XBXARRHUSA-N" }, "metanode": "Compound" }, { "id": 38582, "identifier": "388795", "identifier_type": "int", "name": "EFCAB8", "properties": { "url": "http://identifiers.org/ncbigene/388795", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "EF-hand calcium binding domain 8" }, "metanode": "Gene" }, { "id": 38583, "identifier": "GO:0042663", "identifier_type": "str", "name": "regulation of endodermal cell fate specification", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0042663", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 38584, "identifier": "26007", "identifier_type": "int", "name": "TKFC", "properties": { "url": "http://identifiers.org/ncbigene/26007", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "triokinase/FMN cyclase" }, "metanode": "Gene" }, { "id": 38585, "identifier": "GO:0052255", "identifier_type": "str", "name": "modulation by organism of defense response of other organism involved in symbiotic interaction", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0052255", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 38586, "identifier": "GO:0071158", "identifier_type": "str", "name": "positive regulation of cell cycle arrest", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0071158", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 38587, "identifier": "64168", "identifier_type": "int", "name": "NECAB1", "properties": { "url": "http://identifiers.org/ncbigene/64168", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "N-terminal EF-hand calcium binding protein 1" }, "metanode": "Gene" }, { "id": 38588, "identifier": "GO:0097362", "identifier_type": "str", "name": "MCM8-MCM9 complex", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0097362", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 38589, "identifier": "GO:0005680", "identifier_type": "str", "name": "anaphase-promoting complex", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0005680", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 38590, "identifier": "359", "identifier_type": "int", "name": "AQP2", "properties": { "url": "http://identifiers.org/ncbigene/359", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "aquaporin 2 (collecting duct)" }, "metanode": "Gene" }, { "id": 38591, "identifier": "8850", "identifier_type": "int", "name": "KAT2B", "properties": { "url": "http://identifiers.org/ncbigene/8850", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "K(lysine) acetyltransferase 2B" }, "metanode": "Gene" }, { "id": 38592, "identifier": "GO:0070391", "identifier_type": "str", "name": "response to lipoteichoic acid", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0070391", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 38593, "identifier": "81551", "identifier_type": "int", "name": "STMN4", "properties": { "url": "http://identifiers.org/ncbigene/81551", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "stathmin-like 4" }, "metanode": "Gene" }, { "id": 38594, "identifier": "C0948396", "identifier_type": "str", "name": "Frequent headaches", "properties": { "url": "http://identifiers.org/umls/C0948396", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 38595, "identifier": "2812", "identifier_type": "int", "name": "GP1BB", "properties": { "url": "http://identifiers.org/ncbigene/2812", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "22", "description": "glycoprotein Ib (platelet), beta polypeptide" }, "metanode": "Gene" }, { "id": 38596, "identifier": "11319", "identifier_type": "int", "name": "ECD", "properties": { "url": "http://identifiers.org/ncbigene/11319", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "10", "description": "ecdysoneless homolog (Drosophila)" }, "metanode": "Gene" } ] }