Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=38575
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=38600",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=38550",
    "results": [
        {
            "id": 38572,
            "identifier": "222389",
            "identifier_type": "int",
            "name": "BEND7",
            "properties": {
                "url": "http://identifiers.org/ncbigene/222389",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "10",
                "description": "BEN domain containing 7"
            },
            "metanode": "Gene"
        },
        {
            "id": 38573,
            "identifier": "100128795",
            "identifier_type": "int",
            "name": "LOC100128795",
            "properties": {
                "url": "http://identifiers.org/ncbigene/100128795",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "7",
                "description": "coiled-coil domain-containing protein 144A-like"
            },
            "metanode": "Gene"
        },
        {
            "id": 38574,
            "identifier": "GO:0016744",
            "identifier_type": "str",
            "name": "transferase activity, transferring aldehyde or ketonic groups",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0016744",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 38575,
            "identifier": "4829",
            "identifier_type": "int",
            "name": "NMBR",
            "properties": {
                "url": "http://identifiers.org/ncbigene/4829",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "neuromedin B receptor"
            },
            "metanode": "Gene"
        },
        {
            "id": 38576,
            "identifier": "54851",
            "identifier_type": "int",
            "name": "ANKRD49",
            "properties": {
                "url": "http://identifiers.org/ncbigene/54851",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "11",
                "description": "ankyrin repeat domain 49"
            },
            "metanode": "Gene"
        },
        {
            "id": 38577,
            "identifier": "874",
            "identifier_type": "int",
            "name": "CBR3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/874",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "21",
                "description": "carbonyl reductase 3"
            },
            "metanode": "Gene"
        },
        {
            "id": 38578,
            "identifier": "84307",
            "identifier_type": "int",
            "name": "ZNF397",
            "properties": {
                "url": "http://identifiers.org/ncbigene/84307",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "18",
                "description": "zinc finger protein 397"
            },
            "metanode": "Gene"
        },
        {
            "id": 38579,
            "identifier": "146861",
            "identifier_type": "int",
            "name": "SLC35G3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/146861",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "17",
                "description": "solute carrier family 35, member G3"
            },
            "metanode": "Gene"
        },
        {
            "id": 38580,
            "identifier": "9381",
            "identifier_type": "int",
            "name": "OTOF",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9381",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "otoferlin"
            },
            "metanode": "Gene"
        },
        {
            "id": 38581,
            "identifier": "DB00265",
            "identifier_type": "str",
            "name": "Crotamiton",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB00265",
                "inchi": "InChI=1S/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3/b8-4+",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=DNTGGZPQPQTDQF-XBXARRHUSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 38582,
            "identifier": "388795",
            "identifier_type": "int",
            "name": "EFCAB8",
            "properties": {
                "url": "http://identifiers.org/ncbigene/388795",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "EF-hand calcium binding domain 8"
            },
            "metanode": "Gene"
        },
        {
            "id": 38583,
            "identifier": "GO:0042663",
            "identifier_type": "str",
            "name": "regulation of endodermal cell fate specification",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0042663",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 38584,
            "identifier": "26007",
            "identifier_type": "int",
            "name": "TKFC",
            "properties": {
                "url": "http://identifiers.org/ncbigene/26007",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "11",
                "description": "triokinase/FMN cyclase"
            },
            "metanode": "Gene"
        },
        {
            "id": 38585,
            "identifier": "GO:0052255",
            "identifier_type": "str",
            "name": "modulation by organism of defense response of other organism involved in symbiotic interaction",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0052255",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 38586,
            "identifier": "GO:0071158",
            "identifier_type": "str",
            "name": "positive regulation of cell cycle arrest",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0071158",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 38587,
            "identifier": "64168",
            "identifier_type": "int",
            "name": "NECAB1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/64168",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "8",
                "description": "N-terminal EF-hand calcium binding protein 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 38588,
            "identifier": "GO:0097362",
            "identifier_type": "str",
            "name": "MCM8-MCM9 complex",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0097362",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 38589,
            "identifier": "GO:0005680",
            "identifier_type": "str",
            "name": "anaphase-promoting complex",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0005680",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 38590,
            "identifier": "359",
            "identifier_type": "int",
            "name": "AQP2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/359",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "aquaporin 2 (collecting duct)"
            },
            "metanode": "Gene"
        },
        {
            "id": 38591,
            "identifier": "8850",
            "identifier_type": "int",
            "name": "KAT2B",
            "properties": {
                "url": "http://identifiers.org/ncbigene/8850",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "K(lysine) acetyltransferase 2B"
            },
            "metanode": "Gene"
        },
        {
            "id": 38592,
            "identifier": "GO:0070391",
            "identifier_type": "str",
            "name": "response to lipoteichoic acid",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0070391",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 38593,
            "identifier": "81551",
            "identifier_type": "int",
            "name": "STMN4",
            "properties": {
                "url": "http://identifiers.org/ncbigene/81551",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "8",
                "description": "stathmin-like 4"
            },
            "metanode": "Gene"
        },
        {
            "id": 38594,
            "identifier": "C0948396",
            "identifier_type": "str",
            "name": "Frequent headaches",
            "properties": {
                "url": "http://identifiers.org/umls/C0948396",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 38595,
            "identifier": "2812",
            "identifier_type": "int",
            "name": "GP1BB",
            "properties": {
                "url": "http://identifiers.org/ncbigene/2812",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "22",
                "description": "glycoprotein Ib (platelet), beta polypeptide"
            },
            "metanode": "Gene"
        },
        {
            "id": 38596,
            "identifier": "11319",
            "identifier_type": "int",
            "name": "ECD",
            "properties": {
                "url": "http://identifiers.org/ncbigene/11319",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "10",
                "description": "ecdysoneless homolog (Drosophila)"
            },
            "metanode": "Gene"
        }
    ]
}