Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=42225
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=42250", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=42200", "results": [ { "id": 42224, "identifier": "55636", "identifier_type": "int", "name": "CHD7", "properties": { "url": "http://identifiers.org/ncbigene/55636", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "chromodomain helicase DNA binding protein 7" }, "metanode": "Gene" }, { "id": 42225, "identifier": "115265", "identifier_type": "int", "name": "DDIT4L", "properties": { "url": "http://identifiers.org/ncbigene/115265", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "4", "description": "DNA-damage-inducible transcript 4-like" }, "metanode": "Gene" }, { "id": 42226, "identifier": "387119", "identifier_type": "int", "name": "CEP85L", "properties": { "url": "http://identifiers.org/ncbigene/387119", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "centrosomal protein 85kDa-like" }, "metanode": "Gene" }, { "id": 42227, "identifier": "GO:0004112", "identifier_type": "str", "name": "cyclic-nucleotide phosphodiesterase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0004112", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 42228, "identifier": "57158", "identifier_type": "int", "name": "JPH2", "properties": { "url": "http://identifiers.org/ncbigene/57158", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "junctophilin 2" }, "metanode": "Gene" }, { "id": 42229, "identifier": "PC7_3975", "identifier_type": "str", "name": "Formyl peptide receptors bind formyl peptides and many other ligands", "properties": { "source": "Reactome via Pathway Commons", "license": "CC BY 4.0" }, "metanode": "Pathway" }, { "id": 42230, "identifier": "388633", "identifier_type": "int", "name": "LDLRAD1", "properties": { "url": "http://identifiers.org/ncbigene/388633", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "low density lipoprotein receptor class A domain containing 1" }, "metanode": "Gene" }, { "id": 42231, "identifier": "GO:0070530", "identifier_type": "str", "name": "K63-linked polyubiquitin binding", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0070530", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 42232, "identifier": "100287290", "identifier_type": "int", "name": "LOC100287290", "properties": { "url": "http://identifiers.org/ncbigene/100287290", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "cytokine receptor CRL2" }, "metanode": "Gene" }, { "id": 42233, "identifier": "PC7_2957", "identifier_type": "str", "name": "DNA-PK pathway in nonhomologous end joining", "properties": { "source": "PID via Pathway Commons", "license": "CC0 1.0" }, "metanode": "Pathway" }, { "id": 42234, "identifier": "55515", "identifier_type": "int", "name": "ASIC4", "properties": { "url": "http://identifiers.org/ncbigene/55515", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "acid sensing (proton gated) ion channel family member 4" }, "metanode": "Gene" }, { "id": 42235, "identifier": "GO:0032404", "identifier_type": "str", "name": "mismatch repair complex binding", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0032404", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 42236, "identifier": "79048", "identifier_type": "int", "name": "SECISBP2", "properties": { "url": "http://identifiers.org/ncbigene/79048", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "9", "description": "SECIS binding protein 2" }, "metanode": "Gene" }, { "id": 42237, "identifier": "GO:0010724", "identifier_type": "str", "name": "regulation of definitive erythrocyte differentiation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0010724", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42238, "identifier": "8816", "identifier_type": "int", "name": "DCAF5", "properties": { "url": "http://identifiers.org/ncbigene/8816", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "14", "description": "DDB1 and CUL4 associated factor 5" }, "metanode": "Gene" }, { "id": 42239, "identifier": "GO:0043198", "identifier_type": "str", "name": "dendritic shaft", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0043198", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 42240, "identifier": "GO:0033184", "identifier_type": "str", "name": "positive regulation of histone ubiquitination", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0033184", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42241, "identifier": "GO:0042470", "identifier_type": "str", "name": "melanosome", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0042470", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 42242, "identifier": "PC7_1581", "identifier_type": "str", "name": "Aflatoxin activation and detoxification", "properties": { "source": "Reactome via Pathway Commons", "license": "CC BY 4.0" }, "metanode": "Pathway" }, { "id": 42243, "identifier": "648791", "identifier_type": "int", "name": "PPP1R3G", "properties": { "url": "http://identifiers.org/ncbigene/648791", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "protein phosphatase 1, regulatory subunit 3G" }, "metanode": "Gene" }, { "id": 42244, "identifier": "2650", "identifier_type": "int", "name": "GCNT1", "properties": { "url": "http://identifiers.org/ncbigene/2650", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "9", "description": "glucosaminyl (N-acetyl) transferase 1, core 2" }, "metanode": "Gene" }, { "id": 42245, "identifier": "11157", "identifier_type": "int", "name": "LSM6", "properties": { "url": "http://identifiers.org/ncbigene/11157", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "4", "description": "LSM6 homolog, U6 small nuclear RNA associated (S. cerevisiae)" }, "metanode": "Gene" }, { "id": 42246, "identifier": "DB00719", "identifier_type": "str", "name": "Azatadine", "properties": { "url": "http://www.drugbank.ca/drugs/DB00719", "inchi": "InChI=1S/C20H22N2/c1-22-13-10-16(11-14-22)19-18-7-3-2-5-15(18)8-9-17-6-4-12-21-20(17)19/h2-7,12H,8-11,13-14H2,1H3", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=SEBMTIQKRHYNIT-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 42247, "identifier": "GO:0002904", "identifier_type": "str", "name": "positive regulation of B cell apoptotic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0002904", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42248, "identifier": "5119", "identifier_type": "int", "name": "CHMP1A", "properties": { "url": "http://identifiers.org/ncbigene/5119", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "charged multivesicular body protein 1A" }, "metanode": "Gene" } ] }