Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=42750
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=42775",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=42725",
    "results": [
        {
            "id": 42749,
            "identifier": "51091",
            "identifier_type": "int",
            "name": "SEPSECS",
            "properties": {
                "url": "http://identifiers.org/ncbigene/51091",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "4",
                "description": "Sep (O-phosphoserine) tRNA:Sec (selenocysteine) tRNA synthase"
            },
            "metanode": "Gene"
        },
        {
            "id": 42750,
            "identifier": "GO:0016248",
            "identifier_type": "str",
            "name": "channel inhibitor activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0016248",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 42751,
            "identifier": "GO:0002221",
            "identifier_type": "str",
            "name": "pattern recognition receptor signaling pathway",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0002221",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42752,
            "identifier": "GO:0015144",
            "identifier_type": "str",
            "name": "carbohydrate transmembrane transporter activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0015144",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 42753,
            "identifier": "DB00568",
            "identifier_type": "str",
            "name": "Cinnarizine",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB00568",
                "inchi": "InChI=1S/C26H28N2/c1-4-11-23(12-5-1)13-10-18-27-19-21-28(22-20-27)26(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-17,26H,18-22H2/b13-10+",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=DERZBLKQOCDDDZ-JLHYYAGUSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 42754,
            "identifier": "PC7_7719",
            "identifier_type": "str",
            "name": "Syndecan-2-mediated signaling events",
            "properties": {
                "source": "PID via Pathway Commons",
                "license": "CC0 1.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 42755,
            "identifier": "6119",
            "identifier_type": "int",
            "name": "RPA3",
            "properties": {
                "url": "http://identifiers.org/ncbigene/6119",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "7",
                "description": "replication protein A3, 14kDa"
            },
            "metanode": "Gene"
        },
        {
            "id": 42756,
            "identifier": "GO:0031016",
            "identifier_type": "str",
            "name": "pancreas development",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0031016",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42757,
            "identifier": "139628",
            "identifier_type": "int",
            "name": "FOXR2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/139628",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "X",
                "description": "forkhead box R2"
            },
            "metanode": "Gene"
        },
        {
            "id": 42758,
            "identifier": "GO:0005179",
            "identifier_type": "str",
            "name": "hormone activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0005179",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 42759,
            "identifier": "GO:1903818",
            "identifier_type": "str",
            "name": "positive regulation of voltage-gated potassium channel activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1903818",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42760,
            "identifier": "GO:0010455",
            "identifier_type": "str",
            "name": "positive regulation of cell fate commitment",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0010455",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42761,
            "identifier": "GO:0038179",
            "identifier_type": "str",
            "name": "neurotrophin signaling pathway",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0038179",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42762,
            "identifier": "100506144",
            "identifier_type": "int",
            "name": "ZMYM6NB",
            "properties": {
                "url": "http://identifiers.org/ncbigene/100506144",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "ZMYM6 neighbor"
            },
            "metanode": "Gene"
        },
        {
            "id": 42763,
            "identifier": "GO:0034374",
            "identifier_type": "str",
            "name": "low-density lipoprotein particle remodeling",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0034374",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42764,
            "identifier": "GO:0015939",
            "identifier_type": "str",
            "name": "pantothenate metabolic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0015939",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42765,
            "identifier": "GO:2000211",
            "identifier_type": "str",
            "name": "regulation of glutamate metabolic process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_2000211",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42766,
            "identifier": "54498",
            "identifier_type": "int",
            "name": "SMOX",
            "properties": {
                "url": "http://identifiers.org/ncbigene/54498",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "spermine oxidase"
            },
            "metanode": "Gene"
        },
        {
            "id": 42767,
            "identifier": "84798",
            "identifier_type": "int",
            "name": "C19orf48",
            "properties": {
                "url": "http://identifiers.org/ncbigene/84798",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "19",
                "description": "chromosome 19 open reading frame 48"
            },
            "metanode": "Gene"
        },
        {
            "id": 42768,
            "identifier": "GO:0014873",
            "identifier_type": "str",
            "name": "response to muscle activity involved in regulation of muscle adaptation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0014873",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42769,
            "identifier": "6801",
            "identifier_type": "int",
            "name": "STRN",
            "properties": {
                "url": "http://identifiers.org/ncbigene/6801",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "striatin, calmodulin binding protein"
            },
            "metanode": "Gene"
        },
        {
            "id": 42770,
            "identifier": "55137",
            "identifier_type": "int",
            "name": "FIGN",
            "properties": {
                "url": "http://identifiers.org/ncbigene/55137",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "fidgetin"
            },
            "metanode": "Gene"
        },
        {
            "id": 42771,
            "identifier": "GO:0060670",
            "identifier_type": "str",
            "name": "branching involved in labyrinthine layer morphogenesis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0060670",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 42772,
            "identifier": "GO:0005791",
            "identifier_type": "str",
            "name": "rough endoplasmic reticulum",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0005791",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 42773,
            "identifier": "1633",
            "identifier_type": "int",
            "name": "DCK",
            "properties": {
                "url": "http://identifiers.org/ncbigene/1633",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "4",
                "description": "deoxycytidine kinase"
            },
            "metanode": "Gene"
        }
    ]
}