Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=42750
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=42775", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=42725", "results": [ { "id": 42749, "identifier": "51091", "identifier_type": "int", "name": "SEPSECS", "properties": { "url": "http://identifiers.org/ncbigene/51091", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "4", "description": "Sep (O-phosphoserine) tRNA:Sec (selenocysteine) tRNA synthase" }, "metanode": "Gene" }, { "id": 42750, "identifier": "GO:0016248", "identifier_type": "str", "name": "channel inhibitor activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0016248", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 42751, "identifier": "GO:0002221", "identifier_type": "str", "name": "pattern recognition receptor signaling pathway", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0002221", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42752, "identifier": "GO:0015144", "identifier_type": "str", "name": "carbohydrate transmembrane transporter activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0015144", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 42753, "identifier": "DB00568", "identifier_type": "str", "name": "Cinnarizine", "properties": { "url": "http://www.drugbank.ca/drugs/DB00568", "inchi": "InChI=1S/C26H28N2/c1-4-11-23(12-5-1)13-10-18-27-19-21-28(22-20-27)26(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-17,26H,18-22H2/b13-10+", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=DERZBLKQOCDDDZ-JLHYYAGUSA-N" }, "metanode": "Compound" }, { "id": 42754, "identifier": "PC7_7719", "identifier_type": "str", "name": "Syndecan-2-mediated signaling events", "properties": { "source": "PID via Pathway Commons", "license": "CC0 1.0" }, "metanode": "Pathway" }, { "id": 42755, "identifier": "6119", "identifier_type": "int", "name": "RPA3", "properties": { "url": "http://identifiers.org/ncbigene/6119", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "replication protein A3, 14kDa" }, "metanode": "Gene" }, { "id": 42756, "identifier": "GO:0031016", "identifier_type": "str", "name": "pancreas development", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0031016", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42757, "identifier": "139628", "identifier_type": "int", "name": "FOXR2", "properties": { "url": "http://identifiers.org/ncbigene/139628", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "forkhead box R2" }, "metanode": "Gene" }, { "id": 42758, "identifier": "GO:0005179", "identifier_type": "str", "name": "hormone activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0005179", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 42759, "identifier": "GO:1903818", "identifier_type": "str", "name": "positive regulation of voltage-gated potassium channel activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1903818", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42760, "identifier": "GO:0010455", "identifier_type": "str", "name": "positive regulation of cell fate commitment", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0010455", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42761, "identifier": "GO:0038179", "identifier_type": "str", "name": "neurotrophin signaling pathway", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0038179", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42762, "identifier": "100506144", "identifier_type": "int", "name": "ZMYM6NB", "properties": { "url": "http://identifiers.org/ncbigene/100506144", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "ZMYM6 neighbor" }, "metanode": "Gene" }, { "id": 42763, "identifier": "GO:0034374", "identifier_type": "str", "name": "low-density lipoprotein particle remodeling", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0034374", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42764, "identifier": "GO:0015939", "identifier_type": "str", "name": "pantothenate metabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0015939", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42765, "identifier": "GO:2000211", "identifier_type": "str", "name": "regulation of glutamate metabolic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_2000211", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42766, "identifier": "54498", "identifier_type": "int", "name": "SMOX", "properties": { "url": "http://identifiers.org/ncbigene/54498", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "spermine oxidase" }, "metanode": "Gene" }, { "id": 42767, "identifier": "84798", "identifier_type": "int", "name": "C19orf48", "properties": { "url": "http://identifiers.org/ncbigene/84798", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "chromosome 19 open reading frame 48" }, "metanode": "Gene" }, { "id": 42768, "identifier": "GO:0014873", "identifier_type": "str", "name": "response to muscle activity involved in regulation of muscle adaptation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0014873", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42769, "identifier": "6801", "identifier_type": "int", "name": "STRN", "properties": { "url": "http://identifiers.org/ncbigene/6801", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "striatin, calmodulin binding protein" }, "metanode": "Gene" }, { "id": 42770, "identifier": "55137", "identifier_type": "int", "name": "FIGN", "properties": { "url": "http://identifiers.org/ncbigene/55137", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "fidgetin" }, "metanode": "Gene" }, { "id": 42771, "identifier": "GO:0060670", "identifier_type": "str", "name": "branching involved in labyrinthine layer morphogenesis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0060670", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 42772, "identifier": "GO:0005791", "identifier_type": "str", "name": "rough endoplasmic reticulum", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0005791", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 42773, "identifier": "1633", "identifier_type": "int", "name": "DCK", "properties": { "url": "http://identifiers.org/ncbigene/1633", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "4", "description": "deoxycytidine kinase" }, "metanode": "Gene" } ] }