Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=5225
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=5250", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=5200", "results": [ { "id": 5214, "identifier": "DB06218", "identifier_type": "str", "name": "Lacosamide", "properties": { "url": "http://www.drugbank.ca/drugs/DB06218", "inchi": "InChI=1S/C13H18N2O3/c1-10(16)15-12(9-18-2)13(17)14-8-11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,14,17)(H,15,16)/t12-/m1/s1", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=VPPJLAIAVCUEMN-GFCCVEGCSA-N" }, "metanode": "Compound" }, { "id": 5215, "identifier": "699", "identifier_type": "int", "name": "BUB1", "properties": { "url": "http://identifiers.org/ncbigene/699", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "2", "description": "BUB1 mitotic checkpoint serine/threonine kinase" }, "metanode": "Gene" }, { "id": 5216, "identifier": "9462", "identifier_type": "int", "name": "RASAL2", "properties": { "url": "http://identifiers.org/ncbigene/9462", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "RAS protein activator like 2" }, "metanode": "Gene" }, { "id": 5217, "identifier": "GO:1900215", "identifier_type": "str", "name": "negative regulation of apoptotic process involved in metanephric collecting duct development", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1900215", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5218, "identifier": "GO:1902573", "identifier_type": "str", "name": "positive regulation of serine-type peptidase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1902573", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5219, "identifier": "27301", "identifier_type": "int", "name": "APEX2", "properties": { "url": "http://identifiers.org/ncbigene/27301", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "APEX nuclease (apurinic/apyrimidinic endonuclease) 2" }, "metanode": "Gene" }, { "id": 5220, "identifier": "3280", "identifier_type": "int", "name": "HES1", "properties": { "url": "http://identifiers.org/ncbigene/3280", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "hes family bHLH transcription factor 1" }, "metanode": "Gene" }, { "id": 5221, "identifier": "GO:0070272", "identifier_type": "str", "name": "proton-transporting ATP synthase complex biogenesis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0070272", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5222, "identifier": "GO:0010260", "identifier_type": "str", "name": "organ senescence", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0010260", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5223, "identifier": "GO:0097629", "identifier_type": "str", "name": "extrinsic component of omegasome membrane", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0097629", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 5224, "identifier": "GO:0002143", "identifier_type": "str", "name": "tRNA wobble position uridine thiolation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0002143", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5225, "identifier": "GO:1990698", "identifier_type": "str", "name": "palmitoleoyltransferase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1990698", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 5226, "identifier": "GO:0008417", "identifier_type": "str", "name": "fucosyltransferase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0008417", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 5227, "identifier": "GO:0022404", "identifier_type": "str", "name": "molting cycle process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0022404", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5228, "identifier": "GO:0006477", "identifier_type": "str", "name": "protein sulfation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0006477", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5229, "identifier": "23588", "identifier_type": "int", "name": "KLHDC2", "properties": { "url": "http://identifiers.org/ncbigene/23588", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "14", "description": "kelch domain containing 2" }, "metanode": "Gene" }, { "id": 5230, "identifier": "C0520477", "identifier_type": "str", "name": "Prostatic adenoma", "properties": { "url": "http://identifiers.org/umls/C0520477", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 5231, "identifier": "8074", "identifier_type": "int", "name": "FGF23", "properties": { "url": "http://identifiers.org/ncbigene/8074", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "fibroblast growth factor 23" }, "metanode": "Gene" }, { "id": 5232, "identifier": "GO:0003165", "identifier_type": "str", "name": "Purkinje myocyte development", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0003165", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5270, "identifier": "D011695", "identifier_type": "str", "name": "Purpura, Schoenlein-Henoch", "properties": { "url": "http://identifiers.org/mesh/D011695", "source": "MeSH", "license": "CC0 1.0" }, "metanode": "Symptom" }, { "id": 5233, "identifier": "100131539", "identifier_type": "int", "name": "ZNF705E", "properties": { "url": "http://identifiers.org/ncbigene/100131539", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "zinc finger protein 705E" }, "metanode": "Gene" }, { "id": 5234, "identifier": "GO:0014718", "identifier_type": "str", "name": "positive regulation of satellite cell activation involved in skeletal muscle regeneration", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0014718", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5235, "identifier": "GO:0045103", "identifier_type": "str", "name": "intermediate filament-based process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0045103", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5236, "identifier": "C0269268", "identifier_type": "str", "name": "Breast induration", "properties": { "url": "http://identifiers.org/umls/C0269268", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 5237, "identifier": "GO:2000664", "identifier_type": "str", "name": "positive regulation of interleukin-5 secretion", "properties": { "url": "http://purl.obolibrary.org/obo/GO_2000664", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" } ] }