Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=5225
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=5250",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=5200",
    "results": [
        {
            "id": 5214,
            "identifier": "DB06218",
            "identifier_type": "str",
            "name": "Lacosamide",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB06218",
                "inchi": "InChI=1S/C13H18N2O3/c1-10(16)15-12(9-18-2)13(17)14-8-11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,14,17)(H,15,16)/t12-/m1/s1",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=VPPJLAIAVCUEMN-GFCCVEGCSA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 5215,
            "identifier": "699",
            "identifier_type": "int",
            "name": "BUB1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/699",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "2",
                "description": "BUB1 mitotic checkpoint serine/threonine kinase"
            },
            "metanode": "Gene"
        },
        {
            "id": 5216,
            "identifier": "9462",
            "identifier_type": "int",
            "name": "RASAL2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/9462",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "RAS protein activator like 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 5217,
            "identifier": "GO:1900215",
            "identifier_type": "str",
            "name": "negative regulation of apoptotic process involved in metanephric collecting duct development",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1900215",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5218,
            "identifier": "GO:1902573",
            "identifier_type": "str",
            "name": "positive regulation of serine-type peptidase activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1902573",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5219,
            "identifier": "27301",
            "identifier_type": "int",
            "name": "APEX2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/27301",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "X",
                "description": "APEX nuclease (apurinic/apyrimidinic endonuclease) 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 5220,
            "identifier": "3280",
            "identifier_type": "int",
            "name": "HES1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/3280",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "3",
                "description": "hes family bHLH transcription factor 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 5221,
            "identifier": "GO:0070272",
            "identifier_type": "str",
            "name": "proton-transporting ATP synthase complex biogenesis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0070272",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5222,
            "identifier": "GO:0010260",
            "identifier_type": "str",
            "name": "organ senescence",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0010260",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5223,
            "identifier": "GO:0097629",
            "identifier_type": "str",
            "name": "extrinsic component of omegasome membrane",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0097629",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        },
        {
            "id": 5224,
            "identifier": "GO:0002143",
            "identifier_type": "str",
            "name": "tRNA wobble position uridine thiolation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0002143",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5225,
            "identifier": "GO:1990698",
            "identifier_type": "str",
            "name": "palmitoleoyltransferase activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_1990698",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 5226,
            "identifier": "GO:0008417",
            "identifier_type": "str",
            "name": "fucosyltransferase activity",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0008417",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 5227,
            "identifier": "GO:0022404",
            "identifier_type": "str",
            "name": "molting cycle process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0022404",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5228,
            "identifier": "GO:0006477",
            "identifier_type": "str",
            "name": "protein sulfation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0006477",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5229,
            "identifier": "23588",
            "identifier_type": "int",
            "name": "KLHDC2",
            "properties": {
                "url": "http://identifiers.org/ncbigene/23588",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "14",
                "description": "kelch domain containing 2"
            },
            "metanode": "Gene"
        },
        {
            "id": 5230,
            "identifier": "C0520477",
            "identifier_type": "str",
            "name": "Prostatic adenoma",
            "properties": {
                "url": "http://identifiers.org/umls/C0520477",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 5231,
            "identifier": "8074",
            "identifier_type": "int",
            "name": "FGF23",
            "properties": {
                "url": "http://identifiers.org/ncbigene/8074",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "fibroblast growth factor 23"
            },
            "metanode": "Gene"
        },
        {
            "id": 5232,
            "identifier": "GO:0003165",
            "identifier_type": "str",
            "name": "Purkinje myocyte development",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0003165",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5270,
            "identifier": "D011695",
            "identifier_type": "str",
            "name": "Purpura, Schoenlein-Henoch",
            "properties": {
                "url": "http://identifiers.org/mesh/D011695",
                "source": "MeSH",
                "license": "CC0 1.0"
            },
            "metanode": "Symptom"
        },
        {
            "id": 5233,
            "identifier": "100131539",
            "identifier_type": "int",
            "name": "ZNF705E",
            "properties": {
                "url": "http://identifiers.org/ncbigene/100131539",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "11",
                "description": "zinc finger protein 705E"
            },
            "metanode": "Gene"
        },
        {
            "id": 5234,
            "identifier": "GO:0014718",
            "identifier_type": "str",
            "name": "positive regulation of satellite cell activation involved in skeletal muscle regeneration",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0014718",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5235,
            "identifier": "GO:0045103",
            "identifier_type": "str",
            "name": "intermediate filament-based process",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0045103",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 5236,
            "identifier": "C0269268",
            "identifier_type": "str",
            "name": "Breast induration",
            "properties": {
                "url": "http://identifiers.org/umls/C0269268",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 5237,
            "identifier": "GO:2000664",
            "identifier_type": "str",
            "name": "positive regulation of interleukin-5 secretion",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_2000664",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        }
    ]
}