Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=5300
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=5325", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=5275", "results": [ { "id": 5290, "identifier": "100862671", "identifier_type": "int", "name": "TMEM265", "properties": { "url": "http://identifiers.org/ncbigene/100862671", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "16", "description": "transmembrane protein 265" }, "metanode": "Gene" }, { "id": 5291, "identifier": "GO:0030158", "identifier_type": "str", "name": "protein xylosyltransferase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0030158", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 5292, "identifier": "GO:0021569", "identifier_type": "str", "name": "rhombomere 3 development", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0021569", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5293, "identifier": "55714", "identifier_type": "int", "name": "TENM3", "properties": { "url": "http://identifiers.org/ncbigene/55714", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "4", "description": "teneurin transmembrane protein 3" }, "metanode": "Gene" }, { "id": 5294, "identifier": "GO:0071267", "identifier_type": "str", "name": "L-methionine salvage", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0071267", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5295, "identifier": "C0235231", "identifier_type": "str", "name": "Pupils pinpoint", "properties": { "url": "http://identifiers.org/umls/C0235231", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 5296, "identifier": "GO:1904035", "identifier_type": "str", "name": "regulation of epithelial cell apoptotic process", "properties": { "url": "http://purl.obolibrary.org/obo/GO_1904035", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5297, "identifier": "1665", "identifier_type": "int", "name": "DHX15", "properties": { "url": "http://identifiers.org/ncbigene/1665", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "4", "description": "DEAH (Asp-Glu-Ala-His) box helicase 15" }, "metanode": "Gene" }, { "id": 5298, "identifier": "396", "identifier_type": "int", "name": "ARHGDIA", "properties": { "url": "http://identifiers.org/ncbigene/396", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "Rho GDP dissociation inhibitor (GDI) alpha" }, "metanode": "Gene" }, { "id": 5299, "identifier": "9159", "identifier_type": "int", "name": "PCSK7", "properties": { "url": "http://identifiers.org/ncbigene/9159", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "11", "description": "proprotein convertase subtilisin/kexin type 7" }, "metanode": "Gene" }, { "id": 5300, "identifier": "120892", "identifier_type": "int", "name": "LRRK2", "properties": { "url": "http://identifiers.org/ncbigene/120892", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "leucine-rich repeat kinase 2" }, "metanode": "Gene" }, { "id": 5301, "identifier": "GO:0004421", "identifier_type": "str", "name": "hydroxymethylglutaryl-CoA synthase activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0004421", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 5302, "identifier": "UBERON:0001348", "identifier_type": "str", "name": "brown adipose tissue", "properties": { "url": "http://purl.obolibrary.org/obo/UBERON_0001348", "bto_id": "BTO:0000156", "source": "Uberon", "license": "CC BY 3.0", "mesh_id": "D002001" }, "metanode": "Anatomy" }, { "id": 5303, "identifier": "GO:0007084", "identifier_type": "str", "name": "mitotic nuclear envelope reassembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0007084", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5304, "identifier": "GO:0015684", "identifier_type": "str", "name": "ferrous iron transport", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0015684", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5305, "identifier": "GO:0098728", "identifier_type": "str", "name": "germline stem cell asymmetric division", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0098728", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5306, "identifier": "2849", "identifier_type": "int", "name": "GPR26", "properties": { "url": "http://identifiers.org/ncbigene/2849", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "10", "description": "G protein-coupled receptor 26" }, "metanode": "Gene" }, { "id": 5307, "identifier": "142684", "identifier_type": "int", "name": "RAB40A", "properties": { "url": "http://identifiers.org/ncbigene/142684", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "RAB40A, member RAS oncogene family" }, "metanode": "Gene" }, { "id": 5308, "identifier": "100128927", "identifier_type": "int", "name": "ZBTB42", "properties": { "url": "http://identifiers.org/ncbigene/100128927", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "14", "description": "zinc finger and BTB domain containing 42" }, "metanode": "Gene" }, { "id": 5309, "identifier": "57538", "identifier_type": "int", "name": "ALPK3", "properties": { "url": "http://identifiers.org/ncbigene/57538", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "15", "description": "alpha-kinase 3" }, "metanode": "Gene" }, { "id": 5310, "identifier": "80201", "identifier_type": "int", "name": "HKDC1", "properties": { "url": "http://identifiers.org/ncbigene/80201", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "10", "description": "hexokinase domain containing 1" }, "metanode": "Gene" }, { "id": 5311, "identifier": "GO:0034551", "identifier_type": "str", "name": "mitochondrial respiratory chain complex III assembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0034551", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 5312, "identifier": "81569", "identifier_type": "int", "name": "ACTL8", "properties": { "url": "http://identifiers.org/ncbigene/81569", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "actin-like 8" }, "metanode": "Gene" }, { "id": 5313, "identifier": "WP1433_r83527", "identifier_type": "str", "name": "NOD pathway", "properties": { "url": "http://www.wikipathways.org/instance/WP1433_r83527", "source": "WikiPathways", "license": "CC BY 3.0" }, "metanode": "Pathway" }, { "id": 5314, "identifier": "DB00527", "identifier_type": "str", "name": "Cinchocaine", "properties": { "url": "http://www.drugbank.ca/drugs/DB00527", "inchi": "InChI=1S/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24)", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=PUFQVTATUTYEAL-UHFFFAOYSA-N" }, "metanode": "Compound" } ] }