Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=550
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=575", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=525", "results": [ { "id": 549, "identifier": "GO:0097632", "identifier_type": "str", "name": "extrinsic component of pre-autophagosomal structure membrane", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0097632", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" }, { "id": 550, "identifier": "GO:0043496", "identifier_type": "str", "name": "regulation of protein homodimerization activity", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0043496", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 551, "identifier": "147808", "identifier_type": "int", "name": "ZNF784", "properties": { "url": "http://identifiers.org/ncbigene/147808", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "zinc finger protein 784" }, "metanode": "Gene" }, { "id": 552, "identifier": "1238", "identifier_type": "int", "name": "ACKR2", "properties": { "url": "http://identifiers.org/ncbigene/1238", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "3", "description": "atypical chemokine receptor 2" }, "metanode": "Gene" }, { "id": 553, "identifier": "140801", "identifier_type": "int", "name": "RPL10L", "properties": { "url": "http://identifiers.org/ncbigene/140801", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "14", "description": "ribosomal protein L10-like" }, "metanode": "Gene" }, { "id": 554, "identifier": "51132", "identifier_type": "int", "name": "RLIM", "properties": { "url": "http://identifiers.org/ncbigene/51132", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "X", "description": "ring finger protein, LIM domain interacting" }, "metanode": "Gene" }, { "id": 555, "identifier": "170487", "identifier_type": "int", "name": "ACTL10", "properties": { "url": "http://identifiers.org/ncbigene/170487", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "actin-like 10" }, "metanode": "Gene" }, { "id": 556, "identifier": "3691", "identifier_type": "int", "name": "ITGB4", "properties": { "url": "http://identifiers.org/ncbigene/3691", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "17", "description": "integrin, beta 4" }, "metanode": "Gene" }, { "id": 557, "identifier": "GO:0002070", "identifier_type": "str", "name": "epithelial cell maturation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0002070", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 558, "identifier": "DB00208", "identifier_type": "str", "name": "Ticlopidine", "properties": { "url": "http://www.drugbank.ca/drugs/DB00208", "inchi": "InChI=1S/C14H14ClNS/c15-13-4-2-1-3-11(13)9-16-7-5-14-12(10-16)6-8-17-14/h1-4,6,8H,5,7,9-10H2", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=PHWBOXQYWZNQIN-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 559, "identifier": "GO:0050925", "identifier_type": "str", "name": "negative regulation of negative chemotaxis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0050925", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 560, "identifier": "342931", "identifier_type": "int", "name": "RFPL4A", "properties": { "url": "http://identifiers.org/ncbigene/342931", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "19", "description": "ret finger protein-like 4A" }, "metanode": "Gene" }, { "id": 561, "identifier": "GO:0048665", "identifier_type": "str", "name": "neuron fate specification", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0048665", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 562, "identifier": "283674", "identifier_type": "int", "name": "LOC283674", "properties": { "url": "http://identifiers.org/ncbigene/283674", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "15", "description": "uncharacterized LOC283674" }, "metanode": "Gene" }, { "id": 563, "identifier": "6016", "identifier_type": "int", "name": "RIT1", "properties": { "url": "http://identifiers.org/ncbigene/6016", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "Ras-like without CAAX 1" }, "metanode": "Gene" }, { "id": 564, "identifier": "10555", "identifier_type": "int", "name": "AGPAT2", "properties": { "url": "http://identifiers.org/ncbigene/10555", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "9", "description": "1-acylglycerol-3-phosphate O-acyltransferase 2" }, "metanode": "Gene" }, { "id": 565, "identifier": "DB06725", "identifier_type": "str", "name": "Lornoxicam", "properties": { "url": "http://www.drugbank.ca/drugs/DB06725", "inchi": "InChI=1S/C13H10ClN3O4S2/c1-17-10(13(19)16-9-4-2-3-5-15-9)11(18)12-7(23(17,20)21)6-8(14)22-12/h2-6,19H,1H3,(H,15,16)/b13-10+", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=OXROWJKCGCOJDO-JLHYYAGUSA-N" }, "metanode": "Compound" }, { "id": 566, "identifier": "91133", "identifier_type": "int", "name": "L3MBTL4", "properties": { "url": "http://identifiers.org/ncbigene/91133", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "18", "description": "l(3)mbt-like 4 (Drosophila)" }, "metanode": "Gene" }, { "id": 567, "identifier": "DB01105", "identifier_type": "str", "name": "Sibutramine", "properties": { "url": "http://www.drugbank.ca/drugs/DB01105", "inchi": "InChI=1S/C17H26ClN/c1-13(2)12-16(19(3)4)17(10-5-11-17)14-6-8-15(18)9-7-14/h6-9,13,16H,5,10-12H2,1-4H3", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=UNAANXDKBXWMLN-UHFFFAOYSA-N" }, "metanode": "Compound" }, { "id": 568, "identifier": "GO:0072236", "identifier_type": "str", "name": "metanephric loop of Henle development", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0072236", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 569, "identifier": "84967", "identifier_type": "int", "name": "LSM10", "properties": { "url": "http://identifiers.org/ncbigene/84967", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "LSM10, U7 small nuclear RNA associated" }, "metanode": "Gene" }, { "id": 570, "identifier": "GO:0010880", "identifier_type": "str", "name": "regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0010880", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 571, "identifier": "C0015300", "identifier_type": "str", "name": "Exophthalmos", "properties": { "url": "http://identifiers.org/umls/C0015300", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 572, "identifier": "GO:0070072", "identifier_type": "str", "name": "vacuolar proton-transporting V-type ATPase complex assembly", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0070072", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 6808, "identifier": "D006209", "identifier_type": "str", "name": "Halitosis", "properties": { "url": "http://identifiers.org/mesh/D006209", "source": "MeSH", "license": "CC0 1.0" }, "metanode": "Symptom" } ] }