Node
Return nodes, sorted by similarity to the search term.
Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3);
Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0].
Set similarity=1.0 to exclude trigram search.
Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations.
For example, metanodes=C,D will restrict to Compound and Disease nodes.
Set other-node=<node_id> to return non-null values for metapath_count.
metapath_counts measures the number of metapaths stored in the database between the result node and other node.
If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned.
If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.
GET /v1/nodes/?format=api&offset=8625
{ "count": 47031, "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=8650", "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=8600", "results": [ { "id": 8615, "identifier": "GO:0002874", "identifier_type": "str", "name": "regulation of chronic inflammatory response to antigenic stimulus", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0002874", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 8616, "identifier": "C0267596", "identifier_type": "str", "name": "Rectal haemorrhage", "properties": { "url": "http://identifiers.org/umls/C0267596", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 8617, "identifier": "GO:0000403", "identifier_type": "str", "name": "Y-form DNA binding", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0000403", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 8618, "identifier": "10732", "identifier_type": "int", "name": "TCFL5", "properties": { "url": "http://identifiers.org/ncbigene/10732", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "transcription factor-like 5 (basic helix-loop-helix)" }, "metanode": "Gene" }, { "id": 8619, "identifier": "D001044", "identifier_type": "str", "name": "Aphonia", "properties": { "url": "http://identifiers.org/mesh/D001044", "source": "MeSH", "license": "CC0 1.0" }, "metanode": "Symptom" }, { "id": 8620, "identifier": "GO:0060272", "identifier_type": "str", "name": "embryonic skeletal joint morphogenesis", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0060272", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 8621, "identifier": "C1142158", "identifier_type": "str", "name": "Hepatic vein occlusion", "properties": { "url": "http://identifiers.org/umls/C1142158", "source": "UMLS via SIDER 4.1", "license": "CC BY-NC-SA 4.0" }, "metanode": "Side Effect" }, { "id": 8622, "identifier": "54460", "identifier_type": "int", "name": "MRPS21", "properties": { "url": "http://identifiers.org/ncbigene/54460", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "1", "description": "mitochondrial ribosomal protein S21" }, "metanode": "Gene" }, { "id": 8623, "identifier": "84872", "identifier_type": "int", "name": "ZC3H10", "properties": { "url": "http://identifiers.org/ncbigene/84872", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "12", "description": "zinc finger CCCH-type containing 10" }, "metanode": "Gene" }, { "id": 8624, "identifier": "7019", "identifier_type": "int", "name": "TFAM", "properties": { "url": "http://identifiers.org/ncbigene/7019", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "10", "description": "transcription factor A, mitochondrial" }, "metanode": "Gene" }, { "id": 8625, "identifier": "10234", "identifier_type": "int", "name": "LRRC17", "properties": { "url": "http://identifiers.org/ncbigene/10234", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "leucine rich repeat containing 17" }, "metanode": "Gene" }, { "id": 8626, "identifier": "GO:0001851", "identifier_type": "str", "name": "complement component C3b binding", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0001851", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Molecular Function" }, { "id": 8627, "identifier": "DB01361", "identifier_type": "str", "name": "Troleandomycin", "properties": { "url": "http://www.drugbank.ca/drugs/DB01361", "inchi": "InChI=1S/C41H67NO15/c1-19-17-41(18-49-41)38(46)23(5)34(53-27(9)43)21(3)25(7)52-39(47)24(6)35(56-32-16-31(48-14)36(26(8)51-32)54-28(10)44)22(4)33(19)57-40-37(55-29(11)45)30(42(12)13)15-20(2)50-40/h19-26,30-37,40H,15-18H2,1-14H3/t19-,20+,21-,22+,23+,24+,25+,26-,30-,31-,32-,33-,34-,35-,36-,37+,40-,41+/m0/s1", "source": "DrugBank", "license": "CC BY-NC 4.0", "inchikey": "InChIKey=LQCLVBQBTUVCEQ-QTFUVMRISA-N" }, "metanode": "Compound" }, { "id": 8628, "identifier": "GO:0050907", "identifier_type": "str", "name": "detection of chemical stimulus involved in sensory perception", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0050907", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 8629, "identifier": "1595", "identifier_type": "int", "name": "CYP51A1", "properties": { "url": "http://identifiers.org/ncbigene/1595", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "7", "description": "cytochrome P450, family 51, subfamily A, polypeptide 1" }, "metanode": "Gene" }, { "id": 8630, "identifier": "63905", "identifier_type": "int", "name": "MANBAL", "properties": { "url": "http://identifiers.org/ncbigene/63905", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "20", "description": "mannosidase, beta A, lysosomal-like" }, "metanode": "Gene" }, { "id": 8631, "identifier": "GO:0048073", "identifier_type": "str", "name": "regulation of eye pigmentation", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0048073", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 8632, "identifier": "GO:0010571", "identifier_type": "str", "name": "positive regulation of nuclear cell cycle DNA replication", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0010571", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 8633, "identifier": "105379785", "identifier_type": "int", "name": "LOC105379785", "properties": { "url": "http://identifiers.org/ncbigene/105379785", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "8", "description": "extensin-like" }, "metanode": "Gene" }, { "id": 8634, "identifier": "GO:0048339", "identifier_type": "str", "name": "paraxial mesoderm development", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0048339", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 8635, "identifier": "N0000185499", "identifier_type": "str", "name": "Guanylate Cyclase Activators", "properties": { "url": "http://purl.bioontology.org/ontology/NDFRT/N0000185499", "source": "FDA via DrugCentral", "license": "CC BY 4.0", "class_type": "Mechanism of Action" }, "metanode": "Pharmacologic Class" }, { "id": 8636, "identifier": "GO:0002237", "identifier_type": "str", "name": "response to molecule of bacterial origin", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0002237", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Biological Process" }, { "id": 8638, "identifier": "105378158", "identifier_type": "int", "name": "LOC105378158", "properties": { "url": "http://identifiers.org/ncbigene/105378158", "source": "Entrez Gene", "license": "CC0 1.0", "chromosome": "6", "description": "basic proline-rich protein-like" }, "metanode": "Gene" }, { "id": 8639, "identifier": "WP2338_r78504", "identifier_type": "str", "name": "miRNA Biogenesis", "properties": { "url": "http://www.wikipathways.org/instance/WP2338_r78504", "source": "WikiPathways", "license": "CC BY 3.0" }, "metanode": "Pathway" }, { "id": 8640, "identifier": "GO:0030430", "identifier_type": "str", "name": "host cell cytoplasm", "properties": { "url": "http://purl.obolibrary.org/obo/GO_0030430", "source": "Gene Ontology", "license": "CC BY 4.0" }, "metanode": "Cellular Component" } ] }