Return nodes, sorted by similarity to the search term. Use search=<str> to search identifier for prefix match, and name for substring and trigram searches (similarity defaults to 0.3); Use search=<str>&similarity=<value> to set your own similarity value in the range of (0, 1.0]. Set similarity=1.0 to exclude trigram search. Filter for select metanodes using metanodes=<str>, where <str> is a comma-separated list of metanode abbreviations. For example, metanodes=C,D will restrict to Compound and Disease nodes.

Set other-node=<node_id> to return non-null values for metapath_count. metapath_counts measures the number of metapaths stored in the database between the result node and other node. If search and other-node and both specified, results are sorted by search similarity and results with metapath_count == 0 are returned. If other-node is specified but not search, results are sorted by metapath_count (descending) and only results with metapath_count > 0 are returned.

GET /v1/nodes/?format=api&offset=8625
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "count": 47031,
    "next": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=8650",
    "previous": "http://search-api.het.io/v1/nodes/?format=api&limit=25&offset=8600",
    "results": [
        {
            "id": 8615,
            "identifier": "GO:0002874",
            "identifier_type": "str",
            "name": "regulation of chronic inflammatory response to antigenic stimulus",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0002874",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 8616,
            "identifier": "C0267596",
            "identifier_type": "str",
            "name": "Rectal haemorrhage",
            "properties": {
                "url": "http://identifiers.org/umls/C0267596",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 8617,
            "identifier": "GO:0000403",
            "identifier_type": "str",
            "name": "Y-form DNA binding",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0000403",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 8618,
            "identifier": "10732",
            "identifier_type": "int",
            "name": "TCFL5",
            "properties": {
                "url": "http://identifiers.org/ncbigene/10732",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "transcription factor-like 5 (basic helix-loop-helix)"
            },
            "metanode": "Gene"
        },
        {
            "id": 8619,
            "identifier": "D001044",
            "identifier_type": "str",
            "name": "Aphonia",
            "properties": {
                "url": "http://identifiers.org/mesh/D001044",
                "source": "MeSH",
                "license": "CC0 1.0"
            },
            "metanode": "Symptom"
        },
        {
            "id": 8620,
            "identifier": "GO:0060272",
            "identifier_type": "str",
            "name": "embryonic skeletal joint morphogenesis",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0060272",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 8621,
            "identifier": "C1142158",
            "identifier_type": "str",
            "name": "Hepatic vein occlusion",
            "properties": {
                "url": "http://identifiers.org/umls/C1142158",
                "source": "UMLS via SIDER 4.1",
                "license": "CC BY-NC-SA 4.0"
            },
            "metanode": "Side Effect"
        },
        {
            "id": 8622,
            "identifier": "54460",
            "identifier_type": "int",
            "name": "MRPS21",
            "properties": {
                "url": "http://identifiers.org/ncbigene/54460",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "1",
                "description": "mitochondrial ribosomal protein S21"
            },
            "metanode": "Gene"
        },
        {
            "id": 8623,
            "identifier": "84872",
            "identifier_type": "int",
            "name": "ZC3H10",
            "properties": {
                "url": "http://identifiers.org/ncbigene/84872",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "12",
                "description": "zinc finger CCCH-type containing 10"
            },
            "metanode": "Gene"
        },
        {
            "id": 8624,
            "identifier": "7019",
            "identifier_type": "int",
            "name": "TFAM",
            "properties": {
                "url": "http://identifiers.org/ncbigene/7019",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "10",
                "description": "transcription factor A, mitochondrial"
            },
            "metanode": "Gene"
        },
        {
            "id": 8625,
            "identifier": "10234",
            "identifier_type": "int",
            "name": "LRRC17",
            "properties": {
                "url": "http://identifiers.org/ncbigene/10234",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "7",
                "description": "leucine rich repeat containing 17"
            },
            "metanode": "Gene"
        },
        {
            "id": 8626,
            "identifier": "GO:0001851",
            "identifier_type": "str",
            "name": "complement component C3b binding",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0001851",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Molecular Function"
        },
        {
            "id": 8627,
            "identifier": "DB01361",
            "identifier_type": "str",
            "name": "Troleandomycin",
            "properties": {
                "url": "http://www.drugbank.ca/drugs/DB01361",
                "inchi": "InChI=1S/C41H67NO15/c1-19-17-41(18-49-41)38(46)23(5)34(53-27(9)43)21(3)25(7)52-39(47)24(6)35(56-32-16-31(48-14)36(26(8)51-32)54-28(10)44)22(4)33(19)57-40-37(55-29(11)45)30(42(12)13)15-20(2)50-40/h19-26,30-37,40H,15-18H2,1-14H3/t19-,20+,21-,22+,23+,24+,25+,26-,30-,31-,32-,33-,34-,35-,36-,37+,40-,41+/m0/s1",
                "source": "DrugBank",
                "license": "CC BY-NC 4.0",
                "inchikey": "InChIKey=LQCLVBQBTUVCEQ-QTFUVMRISA-N"
            },
            "metanode": "Compound"
        },
        {
            "id": 8628,
            "identifier": "GO:0050907",
            "identifier_type": "str",
            "name": "detection of chemical stimulus involved in sensory perception",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0050907",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 8629,
            "identifier": "1595",
            "identifier_type": "int",
            "name": "CYP51A1",
            "properties": {
                "url": "http://identifiers.org/ncbigene/1595",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "7",
                "description": "cytochrome P450, family 51, subfamily A, polypeptide 1"
            },
            "metanode": "Gene"
        },
        {
            "id": 8630,
            "identifier": "63905",
            "identifier_type": "int",
            "name": "MANBAL",
            "properties": {
                "url": "http://identifiers.org/ncbigene/63905",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "20",
                "description": "mannosidase, beta A, lysosomal-like"
            },
            "metanode": "Gene"
        },
        {
            "id": 8631,
            "identifier": "GO:0048073",
            "identifier_type": "str",
            "name": "regulation of eye pigmentation",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0048073",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 8632,
            "identifier": "GO:0010571",
            "identifier_type": "str",
            "name": "positive regulation of nuclear cell cycle DNA replication",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0010571",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 8633,
            "identifier": "105379785",
            "identifier_type": "int",
            "name": "LOC105379785",
            "properties": {
                "url": "http://identifiers.org/ncbigene/105379785",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "8",
                "description": "extensin-like"
            },
            "metanode": "Gene"
        },
        {
            "id": 8634,
            "identifier": "GO:0048339",
            "identifier_type": "str",
            "name": "paraxial mesoderm development",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0048339",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 8635,
            "identifier": "N0000185499",
            "identifier_type": "str",
            "name": "Guanylate Cyclase Activators",
            "properties": {
                "url": "http://purl.bioontology.org/ontology/NDFRT/N0000185499",
                "source": "FDA via DrugCentral",
                "license": "CC BY 4.0",
                "class_type": "Mechanism of Action"
            },
            "metanode": "Pharmacologic Class"
        },
        {
            "id": 8636,
            "identifier": "GO:0002237",
            "identifier_type": "str",
            "name": "response to molecule of bacterial origin",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0002237",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Biological Process"
        },
        {
            "id": 8638,
            "identifier": "105378158",
            "identifier_type": "int",
            "name": "LOC105378158",
            "properties": {
                "url": "http://identifiers.org/ncbigene/105378158",
                "source": "Entrez Gene",
                "license": "CC0 1.0",
                "chromosome": "6",
                "description": "basic proline-rich protein-like"
            },
            "metanode": "Gene"
        },
        {
            "id": 8639,
            "identifier": "WP2338_r78504",
            "identifier_type": "str",
            "name": "miRNA Biogenesis",
            "properties": {
                "url": "http://www.wikipathways.org/instance/WP2338_r78504",
                "source": "WikiPathways",
                "license": "CC BY 3.0"
            },
            "metanode": "Pathway"
        },
        {
            "id": 8640,
            "identifier": "GO:0030430",
            "identifier_type": "str",
            "name": "host cell cytoplasm",
            "properties": {
                "url": "http://purl.obolibrary.org/obo/GO_0030430",
                "source": "Gene Ontology",
                "license": "CC BY 4.0"
            },
            "metanode": "Cellular Component"
        }
    ]
}