For a given source node, target node, and metapath, return the actual paths comprising the path count / DWPC. These paths have not been pre-computed and are extracted on-the-fly from the Hetionet Neo4j Browser. Therefore, it is advisable to avoid querying a source-target-metapath pair with a path count exceeding 10,000. Because results are ordered by PDP / percent_of_DWPC, reducing limit does not prevent neo4j from having to exhaustively traverse all paths.

GET /v1/paths/source/17054/target/6602/metapath/CbGeAlD/
HTTP 200 OK
Allow: GET
Content-Type: application/json
Vary: Accept

{
    "query": {
        "source_id": 17054,
        "target_id": 6602,
        "source_metanode": "Compound",
        "target_metanode": "Disease",
        "source_identifier": "DB00331",
        "target_identifier": "DOID:1612",
        "metapath": "CbGeAlD",
        "metapath_id": [
            [
                "Compound",
                "Gene",
                "binds",
                "both"
            ],
            [
                "Gene",
                "Anatomy",
                "expresses",
                "both"
            ],
            [
                "Anatomy",
                "Disease",
                "localizes",
                "both"
            ]
        ],
        "metapath_unadjusted_p_value": 3.2653823879721316e-05,
        "metapath_adjusted_p_value": 0.003951112689446279,
        "metapath_score": 2.4032805836552362,
        "limit": 100
    },
    "path_count_info": {
        "id": 77513331,
        "adjusted_p_value": 0.003951112689446279,
        "path_count": 484,
        "dwpc": 3.5346993748913973,
        "p_value": 3.2653823879721316e-05,
        "source": 17054,
        "target": 6602,
        "reversed": false,
        "metapath_abbreviation": "CbGeAlD",
        "metapath_name": "Compound–binds–Gene–expresses–Anatomy–localizes–Disease",
        "metapath_length": 3,
        "metapath_path_count_density": 0.800046,
        "metapath_path_count_mean": 17.3173,
        "metapath_path_count_max": 1670,
        "metapath_dwpc_raw_mean": 0.000259132,
        "metapath_n_similar": 121,
        "metapath_p_threshold": 1.0,
        "metapath_source": "Compound",
        "metapath_target": "Disease",
        "metapath_id": "CbGeAlD",
        "metapath_reversed": false,
        "metapath_metaedges": [
            [
                "Compound",
                "Gene",
                "binds",
                "both"
            ],
            [
                "Gene",
                "Anatomy",
                "expresses",
                "both"
            ],
            [
                "Anatomy",
                "Disease",
                "localizes",
                "both"
            ]
        ],
        "dgp_id": 21810569,
        "dgp_source_degree": 56,
        "dgp_target_degree": 39,
        "dgp_n_dwpcs": 800,
        "dgp_n_nonzero_dwpcs": 800,
        "dgp_nonzero_mean": 1.9215512456202535,
        "dgp_nonzero_sd": 0.33090308109283123,
        "dgp_reversed": false,
        "cypher_query": "MATCH path = (n0:Compound)-[:BINDS_CbG]-(n1)-[:EXPRESSES_AeG]-(n2)-[:LOCALIZES_DlA]-(n3:Disease)\nUSING JOIN ON n1\nWHERE n0.identifier = 'DB00331' // Metformin\nAND n3.identifier = 'DOID:1612' // breast cancer\nWITH\n[\nsize((n0)-[:BINDS_CbG]-()),\nsize(()-[:BINDS_CbG]-(n1)),\nsize((n1)-[:EXPRESSES_AeG]-()),\nsize(()-[:EXPRESSES_AeG]-(n2)),\nsize((n2)-[:LOCALIZES_DlA]-()),\nsize(()-[:LOCALIZES_DlA]-(n3))\n] AS degrees, path\nWITH path, reduce(pdp = 1.0, d in degrees| pdp * d ^ -0.5) AS PDP\nWITH collect({paths: path, PDPs: PDP}) AS data_maps, count(path) AS PC, sum(PDP) AS DWPC\nUNWIND data_maps AS data_map\nWITH data_map.paths AS path, data_map.PDPs AS PDP, PC, DWPC\nRETURN\n  path AS neo4j_path,\n  substring(reduce(s = '', node IN nodes(path)| s + '–' + node.name), 1) AS path,\n  PDP,\n  100 * (PDP / DWPC) AS percent_of_DWPC\nORDER BY percent_of_DWPC DESC\nLIMIT 10"
    },
    "paths": [
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                29816,
                19170,
                6602
            ],
            "rel_ids": [
                1067367,
                719635,
                2237783
            ],
            "PDP": 4.494768395092515e-05,
            "percent_of_DWPC": 1.0127117597532767,
            "score": 2.433830509054376
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                36407,
                19170,
                6602
            ],
            "rel_ids": [
                672983,
                23365,
                2237783
            ],
            "PDP": 2.8427411366863883e-05,
            "percent_of_DWPC": 0.6404951548115189,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.539289569483778
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                39959,
                37620,
                6602
            ],
            "rel_ids": [
                2137837,
                1339826,
                566487
            ],
            "PDP": 2.746385207628499e-05,
            "percent_of_DWPC": 0.6187852970610243,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.4871146898780971
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                26435,
                19170,
                6602
            ],
            "rel_ids": [
                859153,
                661188,
                2237783
            ],
            "PDP": 2.6194229980341666e-05,
            "percent_of_DWPC": 0.5901795689347825,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.4183670988909798
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                44623,
                19170,
                6602
            ],
            "rel_ids": [
                1443537,
                1343672,
                2237783
            ],
            "PDP": 2.5950557428516856e-05,
            "percent_of_DWPC": 0.5846894071050539,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.405172699564468
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                11807,
                19170,
                6602
            ],
            "rel_ids": [
                1357836,
                1030045,
                2237783
            ],
            "PDP": 2.5039726114626876e-05,
            "percent_of_DWPC": 0.564167558109786,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.355852938333436
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                29376,
                38528,
                6602
            ],
            "rel_ids": [
                547502,
                1661805,
                2159342
            ],
            "PDP": 2.225071148218579e-05,
            "percent_of_DWPC": 0.5013285491081018,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.2048331681035516
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                31661,
                37620,
                6602
            ],
            "rel_ids": [
                1826359,
                2170388,
                566487
            ],
            "PDP": 2.1712081470751245e-05,
            "percent_of_DWPC": 0.4891927303341829,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.1756673904774337
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                8673,
                37620,
                6602
            ],
            "rel_ids": [
                325297,
                1707833,
                566487
            ],
            "PDP": 2.1273408342831148e-05,
            "percent_of_DWPC": 0.4793090300790713,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.1519140855596557
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                21140,
                37620,
                6602
            ],
            "rel_ids": [
                1767287,
                752475,
                566487
            ],
            "PDP": 2.1273408342831148e-05,
            "percent_of_DWPC": 0.4793090300790713,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.1519140855596557
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                26435,
                37620,
                6602
            ],
            "rel_ids": [
                859153,
                45383,
                566487
            ],
            "PDP": 2.0662560767544975e-05,
            "percent_of_DWPC": 0.46554608461597474,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.1188378659542897
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                20934,
                37620,
                6602
            ],
            "rel_ids": [
                698091,
                888397,
                566487
            ],
            "PDP": 2.0662560767544975e-05,
            "percent_of_DWPC": 0.46554608461597474,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.1188378659542897
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                44623,
                37620,
                6602
            ],
            "rel_ids": [
                1443537,
                1165243,
                566487
            ],
            "PDP": 2.0470346722190654e-05,
            "percent_of_DWPC": 0.46121532923528363,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.1084298456353143
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                5057,
                37620,
                6602
            ],
            "rel_ids": [
                1775221,
                793041,
                566487
            ],
            "PDP": 2.0470346722190654e-05,
            "percent_of_DWPC": 0.46121532923528363,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.1084298456353143
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                13810,
                37620,
                6602
            ],
            "rel_ids": [
                2235886,
                2012117,
                566487
            ],
            "PDP": 2.0283399000634574e-05,
            "percent_of_DWPC": 0.45700322886798483,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.098306986606178
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                3423,
                37620,
                6602
            ],
            "rel_ids": [
                830364,
                320117,
                566487
            ],
            "PDP": 2.0101481433520687e-05,
            "percent_of_DWPC": 0.45290446240600013,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.088456500751153
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                39867,
                37620,
                6602
            ],
            "rel_ids": [
                436986,
                2166487,
                566487
            ],
            "PDP": 1.9924372417879292e-05,
            "percent_of_DWPC": 0.44891403693504156,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.078866388696275
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                2517,
                37620,
                6602
            ],
            "rel_ids": [
                620180,
                161980,
                566487
            ],
            "PDP": 1.9924372417879292e-05,
            "percent_of_DWPC": 0.44891403693504156,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.078866388696275
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                11807,
                37620,
                6602
            ],
            "rel_ids": [
                1357836,
                37480,
                566487
            ],
            "PDP": 1.975186378200273e-05,
            "percent_of_DWPC": 0.4450272621592392,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.0695253783445482
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                26852,
                37620,
                6602
            ],
            "rel_ids": [
                457065,
                283049,
                566487
            ],
            "PDP": 1.941987604064536e-05,
            "percent_of_DWPC": 0.43754727965038254,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.051548881614932
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                10435,
                37620,
                6602
            ],
            "rel_ids": [
                1085914,
                241741,
                566487
            ],
            "PDP": 1.941987604064536e-05,
            "percent_of_DWPC": 0.43754727965038254,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.051548881614932
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                22305,
                23126,
                6602
            ],
            "rel_ids": [
                555093,
                350512,
                1908160
            ],
            "PDP": 1.9318607788799934e-05,
            "percent_of_DWPC": 0.4352656148232139,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.0460654008373889
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                6708,
                37620,
                6602
            ],
            "rel_ids": [
                1530044,
                878902,
                566487
            ],
            "PDP": 1.926003895185356e-05,
            "percent_of_DWPC": 0.43394600623124674,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.0428940111302893
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                22615,
                37620,
                6602
            ],
            "rel_ids": [
                1642812,
                1026720,
                566487
            ],
            "PDP": 1.8951858444717277e-05,
            "percent_of_DWPC": 0.42700242212924056,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.0262066302769608
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                24349,
                37620,
                6602
            ],
            "rel_ids": [
                676868,
                1030017,
                566487
            ],
            "PDP": 1.8803214122707974e-05,
            "percent_of_DWPC": 0.4236533318160727,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.0181578265544167
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                15519,
                37620,
                6602
            ],
            "rel_ids": [
                802699,
                1845118,
                566487
            ],
            "PDP": 1.865801338507312e-05,
            "percent_of_DWPC": 0.4203818285571236,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.0102954862928195
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                21757,
                37620,
                6602
            ],
            "rel_ids": [
                1438618,
                1794493,
                566487
            ],
            "PDP": 1.865801338507312e-05,
            "percent_of_DWPC": 0.4203818285571236,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.0102954862928195
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                33038,
                37620,
                6602
            ],
            "rel_ids": [
                571130,
                1709191,
                566487
            ],
            "PDP": 1.8516125292542163e-05,
            "percent_of_DWPC": 0.417184962172819,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 1.00261251938288
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                7673,
                37620,
                6602
            ],
            "rel_ids": [
                1084245,
                1953705,
                566487
            ],
            "PDP": 1.837742577187092e-05,
            "percent_of_DWPC": 0.41405993718133616,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.995102207497412
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                18905,
                37620,
                6602
            ],
            "rel_ids": [
                1834534,
                1589083,
                566487
            ],
            "PDP": 1.837742577187092e-05,
            "percent_of_DWPC": 0.41405993718133616,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.995102207497412
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                27716,
                37620,
                6602
            ],
            "rel_ids": [
                1890475,
                965220,
                566487
            ],
            "PDP": 1.824179715977193e-05,
            "percent_of_DWPC": 0.4110041025229447,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.9877581793960392
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                41596,
                37620,
                6602
            ],
            "rel_ids": [
                2013407,
                64252,
                566487
            ],
            "PDP": 1.824179715977193e-05,
            "percent_of_DWPC": 0.4110041025229447,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.9877581793960392
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                26016,
                19170,
                6602
            ],
            "rel_ids": [
                1882278,
                1447777,
                2237783
            ],
            "PDP": 1.7705760134706546e-05,
            "percent_of_DWPC": 0.39892670606488534,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.9587328069872785
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                31337,
                29897,
                6602
            ],
            "rel_ids": [
                387355,
                1190352,
                725145
            ],
            "PDP": 1.7575772338250507e-05,
            "percent_of_DWPC": 0.3959979640580853,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.9516942181878005
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                1735,
                38528,
                6602
            ],
            "rel_ids": [
                215325,
                172888,
                2159342
            ],
            "PDP": 1.7235327002354346e-05,
            "percent_of_DWPC": 0.38832742433480105,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.9332597590046753
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                34133,
                38528,
                6602
            ],
            "rel_ids": [
                487612,
                953581,
                2159342
            ],
            "PDP": 1.7235327002354346e-05,
            "percent_of_DWPC": 0.38832742433480105,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.9332597590046753
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                22305,
                10333,
                6602
            ],
            "rel_ids": [
                555093,
                2004930,
                1577078
            ],
            "PDP": 1.6910389254520898e-05,
            "percent_of_DWPC": 0.3810062845230599,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.9156650058448924
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                17819,
                15219,
                6602
            ],
            "rel_ids": [
                1607178,
                488342,
                1438257
            ],
            "PDP": 1.6899310885947403e-05,
            "percent_of_DWPC": 0.3807566789116671,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.9150651335254607
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                29816,
                29897,
                6602
            ],
            "rel_ids": [
                1067367,
                6777,
                725145
            ],
            "PDP": 1.6570597073290504e-05,
            "percent_of_DWPC": 0.3733504609620518,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.8972659137288314
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                20934,
                15219,
                6602
            ],
            "rel_ids": [
                698091,
                1085845,
                1438257
            ],
            "PDP": 1.6249092115465686e-05,
            "percent_of_DWPC": 0.36610666499775557,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.879857039535878
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                13810,
                15219,
                6602
            ],
            "rel_ids": [
                2235886,
                1436358,
                1438257
            ],
            "PDP": 1.5950918305041033e-05,
            "percent_of_DWPC": 0.35938854077588955,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.8637115020348836
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                31337,
                4002,
                6602
            ],
            "rel_ids": [
                387355,
                269349,
                470162
            ],
            "PDP": 1.5342653722738776e-05,
            "percent_of_DWPC": 0.3456837924686916,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.8307751465243126
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                40665,
                37620,
                6602
            ],
            "rel_ids": [
                607731,
                140243,
                566487
            ],
            "PDP": 1.504257129816638e-05,
            "percent_of_DWPC": 0.3389226654528582,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.8145262612435334
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                22615,
                15219,
                6602
            ],
            "rel_ids": [
                1642812,
                1625991,
                1438257
            ],
            "PDP": 1.490379131086115e-05,
            "percent_of_DWPC": 0.33579582747571424,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.8070115922448275
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                15519,
                15219,
                6602
            ],
            "rel_ids": [
                802699,
                819459,
                1438257
            ],
            "PDP": 1.4672710783353053e-05,
            "percent_of_DWPC": 0.3305893752831397,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7944990267806838
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                29987,
                38528,
                6602
            ],
            "rel_ids": [
                1639938,
                323902,
                2159342
            ],
            "PDP": 1.456650994767706e-05,
            "percent_of_DWPC": 0.3281965749043231,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.788748456089711
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                31631,
                38528,
                6602
            ],
            "rel_ids": [
                717289,
                1658481,
                2159342
            ],
            "PDP": 1.456650994767706e-05,
            "percent_of_DWPC": 0.3281965749043231,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.788748456089711
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                23704,
                38528,
                6602
            ],
            "rel_ids": [
                274375,
                1456404,
                2159342
            ],
            "PDP": 1.456650994767706e-05,
            "percent_of_DWPC": 0.3281965749043231,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.788748456089711
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                42219,
                38528,
                6602
            ],
            "rel_ids": [
                43539,
                2203445,
                2159342
            ],
            "PDP": 1.456650994767706e-05,
            "percent_of_DWPC": 0.3281965749043231,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.788748456089711
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                33038,
                15219,
                6602
            ],
            "rel_ids": [
                571130,
                1652601,
                1438257
            ],
            "PDP": 1.456112961432174e-05,
            "percent_of_DWPC": 0.32807535115303316,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7884571214019581
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                18668,
                10333,
                6602
            ],
            "rel_ids": [
                181319,
                162636,
                1577078
            ],
            "PDP": 1.4515794857130852e-05,
            "percent_of_DWPC": 0.3270539182849259,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7860023316225286
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                7673,
                15219,
                6602
            ],
            "rel_ids": [
                1084245,
                1670120,
                1438257
            ],
            "PDP": 1.445205594658458e-05,
            "percent_of_DWPC": 0.32561782328313343,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7825509923884365
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                7351,
                38528,
                6602
            ],
            "rel_ids": [
                326702,
                1523521,
                2159342
            ],
            "PDP": 1.3979696199876635e-05,
            "percent_of_DWPC": 0.31497513319820036,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7569736219494567
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                26016,
                37620,
                6602
            ],
            "rel_ids": [
                1882278,
                527650,
                566487
            ],
            "PDP": 1.3966676821327099e-05,
            "percent_of_DWPC": 0.31468179488568154,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7562686476785381
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                15827,
                29897,
                6602
            ],
            "rel_ids": [
                2067176,
                38048,
                725145
            ],
            "PDP": 1.3787570172185176e-05,
            "percent_of_DWPC": 0.31064636093464487,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7465703676173885
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                22305,
                46503,
                6602
            ],
            "rel_ids": [
                555093,
                1476346,
                88976
            ],
            "PDP": 1.3725314247226192e-05,
            "percent_of_DWPC": 0.30924367893240606,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7431993291963653
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                8422,
                37620,
                6602
            ],
            "rel_ids": [
                433145,
                1244972,
                566487
            ],
            "PDP": 1.329588021426947e-05,
            "percent_of_DWPC": 0.2995681437994196,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7199463034747848
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                9289,
                29897,
                6602
            ],
            "rel_ids": [
                1061430,
                816748,
                725145
            ],
            "PDP": 1.3286035059114015e-05,
            "percent_of_DWPC": 0.29934632359588226,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7194132072865611
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                29376,
                46503,
                6602
            ],
            "rel_ids": [
                547502,
                1589332,
                88976
            ],
            "PDP": 1.325991331442642e-05,
            "percent_of_DWPC": 0.29875777718580954,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7179987651266534
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                31043,
                37620,
                6602
            ],
            "rel_ids": [
                807298,
                2177866,
                566487
            ],
            "PDP": 1.3092877755656309e-05,
            "percent_of_DWPC": 0.2949943157614536,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.7089541113581632
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                39959,
                43573,
                6602
            ],
            "rel_ids": [
                2137837,
                500489,
                1956363
            ],
            "PDP": 1.2901148902079357e-05,
            "percent_of_DWPC": 0.2906744921880435,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6985723632393706
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                36407,
                38528,
                6602
            ],
            "rel_ids": [
                672983,
                989112,
                2159342
            ],
            "PDP": 1.2846454263900664e-05,
            "percent_of_DWPC": 0.28944217278000706,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6956107539331751
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                31337,
                46503,
                6602
            ],
            "rel_ids": [
                387355,
                1751586,
                88976
            ],
            "PDP": 1.2838855859731874e-05,
            "percent_of_DWPC": 0.28927097389764655,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6951993149832546
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                39959,
                29897,
                6602
            ],
            "rel_ids": [
                2137837,
                642610,
                725145
            ],
            "PDP": 1.2835529300313496e-05,
            "percent_of_DWPC": 0.2891960235209778,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6950191881982689
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                38142,
                38528,
                6602
            ],
            "rel_ids": [
                2071089,
                1059219,
                2159342
            ],
            "PDP": 1.2706051640982221e-05,
            "percent_of_DWPC": 0.28627877536257934,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.688008222341486
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                34133,
                10333,
                6602
            ],
            "rel_ids": [
                487612,
                976117,
                1577078
            ],
            "PDP": 1.2654576573480162e-05,
            "percent_of_DWPC": 0.2851189957786002,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6852209465859892
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                1735,
                10333,
                6602
            ],
            "rel_ids": [
                215325,
                323154,
                1577078
            ],
            "PDP": 1.2654576573480162e-05,
            "percent_of_DWPC": 0.2851189957786002,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6852209465859892
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                15827,
                10333,
                6602
            ],
            "rel_ids": [
                2067176,
                319063,
                1577078
            ],
            "PDP": 1.2408833247005665e-05,
            "percent_of_DWPC": 0.27958217753289644,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6719144188008612
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                17819,
                38528,
                6602
            ],
            "rel_ids": [
                1607178,
                434117,
                2159342
            ],
            "PDP": 1.231094785882453e-05,
            "percent_of_DWPC": 0.277376731667715,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6666141135747679
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                34133,
                4002,
                6602
            ],
            "rel_ids": [
                487612,
                258736,
                470162
            ],
            "PDP": 1.227412297819102e-05,
            "percent_of_DWPC": 0.2765470339749533,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6646201172194501
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                2517,
                14414,
                6602
            ],
            "rel_ids": [
                620180,
                1436843,
                1062975
            ],
            "PDP": 1.2152140234363022e-05,
            "percent_of_DWPC": 0.27379865300617046,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6580149866006868
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                9289,
                10333,
                6602
            ],
            "rel_ids": [
                1061430,
                1326397,
                1577078
            ],
            "PDP": 1.1957450914375853e-05,
            "percent_of_DWPC": 0.2694121274609468,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6474729349281431
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                20934,
                38528,
                6602
            ],
            "rel_ids": [
                698091,
                1746928,
                2159342
            ],
            "PDP": 1.1837271184417302e-05,
            "percent_of_DWPC": 0.26670437001685066,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.640965434037499
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                18668,
                46503,
                6602
            ],
            "rel_ids": [
                181319,
                1210521,
                88976
            ],
            "PDP": 1.1781742156475003e-05,
            "percent_of_DWPC": 0.26545325105672285,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6379586441327808
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                5057,
                38528,
                6602
            ],
            "rel_ids": [
                1775221,
                1506873,
                2159342
            ],
            "PDP": 1.1727154640494694e-05,
            "percent_of_DWPC": 0.264223345208196,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6350028352872923
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                13810,
                38528,
                6602
            ],
            "rel_ids": [
                2235886,
                2198007,
                2159342
            ],
            "PDP": 1.16200550944963e-05,
            "percent_of_DWPC": 0.26181029607722783,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6292036011634303
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                9289,
                4002,
                6602
            ],
            "rel_ids": [
                1061430,
                365434,
                470162
            ],
            "PDP": 1.1597956057756039e-05,
            "percent_of_DWPC": 0.26131238489652014,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6280069808904507
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                31661,
                23587,
                6602
            ],
            "rel_ids": [
                1826359,
                1972878,
                243603
            ],
            "PDP": 1.1555895860806355e-05,
            "percent_of_DWPC": 0.2603647308168352,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6257295022407222
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                39959,
                10333,
                6602
            ],
            "rel_ids": [
                2137837,
                677987,
                1577078
            ],
            "PDP": 1.1551995074952526e-05,
            "percent_of_DWPC": 0.2602768426019326,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6255182822003147
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                3423,
                38528,
                6602
            ],
            "rel_ids": [
                830364,
                60349,
                2159342
            ],
            "PDP": 1.1515837248539913e-05,
            "percent_of_DWPC": 0.2594621742409299,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6235604055461985
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                24349,
                14414,
                6602
            ],
            "rel_ids": [
                676868,
                1094217,
                1062975
            ],
            "PDP": 1.146833085045414e-05,
            "percent_of_DWPC": 0.25839181234959174,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6209880255952611
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                3718,
                23126,
                6602
            ],
            "rel_ids": [
                1918935,
                266076,
                1908160
            ],
            "PDP": 1.1429042497695008e-05,
            "percent_of_DWPC": 0.25750661041340406,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6188606369694072
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                15519,
                14414,
                6602
            ],
            "rel_ids": [
                802699,
                624100,
                1062975
            ],
            "PDP": 1.1379770985738484e-05,
            "percent_of_DWPC": 0.25639647891844924,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6161926795022782
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                21140,
                23587,
                6602
            ],
            "rel_ids": [
                1767287,
                504208,
                243603
            ],
            "PDP": 1.1322419351886301e-05,
            "percent_of_DWPC": 0.25510429500733645,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6130871989981891
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                8673,
                23587,
                6602
            ],
            "rel_ids": [
                325297,
                42241,
                243603
            ],
            "PDP": 1.1322419351886301e-05,
            "percent_of_DWPC": 0.25510429500733645,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6130871989981891
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                1735,
                27277,
                6602
            ],
            "rel_ids": [
                215325,
                596499,
                694619
            ],
            "PDP": 1.124628022090986e-05,
            "percent_of_DWPC": 0.2533888118825235,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.608964411712738
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                39959,
                4002,
                6602
            ],
            "rel_ids": [
                2137837,
                1937412,
                470162
            ],
            "PDP": 1.1204690047912853e-05,
            "percent_of_DWPC": 0.2524517478653824,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6067123839547007
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                41596,
                14414,
                6602
            ],
            "rel_ids": [
                2013407,
                1245605,
                1062975
            ],
            "PDP": 1.112591516375342e-05,
            "percent_of_DWPC": 0.2506768788499163,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6024468757112997
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                10435,
                38528,
                6602
            ],
            "rel_ids": [
                1085914,
                361170,
                2159342
            ],
            "PDP": 1.1125355741092895e-05,
            "percent_of_DWPC": 0.2506642745540509,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6024165840517758
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                3718,
                29897,
                6602
            ],
            "rel_ids": [
                1918935,
                607692,
                725145
            ],
            "PDP": 1.1115894445090989e-05,
            "percent_of_DWPC": 0.2504511030426088,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.6019042730973386
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                15827,
                27277,
                6602
            ],
            "rel_ids": [
                2067176,
                1766394,
                694619
            ],
            "PDP": 1.1027885058029225e-05,
            "percent_of_DWPC": 0.24846817236828445,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5971387343090004
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                26435,
                23587,
                6602
            ],
            "rel_ids": [
                859153,
                2141456,
                243603
            ],
            "PDP": 1.0997305844167463e-05,
            "percent_of_DWPC": 0.2477791951672427,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5954829287791558
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                44623,
                23587,
                6602
            ],
            "rel_ids": [
                1443537,
                847508,
                243603
            ],
            "PDP": 1.0895003101148973e-05,
            "percent_of_DWPC": 0.24547422232319233,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5899434322971969
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                5057,
                23587,
                6602
            ],
            "rel_ids": [
                1775221,
                2168159,
                243603
            ],
            "PDP": 1.0895003101148973e-05,
            "percent_of_DWPC": 0.24547422232319233,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5899434322971969
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                36407,
                23126,
                6602
            ],
            "rel_ids": [
                672983,
                1573536,
                1908160
            ],
            "PDP": 1.0775404603452504e-05,
            "percent_of_DWPC": 0.2427795605649073,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5834674040139922
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                24349,
                38528,
                6602
            ],
            "rel_ids": [
                676868,
                2249983,
                2159342
            ],
            "PDP": 1.0772079376471463e-05,
            "percent_of_DWPC": 0.2427046402092506,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5832873493779218
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                3423,
                23587,
                6602
            ],
            "rel_ids": [
                830364,
                322731,
                243603
            ],
            "PDP": 1.0698680658812956e-05,
            "percent_of_DWPC": 0.24105090106209592,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5793129501951345
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                31631,
                10333,
                6602
            ],
            "rel_ids": [
                717289,
                1541194,
                1577078
            ],
            "PDP": 1.069506923286457e-05,
            "percent_of_DWPC": 0.24096953238620594,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5791173984362503
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                42219,
                10333,
                6602
            ],
            "rel_ids": [
                43539,
                211133,
                1577078
            ],
            "PDP": 1.069506923286457e-05,
            "percent_of_DWPC": 0.24096953238620594,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5791173984362503
        },
        {
            "metapath": "CbGeAlD",
            "node_ids": [
                17054,
                23704,
                10333,
                6602
            ],
            "rel_ids": [
                274375,
                424181,
                1577078
            ],
            "PDP": 1.069506923286457e-05,
            "percent_of_DWPC": 0.24096953238620594,
            "PC": 484,
            "DWPC": 0.004438349166783211,
            "score": 0.5791173984362503
        }
    ],
    "nodes": {
        "1735": {
            "neo4j_id": 1735,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4704,
                "chromosome": "12",
                "name": "NDUFA9",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 9, 39kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4704"
            },
            "metanode": "Gene"
        },
        "2517": {
            "neo4j_id": 2517,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 55967,
                "chromosome": "12",
                "name": "NDUFA12",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 12",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/55967"
            },
            "metanode": "Gene"
        },
        "3423": {
            "neo4j_id": 3423,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4716,
                "chromosome": "16",
                "name": "NDUFB10",
                "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 10, 22kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4716"
            },
            "metanode": "Gene"
        },
        "3718": {
            "neo4j_id": 3718,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4695,
                "chromosome": "5",
                "name": "NDUFA2",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 2, 8kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4695"
            },
            "metanode": "Gene"
        },
        "4002": {
            "neo4j_id": 4002,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0002369",
                "mesh_id": "D000311",
                "name": "adrenal gland",
                "source": "Uberon",
                "bto_id": "BTO:0000047",
                "url": "http://purl.obolibrary.org/obo/UBERON_0002369"
            },
            "metanode": "Anatomy"
        },
        "5057": {
            "neo4j_id": 5057,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4712,
                "chromosome": "9",
                "name": "NDUFB6",
                "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 6, 17kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4712"
            },
            "metanode": "Gene"
        },
        "6602": {
            "neo4j_id": 6602,
            "node_label": "Disease",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "DOID:1612",
                "name": "breast cancer",
                "source": "Disease Ontology",
                "url": "http://purl.obolibrary.org/obo/DOID_1612"
            },
            "metanode": "Disease"
        },
        "6708": {
            "neo4j_id": 6708,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4724,
                "chromosome": "5",
                "name": "NDUFS4",
                "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 4, 18kDa (NADH-coenzyme Q reductase)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4724"
            },
            "metanode": "Gene"
        },
        "7351": {
            "neo4j_id": 7351,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4538,
                "chromosome": "MT",
                "name": "ND4",
                "description": "NADH dehydrogenase, subunit 4 (complex I)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4538"
            },
            "metanode": "Gene"
        },
        "7673": {
            "neo4j_id": 7673,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 54539,
                "chromosome": "X",
                "name": "NDUFB11",
                "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 11, 17.3kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/54539"
            },
            "metanode": "Gene"
        },
        "8422": {
            "neo4j_id": 8422,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4720,
                "chromosome": "1",
                "name": "NDUFS2",
                "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 2, 49kDa (NADH-coenzyme Q reductase)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4720"
            },
            "metanode": "Gene"
        },
        "8673": {
            "neo4j_id": 8673,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 91942,
                "chromosome": "5",
                "name": "NDUFAF2",
                "description": "NADH dehydrogenase (ubiquinone) complex I, assembly factor 2",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/91942"
            },
            "metanode": "Gene"
        },
        "9289": {
            "neo4j_id": 9289,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4729,
                "chromosome": "18",
                "name": "NDUFV2",
                "description": "NADH dehydrogenase (ubiquinone) flavoprotein 2, 24kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4729"
            },
            "metanode": "Gene"
        },
        "10333": {
            "neo4j_id": 10333,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0000474",
                "mesh_id": "D005836",
                "name": "female reproductive system",
                "source": "Uberon",
                "bto_id": "BTO:0000083",
                "url": "http://purl.obolibrary.org/obo/UBERON_0000474"
            },
            "metanode": "Anatomy"
        },
        "10435": {
            "neo4j_id": 10435,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4711,
                "chromosome": "3",
                "name": "NDUFB5",
                "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 5, 16kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4711"
            },
            "metanode": "Gene"
        },
        "11807": {
            "neo4j_id": 11807,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4728,
                "chromosome": "11",
                "name": "NDUFS8",
                "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 8, 23kDa (NADH-coenzyme Q reductase)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4728"
            },
            "metanode": "Gene"
        },
        "13810": {
            "neo4j_id": 13810,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4719,
                "chromosome": "2",
                "name": "NDUFS1",
                "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 1, 75kDa (NADH-coenzyme Q reductase)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4719"
            },
            "metanode": "Gene"
        },
        "14414": {
            "neo4j_id": 14414,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0000483",
                "mesh_id": "D004848",
                "name": "epithelium",
                "source": "Uberon",
                "bto_id": "BTO:0000416",
                "url": "http://purl.obolibrary.org/obo/UBERON_0000483"
            },
            "metanode": "Anatomy"
        },
        "15219": {
            "neo4j_id": 15219,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0000922",
                "mesh_id": "D004622",
                "name": "embryo",
                "source": "Uberon",
                "bto_id": "BTO:0000379",
                "url": "http://purl.obolibrary.org/obo/UBERON_0000922"
            },
            "metanode": "Anatomy"
        },
        "15519": {
            "neo4j_id": 15519,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4715,
                "chromosome": "8",
                "name": "NDUFB9",
                "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 9, 22kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4715"
            },
            "metanode": "Gene"
        },
        "15827": {
            "neo4j_id": 15827,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4694,
                "chromosome": "X",
                "name": "NDUFA1",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 1, 7.5kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4694"
            },
            "metanode": "Gene"
        },
        "17054": {
            "neo4j_id": 17054,
            "node_label": "Compound",
            "properties": {
                "license": "CC BY-NC 4.0",
                "identifier": "DB00331",
                "inchikey": "InChIKey=XZWYZXLIPXDOLR-UHFFFAOYSA-N",
                "inchi": "InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8)",
                "name": "Metformin",
                "source": "DrugBank",
                "url": "http://www.drugbank.ca/drugs/DB00331"
            },
            "metanode": "Compound"
        },
        "17819": {
            "neo4j_id": 17819,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4541,
                "chromosome": "MT",
                "name": "ND6",
                "description": "NADH dehydrogenase, subunit 6 (complex I)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4541"
            },
            "metanode": "Gene"
        },
        "18668": {
            "neo4j_id": 18668,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 25915,
                "chromosome": "3",
                "name": "NDUFAF3",
                "description": "NADH dehydrogenase (ubiquinone) complex I, assembly factor 3",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/25915"
            },
            "metanode": "Gene"
        },
        "18905": {
            "neo4j_id": 18905,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4723,
                "chromosome": "11",
                "name": "NDUFV1",
                "description": "NADH dehydrogenase (ubiquinone) flavoprotein 1, 51kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4723"
            },
            "metanode": "Gene"
        },
        "19170": {
            "neo4j_id": 19170,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0001911",
                "mesh_id": "D008321",
                "name": "mammary gland",
                "source": "Uberon",
                "bto_id": "BTO:0000817",
                "url": "http://purl.obolibrary.org/obo/UBERON_0001911"
            },
            "metanode": "Anatomy"
        },
        "20934": {
            "neo4j_id": 20934,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4698,
                "chromosome": "7",
                "name": "NDUFA5",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 5",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4698"
            },
            "metanode": "Gene"
        },
        "21140": {
            "neo4j_id": 21140,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4709,
                "chromosome": "2",
                "name": "NDUFB3",
                "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 3, 12kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4709"
            },
            "metanode": "Gene"
        },
        "21757": {
            "neo4j_id": 21757,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4702,
                "chromosome": "9",
                "name": "NDUFA8",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 8, 19kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4702"
            },
            "metanode": "Gene"
        },
        "22305": {
            "neo4j_id": 22305,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4731,
                "chromosome": "21",
                "name": "NDUFV3",
                "description": "NADH dehydrogenase (ubiquinone) flavoprotein 3, 10kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4731"
            },
            "metanode": "Gene"
        },
        "22615": {
            "neo4j_id": 22615,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4710,
                "chromosome": "3",
                "name": "NDUFB4",
                "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 4, 15kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4710"
            },
            "metanode": "Gene"
        },
        "23126": {
            "neo4j_id": 23126,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0000995",
                "mesh_id": "D014599",
                "name": "uterus",
                "source": "Uberon",
                "bto_id": "BTO:0001424",
                "url": "http://purl.obolibrary.org/obo/UBERON_0000995"
            },
            "metanode": "Anatomy"
        },
        "23587": {
            "neo4j_id": 23587,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0001295",
                "mesh_id": "D004717",
                "name": "endometrium",
                "source": "Uberon",
                "bto_id": "BTO:0001422",
                "url": "http://purl.obolibrary.org/obo/UBERON_0001295"
            },
            "metanode": "Anatomy"
        },
        "23704": {
            "neo4j_id": 23704,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4537,
                "chromosome": "MT",
                "name": "ND3",
                "description": "NADH dehydrogenase, subunit 3 (complex I)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4537"
            },
            "metanode": "Gene"
        },
        "24349": {
            "neo4j_id": 24349,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4706,
                "chromosome": "16",
                "name": "NDUFAB1",
                "description": "NADH dehydrogenase (ubiquinone) 1, alpha/beta subcomplex, 1, 8kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4706"
            },
            "metanode": "Gene"
        },
        "26016": {
            "neo4j_id": 26016,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4718,
                "chromosome": "11",
                "name": "NDUFC2",
                "description": "NADH dehydrogenase (ubiquinone) 1, subcomplex unknown, 2, 14.5kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4718"
            },
            "metanode": "Gene"
        },
        "26435": {
            "neo4j_id": 26435,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 126328,
                "chromosome": "19",
                "name": "NDUFA11",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 11, 14.7kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/126328"
            },
            "metanode": "Gene"
        },
        "26852": {
            "neo4j_id": 26852,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4700,
                "chromosome": "22",
                "name": "NDUFA6",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 6, 14kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4700"
            },
            "metanode": "Gene"
        },
        "27277": {
            "neo4j_id": 27277,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0000992",
                "mesh_id": "D010053",
                "name": "female gonad",
                "source": "Uberon",
                "bto_id": "BTO:0000975",
                "url": "http://purl.obolibrary.org/obo/UBERON_0000992"
            },
            "metanode": "Anatomy"
        },
        "27716": {
            "neo4j_id": 27716,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4714,
                "chromosome": "10",
                "name": "NDUFB8",
                "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 8, 19kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4714"
            },
            "metanode": "Gene"
        },
        "29376": {
            "neo4j_id": 29376,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4726,
                "chromosome": "5",
                "name": "NDUFS6",
                "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 6, 13kDa (NADH-coenzyme Q reductase)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4726"
            },
            "metanode": "Gene"
        },
        "29816": {
            "neo4j_id": 29816,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 222962,
                "chromosome": "7",
                "name": "SLC29A4",
                "description": "solute carrier family 29 (equilibrative nucleoside transporter), member 4",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/222962"
            },
            "metanode": "Gene"
        },
        "29897": {
            "neo4j_id": 29897,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0001013",
                "mesh_id": "D000273",
                "name": "adipose tissue",
                "source": "Uberon",
                "bto_id": "BTO:0001487",
                "url": "http://purl.obolibrary.org/obo/UBERON_0001013"
            },
            "metanode": "Anatomy"
        },
        "29987": {
            "neo4j_id": 29987,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4540,
                "chromosome": "MT",
                "name": "ND5",
                "description": "NADH dehydrogenase, subunit 5 (complex I)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4540"
            },
            "metanode": "Gene"
        },
        "31043": {
            "neo4j_id": 31043,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4722,
                "chromosome": "11",
                "name": "NDUFS3",
                "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 3, 30kDa (NADH-coenzyme Q reductase)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4722"
            },
            "metanode": "Gene"
        },
        "31337": {
            "neo4j_id": 31337,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4701,
                "chromosome": "19",
                "name": "NDUFA7",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 7, 14.5kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4701"
            },
            "metanode": "Gene"
        },
        "31631": {
            "neo4j_id": 31631,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4536,
                "chromosome": "MT",
                "name": "ND2",
                "description": "MTND2",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4536"
            },
            "metanode": "Gene"
        },
        "31661": {
            "neo4j_id": 31661,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 51103,
                "chromosome": "15",
                "name": "NDUFAF1",
                "description": "NADH dehydrogenase (ubiquinone) complex I, assembly factor 1",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/51103"
            },
            "metanode": "Gene"
        },
        "33038": {
            "neo4j_id": 33038,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4697,
                "chromosome": "7",
                "name": "NDUFA4",
                "description": "NDUFA4, mitochondrial complex associated",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4697"
            },
            "metanode": "Gene"
        },
        "34133": {
            "neo4j_id": 34133,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 51079,
                "chromosome": "19",
                "name": "NDUFA13",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 13",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/51079"
            },
            "metanode": "Gene"
        },
        "36407": {
            "neo4j_id": 36407,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4705,
                "chromosome": "2",
                "name": "NDUFA10",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 10, 42kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4705"
            },
            "metanode": "Gene"
        },
        "37620": {
            "neo4j_id": 37620,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0002030",
                "mesh_id": "D009558",
                "name": "nipple",
                "source": "Uberon",
                "bto_id": "BTO:0000821",
                "url": "http://purl.obolibrary.org/obo/UBERON_0002030"
            },
            "metanode": "Anatomy"
        },
        "38142": {
            "neo4j_id": 38142,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4717,
                "chromosome": "4",
                "name": "NDUFC1",
                "description": "NADH dehydrogenase (ubiquinone) 1, subcomplex unknown, 1, 6kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4717"
            },
            "metanode": "Gene"
        },
        "38528": {
            "neo4j_id": 38528,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0002097",
                "mesh_id": "D012867",
                "name": "skin of body",
                "source": "Uberon",
                "bto_id": "BTO:0001253",
                "url": "http://purl.obolibrary.org/obo/UBERON_0002097"
            },
            "metanode": "Anatomy"
        },
        "39867": {
            "neo4j_id": 39867,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4713,
                "chromosome": "19",
                "name": "NDUFB7",
                "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 7, 18kDa",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4713"
            },
            "metanode": "Gene"
        },
        "39959": {
            "neo4j_id": 39959,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 56901,
                "chromosome": "12",
                "name": "NDUFA4L2",
                "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 4-like 2",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/56901"
            },
            "metanode": "Gene"
        },
        "40665": {
            "neo4j_id": 40665,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 5564,
                "chromosome": "12",
                "name": "PRKAB1",
                "description": "protein kinase, AMP-activated, beta 1 non-catalytic subunit",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/5564"
            },
            "metanode": "Gene"
        },
        "41596": {
            "neo4j_id": 41596,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4725,
                "chromosome": "1",
                "name": "NDUFS5",
                "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 5, 15kDa (NADH-coenzyme Q reductase)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4725"
            },
            "metanode": "Gene"
        },
        "42219": {
            "neo4j_id": 42219,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 4539,
                "chromosome": "MT",
                "name": "ND4L",
                "description": "NADH dehydrogenase, subunit 4L (complex I)",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/4539"
            },
            "metanode": "Gene"
        },
        "43573": {
            "neo4j_id": 43573,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0000007",
                "mesh_id": "D010902",
                "name": "pituitary gland",
                "source": "Uberon",
                "bto_id": "BTO:0001073",
                "url": "http://purl.obolibrary.org/obo/UBERON_0000007"
            },
            "metanode": "Anatomy"
        },
        "44623": {
            "neo4j_id": 44623,
            "node_label": "Gene",
            "properties": {
                "license": "CC0 1.0",
                "identifier": 29078,
                "chromosome": "6",
                "name": "NDUFAF4",
                "description": "NADH dehydrogenase (ubiquinone) complex I, assembly factor 4",
                "source": "Entrez Gene",
                "url": "http://identifiers.org/ncbigene/29078"
            },
            "metanode": "Gene"
        },
        "46503": {
            "neo4j_id": 46503,
            "node_label": "Anatomy",
            "properties": {
                "license": "CC BY 3.0",
                "identifier": "UBERON:0002368",
                "mesh_id": "D004702",
                "name": "endocrine gland",
                "source": "Uberon",
                "bto_id": "BTO:0001488",
                "url": "http://purl.obolibrary.org/obo/UBERON_0002368"
            },
            "metanode": "Anatomy"
        }
    },
    "relationships": {
        "6777": {
            "neo4j_id": 6777,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 29897,
            "target_neo4j_id": 29816,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "23365": {
            "neo4j_id": 23365,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 19170,
            "target_neo4j_id": 36407,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "37480": {
            "neo4j_id": 37480,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 11807,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "38048": {
            "neo4j_id": 38048,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 29897,
            "target_neo4j_id": 15827,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "42241": {
            "neo4j_id": 42241,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23587,
            "target_neo4j_id": 8673,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "43539": {
            "neo4j_id": 43539,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 42219,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "45383": {
            "neo4j_id": 45383,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 26435,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "60349": {
            "neo4j_id": 60349,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 3423,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "64252": {
            "neo4j_id": 64252,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 41596,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "88976": {
            "neo4j_id": 88976,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 46503,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "140243": {
            "neo4j_id": 140243,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 40665,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "161980": {
            "neo4j_id": 161980,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 2517,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "162636": {
            "neo4j_id": 162636,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 18668,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "172888": {
            "neo4j_id": 172888,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 1735,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "181319": {
            "neo4j_id": 181319,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 18668,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "211133": {
            "neo4j_id": 211133,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 42219,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "215325": {
            "neo4j_id": 215325,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 1735,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "241741": {
            "neo4j_id": 241741,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 10435,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "243603": {
            "neo4j_id": 243603,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 23587,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "258736": {
            "neo4j_id": 258736,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 4002,
            "target_neo4j_id": 34133,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "266076": {
            "neo4j_id": 266076,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23126,
            "target_neo4j_id": 3718,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "269349": {
            "neo4j_id": 269349,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 4002,
            "target_neo4j_id": 31337,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "274375": {
            "neo4j_id": 274375,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 23704,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "283049": {
            "neo4j_id": 283049,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 26852,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "319063": {
            "neo4j_id": 319063,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 15827,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "320117": {
            "neo4j_id": 320117,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 3423,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "322731": {
            "neo4j_id": 322731,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23587,
            "target_neo4j_id": 3423,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "323154": {
            "neo4j_id": 323154,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 1735,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "323902": {
            "neo4j_id": 323902,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 29987,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "325297": {
            "neo4j_id": 325297,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 8673,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "326702": {
            "neo4j_id": 326702,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 7351,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "350512": {
            "neo4j_id": 350512,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23126,
            "target_neo4j_id": 22305,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "361170": {
            "neo4j_id": 361170,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 10435,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "365434": {
            "neo4j_id": 365434,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 4002,
            "target_neo4j_id": 9289,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "387355": {
            "neo4j_id": 387355,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 31337,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "424181": {
            "neo4j_id": 424181,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 23704,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "433145": {
            "neo4j_id": 433145,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 8422,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "434117": {
            "neo4j_id": 434117,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 17819,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "436986": {
            "neo4j_id": 436986,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 39867,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "457065": {
            "neo4j_id": 457065,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 26852,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "470162": {
            "neo4j_id": 470162,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 4002,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "487612": {
            "neo4j_id": 487612,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 34133,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "488342": {
            "neo4j_id": 488342,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 15219,
            "target_neo4j_id": 17819,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "500489": {
            "neo4j_id": 500489,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 43573,
            "target_neo4j_id": 39959,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "504208": {
            "neo4j_id": 504208,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23587,
            "target_neo4j_id": 21140,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "527650": {
            "neo4j_id": 527650,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 26016,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "547502": {
            "neo4j_id": 547502,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 29376,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "555093": {
            "neo4j_id": 555093,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 22305,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "566487": {
            "neo4j_id": 566487,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 37620,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "571130": {
            "neo4j_id": 571130,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 33038,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "596499": {
            "neo4j_id": 596499,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 27277,
            "target_neo4j_id": 1735,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "607692": {
            "neo4j_id": 607692,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 29897,
            "target_neo4j_id": 3718,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "607731": {
            "neo4j_id": 607731,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 40665,
            "properties": {
                "license": "CC BY-NC 4.0",
                "pubmed_ids": [
                    "12086935",
                    "12890675",
                    "12960015",
                    "14500570",
                    "14502105",
                    "14871885",
                    "17307971",
                    "19428322"
                ],
                "sources": [
                    "DrugBank (target)"
                ],
                "unbiased": false,
                "actions": [
                    "inducer"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "620180": {
            "neo4j_id": 620180,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 2517,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "624100": {
            "neo4j_id": 624100,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 14414,
            "target_neo4j_id": 15519,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "642610": {
            "neo4j_id": 642610,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 29897,
            "target_neo4j_id": 39959,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "661188": {
            "neo4j_id": 661188,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 19170,
            "target_neo4j_id": 26435,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "672983": {
            "neo4j_id": 672983,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 36407,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "676868": {
            "neo4j_id": 676868,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 24349,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "677987": {
            "neo4j_id": 677987,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 39959,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "694619": {
            "neo4j_id": 694619,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 27277,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "698091": {
            "neo4j_id": 698091,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 20934,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "717289": {
            "neo4j_id": 717289,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 31631,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "719635": {
            "neo4j_id": 719635,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 19170,
            "target_neo4j_id": 29816,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "725145": {
            "neo4j_id": 725145,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 29897,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "752475": {
            "neo4j_id": 752475,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 21140,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "793041": {
            "neo4j_id": 793041,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 5057,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "802699": {
            "neo4j_id": 802699,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 15519,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "807298": {
            "neo4j_id": 807298,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 31043,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "816748": {
            "neo4j_id": 816748,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 29897,
            "target_neo4j_id": 9289,
            "properties": {
                "sources": [
                    "Bgee",
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "819459": {
            "neo4j_id": 819459,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 15219,
            "target_neo4j_id": 15519,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "830364": {
            "neo4j_id": 830364,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 3423,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "847508": {
            "neo4j_id": 847508,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23587,
            "target_neo4j_id": 44623,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "859153": {
            "neo4j_id": 859153,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 26435,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "878902": {
            "neo4j_id": 878902,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 6708,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "888397": {
            "neo4j_id": 888397,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 20934,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "953581": {
            "neo4j_id": 953581,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 34133,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "965220": {
            "neo4j_id": 965220,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 27716,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "976117": {
            "neo4j_id": 976117,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 34133,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "989112": {
            "neo4j_id": 989112,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 36407,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1026720": {
            "neo4j_id": 1026720,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 22615,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1030017": {
            "neo4j_id": 1030017,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 24349,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1030045": {
            "neo4j_id": 1030045,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 19170,
            "target_neo4j_id": 11807,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1059219": {
            "neo4j_id": 1059219,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 38142,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1061430": {
            "neo4j_id": 1061430,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 9289,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1062975": {
            "neo4j_id": 1062975,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 14414,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "1067367": {
            "neo4j_id": 1067367,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 29816,
            "properties": {
                "license": "CC BY-NC 4.0",
                "pubmed_ids": [
                    "17600084"
                ],
                "sources": [
                    "DrugBank (transporter)"
                ],
                "unbiased": false,
                "actions": [
                    "substrate"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1084245": {
            "neo4j_id": 1084245,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 7673,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1085845": {
            "neo4j_id": 1085845,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 15219,
            "target_neo4j_id": 20934,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1085914": {
            "neo4j_id": 1085914,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 10435,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1094217": {
            "neo4j_id": 1094217,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 14414,
            "target_neo4j_id": 24349,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1165243": {
            "neo4j_id": 1165243,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 44623,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1190352": {
            "neo4j_id": 1190352,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 29897,
            "target_neo4j_id": 31337,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1210521": {
            "neo4j_id": 1210521,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 46503,
            "target_neo4j_id": 18668,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1244972": {
            "neo4j_id": 1244972,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 8422,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1245605": {
            "neo4j_id": 1245605,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 14414,
            "target_neo4j_id": 41596,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1326397": {
            "neo4j_id": 1326397,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 9289,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1339826": {
            "neo4j_id": 1339826,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 39959,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1343672": {
            "neo4j_id": 1343672,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 19170,
            "target_neo4j_id": 44623,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1357836": {
            "neo4j_id": 1357836,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 11807,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1436358": {
            "neo4j_id": 1436358,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 15219,
            "target_neo4j_id": 13810,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1436843": {
            "neo4j_id": 1436843,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 14414,
            "target_neo4j_id": 2517,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1438257": {
            "neo4j_id": 1438257,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 15219,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "1438618": {
            "neo4j_id": 1438618,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 21757,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1443537": {
            "neo4j_id": 1443537,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 44623,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1447777": {
            "neo4j_id": 1447777,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 19170,
            "target_neo4j_id": 26016,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1456404": {
            "neo4j_id": 1456404,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 23704,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1476346": {
            "neo4j_id": 1476346,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 46503,
            "target_neo4j_id": 22305,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1506873": {
            "neo4j_id": 1506873,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 5057,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1523521": {
            "neo4j_id": 1523521,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 7351,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1530044": {
            "neo4j_id": 1530044,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 6708,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1541194": {
            "neo4j_id": 1541194,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 31631,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1573536": {
            "neo4j_id": 1573536,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23126,
            "target_neo4j_id": 36407,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1577078": {
            "neo4j_id": 1577078,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 10333,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "1589083": {
            "neo4j_id": 1589083,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 18905,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1589332": {
            "neo4j_id": 1589332,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 46503,
            "target_neo4j_id": 29376,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1607178": {
            "neo4j_id": 1607178,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 17819,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1625991": {
            "neo4j_id": 1625991,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 15219,
            "target_neo4j_id": 22615,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1639938": {
            "neo4j_id": 1639938,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 29987,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1642812": {
            "neo4j_id": 1642812,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 22615,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1652601": {
            "neo4j_id": 1652601,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 15219,
            "target_neo4j_id": 33038,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1658481": {
            "neo4j_id": 1658481,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 31631,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1661805": {
            "neo4j_id": 1661805,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 29376,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1670120": {
            "neo4j_id": 1670120,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 15219,
            "target_neo4j_id": 7673,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1707833": {
            "neo4j_id": 1707833,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 8673,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1709191": {
            "neo4j_id": 1709191,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 33038,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1746928": {
            "neo4j_id": 1746928,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 20934,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1751586": {
            "neo4j_id": 1751586,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 46503,
            "target_neo4j_id": 31337,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        },
        "1766394": {
            "neo4j_id": 1766394,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 27277,
            "target_neo4j_id": 15827,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1767287": {
            "neo4j_id": 1767287,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 21140,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1775221": {
            "neo4j_id": 1775221,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 5057,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1794493": {
            "neo4j_id": 1794493,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 21757,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1826359": {
            "neo4j_id": 1826359,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 31661,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1834534": {
            "neo4j_id": 1834534,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 18905,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1845118": {
            "neo4j_id": 1845118,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 15519,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1882278": {
            "neo4j_id": 1882278,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 26016,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1890475": {
            "neo4j_id": 1890475,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 27716,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1908160": {
            "neo4j_id": 1908160,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 23126,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "1918935": {
            "neo4j_id": 1918935,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 3718,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "1937412": {
            "neo4j_id": 1937412,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 4002,
            "target_neo4j_id": 39959,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1953705": {
            "neo4j_id": 1953705,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 7673,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "1956363": {
            "neo4j_id": 1956363,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 43573,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "1972878": {
            "neo4j_id": 1972878,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23587,
            "target_neo4j_id": 31661,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2004930": {
            "neo4j_id": 2004930,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 10333,
            "target_neo4j_id": 22305,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2012117": {
            "neo4j_id": 2012117,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 13810,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2013407": {
            "neo4j_id": 2013407,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 41596,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "2067176": {
            "neo4j_id": 2067176,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 15827,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "2071089": {
            "neo4j_id": 2071089,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 38142,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "2137837": {
            "neo4j_id": 2137837,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 39959,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "2141456": {
            "neo4j_id": 2141456,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23587,
            "target_neo4j_id": 26435,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2159342": {
            "neo4j_id": 2159342,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 38528,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "2166487": {
            "neo4j_id": 2166487,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 39867,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2168159": {
            "neo4j_id": 2168159,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 23587,
            "target_neo4j_id": 5057,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2170388": {
            "neo4j_id": 2170388,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 31661,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2177866": {
            "neo4j_id": 2177866,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 37620,
            "target_neo4j_id": 31043,
            "properties": {
                "sources": [
                    "Bgee"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2198007": {
            "neo4j_id": 2198007,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 13810,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2203445": {
            "neo4j_id": 2203445,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 42219,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": true
            },
            "kind": "expresses",
            "directed": false
        },
        "2235886": {
            "neo4j_id": 2235886,
            "rel_type": "BINDS_CbG",
            "source_neo4j_id": 17054,
            "target_neo4j_id": 13810,
            "properties": {
                "license": "CC BY 4.0",
                "urls": [
                    "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431"
                ],
                "sources": [
                    "DrugCentral (ChEMBL)"
                ],
                "unbiased": false,
                "actions": [
                    "inhibitor"
                ]
            },
            "kind": "binds",
            "directed": false
        },
        "2237783": {
            "neo4j_id": 2237783,
            "rel_type": "LOCALIZES_DlA",
            "source_neo4j_id": 6602,
            "target_neo4j_id": 19170,
            "properties": {
                "license": "CC0 1.0",
                "unbiased": false,
                "source": "MEDLINE cooccurrence"
            },
            "kind": "localizes",
            "directed": false
        },
        "2249983": {
            "neo4j_id": 2249983,
            "rel_type": "EXPRESSES_AeG",
            "source_neo4j_id": 38528,
            "target_neo4j_id": 24349,
            "properties": {
                "license": "CC BY 4.0",
                "sources": [
                    "TISSUES"
                ],
                "unbiased": false
            },
            "kind": "expresses",
            "directed": false
        }
    }
}