Query Paths
For a given source node, target node, and metapath, return the actual paths comprising the path count / DWPC.
These paths have not been pre-computed and are extracted on-the-fly from the Hetionet Neo4j Browser.
Therefore, it is advisable to avoid querying a source-target-metapath pair with a path count exceeding 10,000.
Because results are ordered by PDP / percent_of_DWPC, reducing limit does not prevent neo4j from having to exhaustively traverse all paths.
GET /v1/paths/source/17054/target/6602/metapath/CbGeAlD/?format=api
{ "query": { "source_id": 17054, "target_id": 6602, "source_metanode": "Compound", "target_metanode": "Disease", "source_identifier": "DB00331", "target_identifier": "DOID:1612", "metapath": "CbGeAlD", "metapath_id": [ [ "Compound", "Gene", "binds", "both" ], [ "Gene", "Anatomy", "expresses", "both" ], [ "Anatomy", "Disease", "localizes", "both" ] ], "metapath_unadjusted_p_value": 3.2653823879721316e-05, "metapath_adjusted_p_value": 0.003951112689446279, "metapath_score": 2.4032805836552362, "limit": 100 }, "path_count_info": { "id": 77513331, "adjusted_p_value": 0.003951112689446279, "path_count": 484, "dwpc": 3.5346993748913973, "p_value": 3.2653823879721316e-05, "source": 17054, "target": 6602, "reversed": false, "metapath_abbreviation": "CbGeAlD", "metapath_name": "Compound–binds–Gene–expresses–Anatomy–localizes–Disease", "metapath_length": 3, "metapath_path_count_density": 0.800046, "metapath_path_count_mean": 17.3173, "metapath_path_count_max": 1670, "metapath_dwpc_raw_mean": 0.000259132, "metapath_n_similar": 121, "metapath_p_threshold": 1.0, "metapath_source": "Compound", "metapath_target": "Disease", "metapath_id": "CbGeAlD", "metapath_reversed": false, "metapath_metaedges": [ [ "Compound", "Gene", "binds", "both" ], [ "Gene", "Anatomy", "expresses", "both" ], [ "Anatomy", "Disease", "localizes", "both" ] ], "dgp_id": 21810569, "dgp_source_degree": 56, "dgp_target_degree": 39, "dgp_n_dwpcs": 800, "dgp_n_nonzero_dwpcs": 800, "dgp_nonzero_mean": 1.9215512456202535, "dgp_nonzero_sd": 0.33090308109283123, "dgp_reversed": false, "cypher_query": "MATCH path = (n0:Compound)-[:BINDS_CbG]-(n1)-[:EXPRESSES_AeG]-(n2)-[:LOCALIZES_DlA]-(n3:Disease)\nUSING JOIN ON n1\nWHERE n0.identifier = 'DB00331' // Metformin\nAND n3.identifier = 'DOID:1612' // breast cancer\nWITH\n[\nsize((n0)-[:BINDS_CbG]-()),\nsize(()-[:BINDS_CbG]-(n1)),\nsize((n1)-[:EXPRESSES_AeG]-()),\nsize(()-[:EXPRESSES_AeG]-(n2)),\nsize((n2)-[:LOCALIZES_DlA]-()),\nsize(()-[:LOCALIZES_DlA]-(n3))\n] AS degrees, path\nWITH path, reduce(pdp = 1.0, d in degrees| pdp * d ^ -0.5) AS PDP\nWITH collect({paths: path, PDPs: PDP}) AS data_maps, count(path) AS PC, sum(PDP) AS DWPC\nUNWIND data_maps AS data_map\nWITH data_map.paths AS path, data_map.PDPs AS PDP, PC, DWPC\nRETURN\n path AS neo4j_path,\n substring(reduce(s = '', node IN nodes(path)| s + '–' + node.name), 1) AS path,\n PDP,\n 100 * (PDP / DWPC) AS percent_of_DWPC\nORDER BY percent_of_DWPC DESC\nLIMIT 10" }, "paths": [ { "metapath": "CbGeAlD", "node_ids": [ 17054, 29816, 19170, 6602 ], "rel_ids": [ 1067367, 719635, 2237783 ], "PDP": 4.494768395092515e-05, "percent_of_DWPC": 1.0127117597532767, "score": 2.433830509054376 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 36407, 19170, 6602 ], "rel_ids": [ 672983, 23365, 2237783 ], "PDP": 2.8427411366863883e-05, "percent_of_DWPC": 0.6404951548115189, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.539289569483778 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 39959, 37620, 6602 ], "rel_ids": [ 2137837, 1339826, 566487 ], "PDP": 2.746385207628499e-05, "percent_of_DWPC": 0.6187852970610243, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.4871146898780971 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 26435, 19170, 6602 ], "rel_ids": [ 859153, 661188, 2237783 ], "PDP": 2.6194229980341666e-05, "percent_of_DWPC": 0.5901795689347825, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.4183670988909798 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 44623, 19170, 6602 ], "rel_ids": [ 1443537, 1343672, 2237783 ], "PDP": 2.5950557428516856e-05, "percent_of_DWPC": 0.5846894071050539, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.405172699564468 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 11807, 19170, 6602 ], "rel_ids": [ 1357836, 1030045, 2237783 ], "PDP": 2.5039726114626876e-05, "percent_of_DWPC": 0.564167558109786, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.355852938333436 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 29376, 38528, 6602 ], "rel_ids": [ 547502, 1661805, 2159342 ], "PDP": 2.225071148218579e-05, "percent_of_DWPC": 0.5013285491081018, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.2048331681035516 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 31661, 37620, 6602 ], "rel_ids": [ 1826359, 2170388, 566487 ], "PDP": 2.1712081470751245e-05, "percent_of_DWPC": 0.4891927303341829, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.1756673904774337 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 8673, 37620, 6602 ], "rel_ids": [ 325297, 1707833, 566487 ], "PDP": 2.1273408342831148e-05, "percent_of_DWPC": 0.4793090300790713, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.1519140855596557 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 21140, 37620, 6602 ], "rel_ids": [ 1767287, 752475, 566487 ], "PDP": 2.1273408342831148e-05, "percent_of_DWPC": 0.4793090300790713, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.1519140855596557 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 26435, 37620, 6602 ], "rel_ids": [ 859153, 45383, 566487 ], "PDP": 2.0662560767544975e-05, "percent_of_DWPC": 0.46554608461597474, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.1188378659542897 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 20934, 37620, 6602 ], "rel_ids": [ 698091, 888397, 566487 ], "PDP": 2.0662560767544975e-05, "percent_of_DWPC": 0.46554608461597474, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.1188378659542897 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 44623, 37620, 6602 ], "rel_ids": [ 1443537, 1165243, 566487 ], "PDP": 2.0470346722190654e-05, "percent_of_DWPC": 0.46121532923528363, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.1084298456353143 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 5057, 37620, 6602 ], "rel_ids": [ 1775221, 793041, 566487 ], "PDP": 2.0470346722190654e-05, "percent_of_DWPC": 0.46121532923528363, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.1084298456353143 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 13810, 37620, 6602 ], "rel_ids": [ 2235886, 2012117, 566487 ], "PDP": 2.0283399000634574e-05, "percent_of_DWPC": 0.45700322886798483, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.098306986606178 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 3423, 37620, 6602 ], "rel_ids": [ 830364, 320117, 566487 ], "PDP": 2.0101481433520687e-05, "percent_of_DWPC": 0.45290446240600013, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.088456500751153 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 39867, 37620, 6602 ], "rel_ids": [ 436986, 2166487, 566487 ], "PDP": 1.9924372417879292e-05, "percent_of_DWPC": 0.44891403693504156, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.078866388696275 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 2517, 37620, 6602 ], "rel_ids": [ 620180, 161980, 566487 ], "PDP": 1.9924372417879292e-05, "percent_of_DWPC": 0.44891403693504156, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.078866388696275 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 11807, 37620, 6602 ], "rel_ids": [ 1357836, 37480, 566487 ], "PDP": 1.975186378200273e-05, "percent_of_DWPC": 0.4450272621592392, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.0695253783445482 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 26852, 37620, 6602 ], "rel_ids": [ 457065, 283049, 566487 ], "PDP": 1.941987604064536e-05, "percent_of_DWPC": 0.43754727965038254, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.051548881614932 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 10435, 37620, 6602 ], "rel_ids": [ 1085914, 241741, 566487 ], "PDP": 1.941987604064536e-05, "percent_of_DWPC": 0.43754727965038254, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.051548881614932 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 22305, 23126, 6602 ], "rel_ids": [ 555093, 350512, 1908160 ], "PDP": 1.9318607788799934e-05, "percent_of_DWPC": 0.4352656148232139, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.0460654008373889 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 6708, 37620, 6602 ], "rel_ids": [ 1530044, 878902, 566487 ], "PDP": 1.926003895185356e-05, "percent_of_DWPC": 0.43394600623124674, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.0428940111302893 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 22615, 37620, 6602 ], "rel_ids": [ 1642812, 1026720, 566487 ], "PDP": 1.8951858444717277e-05, "percent_of_DWPC": 0.42700242212924056, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.0262066302769608 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 24349, 37620, 6602 ], "rel_ids": [ 676868, 1030017, 566487 ], "PDP": 1.8803214122707974e-05, "percent_of_DWPC": 0.4236533318160727, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.0181578265544167 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 15519, 37620, 6602 ], "rel_ids": [ 802699, 1845118, 566487 ], "PDP": 1.865801338507312e-05, "percent_of_DWPC": 0.4203818285571236, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.0102954862928195 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 21757, 37620, 6602 ], "rel_ids": [ 1438618, 1794493, 566487 ], "PDP": 1.865801338507312e-05, "percent_of_DWPC": 0.4203818285571236, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.0102954862928195 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 33038, 37620, 6602 ], "rel_ids": [ 571130, 1709191, 566487 ], "PDP": 1.8516125292542163e-05, "percent_of_DWPC": 0.417184962172819, "PC": 484, "DWPC": 0.004438349166783211, "score": 1.00261251938288 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 7673, 37620, 6602 ], "rel_ids": [ 1084245, 1953705, 566487 ], "PDP": 1.837742577187092e-05, "percent_of_DWPC": 0.41405993718133616, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.995102207497412 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 18905, 37620, 6602 ], "rel_ids": [ 1834534, 1589083, 566487 ], "PDP": 1.837742577187092e-05, "percent_of_DWPC": 0.41405993718133616, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.995102207497412 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 27716, 37620, 6602 ], "rel_ids": [ 1890475, 965220, 566487 ], "PDP": 1.824179715977193e-05, "percent_of_DWPC": 0.4110041025229447, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.9877581793960392 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 41596, 37620, 6602 ], "rel_ids": [ 2013407, 64252, 566487 ], "PDP": 1.824179715977193e-05, "percent_of_DWPC": 0.4110041025229447, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.9877581793960392 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 26016, 19170, 6602 ], "rel_ids": [ 1882278, 1447777, 2237783 ], "PDP": 1.7705760134706546e-05, "percent_of_DWPC": 0.39892670606488534, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.9587328069872785 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 31337, 29897, 6602 ], "rel_ids": [ 387355, 1190352, 725145 ], "PDP": 1.7575772338250507e-05, "percent_of_DWPC": 0.3959979640580853, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.9516942181878005 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 1735, 38528, 6602 ], "rel_ids": [ 215325, 172888, 2159342 ], "PDP": 1.7235327002354346e-05, "percent_of_DWPC": 0.38832742433480105, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.9332597590046753 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 34133, 38528, 6602 ], "rel_ids": [ 487612, 953581, 2159342 ], "PDP": 1.7235327002354346e-05, "percent_of_DWPC": 0.38832742433480105, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.9332597590046753 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 22305, 10333, 6602 ], "rel_ids": [ 555093, 2004930, 1577078 ], "PDP": 1.6910389254520898e-05, "percent_of_DWPC": 0.3810062845230599, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.9156650058448924 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 17819, 15219, 6602 ], "rel_ids": [ 1607178, 488342, 1438257 ], "PDP": 1.6899310885947403e-05, "percent_of_DWPC": 0.3807566789116671, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.9150651335254607 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 29816, 29897, 6602 ], "rel_ids": [ 1067367, 6777, 725145 ], "PDP": 1.6570597073290504e-05, "percent_of_DWPC": 0.3733504609620518, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.8972659137288314 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 20934, 15219, 6602 ], "rel_ids": [ 698091, 1085845, 1438257 ], "PDP": 1.6249092115465686e-05, "percent_of_DWPC": 0.36610666499775557, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.879857039535878 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 13810, 15219, 6602 ], "rel_ids": [ 2235886, 1436358, 1438257 ], "PDP": 1.5950918305041033e-05, "percent_of_DWPC": 0.35938854077588955, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.8637115020348836 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 31337, 4002, 6602 ], "rel_ids": [ 387355, 269349, 470162 ], "PDP": 1.5342653722738776e-05, "percent_of_DWPC": 0.3456837924686916, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.8307751465243126 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 40665, 37620, 6602 ], "rel_ids": [ 607731, 140243, 566487 ], "PDP": 1.504257129816638e-05, "percent_of_DWPC": 0.3389226654528582, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.8145262612435334 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 22615, 15219, 6602 ], "rel_ids": [ 1642812, 1625991, 1438257 ], "PDP": 1.490379131086115e-05, "percent_of_DWPC": 0.33579582747571424, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.8070115922448275 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 15519, 15219, 6602 ], "rel_ids": [ 802699, 819459, 1438257 ], "PDP": 1.4672710783353053e-05, "percent_of_DWPC": 0.3305893752831397, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7944990267806838 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 29987, 38528, 6602 ], "rel_ids": [ 1639938, 323902, 2159342 ], "PDP": 1.456650994767706e-05, "percent_of_DWPC": 0.3281965749043231, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.788748456089711 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 31631, 38528, 6602 ], "rel_ids": [ 717289, 1658481, 2159342 ], "PDP": 1.456650994767706e-05, "percent_of_DWPC": 0.3281965749043231, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.788748456089711 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 23704, 38528, 6602 ], "rel_ids": [ 274375, 1456404, 2159342 ], "PDP": 1.456650994767706e-05, "percent_of_DWPC": 0.3281965749043231, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.788748456089711 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 42219, 38528, 6602 ], "rel_ids": [ 43539, 2203445, 2159342 ], "PDP": 1.456650994767706e-05, "percent_of_DWPC": 0.3281965749043231, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.788748456089711 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 33038, 15219, 6602 ], "rel_ids": [ 571130, 1652601, 1438257 ], "PDP": 1.456112961432174e-05, "percent_of_DWPC": 0.32807535115303316, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7884571214019581 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 18668, 10333, 6602 ], "rel_ids": [ 181319, 162636, 1577078 ], "PDP": 1.4515794857130852e-05, "percent_of_DWPC": 0.3270539182849259, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7860023316225286 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 7673, 15219, 6602 ], "rel_ids": [ 1084245, 1670120, 1438257 ], "PDP": 1.445205594658458e-05, "percent_of_DWPC": 0.32561782328313343, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7825509923884365 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 7351, 38528, 6602 ], "rel_ids": [ 326702, 1523521, 2159342 ], "PDP": 1.3979696199876635e-05, "percent_of_DWPC": 0.31497513319820036, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7569736219494567 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 26016, 37620, 6602 ], "rel_ids": [ 1882278, 527650, 566487 ], "PDP": 1.3966676821327099e-05, "percent_of_DWPC": 0.31468179488568154, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7562686476785381 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 15827, 29897, 6602 ], "rel_ids": [ 2067176, 38048, 725145 ], "PDP": 1.3787570172185176e-05, "percent_of_DWPC": 0.31064636093464487, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7465703676173885 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 22305, 46503, 6602 ], "rel_ids": [ 555093, 1476346, 88976 ], "PDP": 1.3725314247226192e-05, "percent_of_DWPC": 0.30924367893240606, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7431993291963653 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 8422, 37620, 6602 ], "rel_ids": [ 433145, 1244972, 566487 ], "PDP": 1.329588021426947e-05, "percent_of_DWPC": 0.2995681437994196, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7199463034747848 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 9289, 29897, 6602 ], "rel_ids": [ 1061430, 816748, 725145 ], "PDP": 1.3286035059114015e-05, "percent_of_DWPC": 0.29934632359588226, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7194132072865611 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 29376, 46503, 6602 ], "rel_ids": [ 547502, 1589332, 88976 ], "PDP": 1.325991331442642e-05, "percent_of_DWPC": 0.29875777718580954, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7179987651266534 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 31043, 37620, 6602 ], "rel_ids": [ 807298, 2177866, 566487 ], "PDP": 1.3092877755656309e-05, "percent_of_DWPC": 0.2949943157614536, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.7089541113581632 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 39959, 43573, 6602 ], "rel_ids": [ 2137837, 500489, 1956363 ], "PDP": 1.2901148902079357e-05, "percent_of_DWPC": 0.2906744921880435, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6985723632393706 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 36407, 38528, 6602 ], "rel_ids": [ 672983, 989112, 2159342 ], "PDP": 1.2846454263900664e-05, "percent_of_DWPC": 0.28944217278000706, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6956107539331751 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 31337, 46503, 6602 ], "rel_ids": [ 387355, 1751586, 88976 ], "PDP": 1.2838855859731874e-05, "percent_of_DWPC": 0.28927097389764655, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6951993149832546 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 39959, 29897, 6602 ], "rel_ids": [ 2137837, 642610, 725145 ], "PDP": 1.2835529300313496e-05, "percent_of_DWPC": 0.2891960235209778, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6950191881982689 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 38142, 38528, 6602 ], "rel_ids": [ 2071089, 1059219, 2159342 ], "PDP": 1.2706051640982221e-05, "percent_of_DWPC": 0.28627877536257934, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.688008222341486 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 34133, 10333, 6602 ], "rel_ids": [ 487612, 976117, 1577078 ], "PDP": 1.2654576573480162e-05, "percent_of_DWPC": 0.2851189957786002, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6852209465859892 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 1735, 10333, 6602 ], "rel_ids": [ 215325, 323154, 1577078 ], "PDP": 1.2654576573480162e-05, "percent_of_DWPC": 0.2851189957786002, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6852209465859892 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 15827, 10333, 6602 ], "rel_ids": [ 2067176, 319063, 1577078 ], "PDP": 1.2408833247005665e-05, "percent_of_DWPC": 0.27958217753289644, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6719144188008612 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 17819, 38528, 6602 ], "rel_ids": [ 1607178, 434117, 2159342 ], "PDP": 1.231094785882453e-05, "percent_of_DWPC": 0.277376731667715, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6666141135747679 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 34133, 4002, 6602 ], "rel_ids": [ 487612, 258736, 470162 ], "PDP": 1.227412297819102e-05, "percent_of_DWPC": 0.2765470339749533, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6646201172194501 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 2517, 14414, 6602 ], "rel_ids": [ 620180, 1436843, 1062975 ], "PDP": 1.2152140234363022e-05, "percent_of_DWPC": 0.27379865300617046, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6580149866006868 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 9289, 10333, 6602 ], "rel_ids": [ 1061430, 1326397, 1577078 ], "PDP": 1.1957450914375853e-05, "percent_of_DWPC": 0.2694121274609468, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6474729349281431 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 20934, 38528, 6602 ], "rel_ids": [ 698091, 1746928, 2159342 ], "PDP": 1.1837271184417302e-05, "percent_of_DWPC": 0.26670437001685066, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.640965434037499 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 18668, 46503, 6602 ], "rel_ids": [ 181319, 1210521, 88976 ], "PDP": 1.1781742156475003e-05, "percent_of_DWPC": 0.26545325105672285, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6379586441327808 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 5057, 38528, 6602 ], "rel_ids": [ 1775221, 1506873, 2159342 ], "PDP": 1.1727154640494694e-05, "percent_of_DWPC": 0.264223345208196, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6350028352872923 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 13810, 38528, 6602 ], "rel_ids": [ 2235886, 2198007, 2159342 ], "PDP": 1.16200550944963e-05, "percent_of_DWPC": 0.26181029607722783, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6292036011634303 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 9289, 4002, 6602 ], "rel_ids": [ 1061430, 365434, 470162 ], "PDP": 1.1597956057756039e-05, "percent_of_DWPC": 0.26131238489652014, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6280069808904507 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 31661, 23587, 6602 ], "rel_ids": [ 1826359, 1972878, 243603 ], "PDP": 1.1555895860806355e-05, "percent_of_DWPC": 0.2603647308168352, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6257295022407222 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 39959, 10333, 6602 ], "rel_ids": [ 2137837, 677987, 1577078 ], "PDP": 1.1551995074952526e-05, "percent_of_DWPC": 0.2602768426019326, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6255182822003147 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 3423, 38528, 6602 ], "rel_ids": [ 830364, 60349, 2159342 ], "PDP": 1.1515837248539913e-05, "percent_of_DWPC": 0.2594621742409299, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6235604055461985 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 24349, 14414, 6602 ], "rel_ids": [ 676868, 1094217, 1062975 ], "PDP": 1.146833085045414e-05, "percent_of_DWPC": 0.25839181234959174, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6209880255952611 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 3718, 23126, 6602 ], "rel_ids": [ 1918935, 266076, 1908160 ], "PDP": 1.1429042497695008e-05, "percent_of_DWPC": 0.25750661041340406, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6188606369694072 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 15519, 14414, 6602 ], "rel_ids": [ 802699, 624100, 1062975 ], "PDP": 1.1379770985738484e-05, "percent_of_DWPC": 0.25639647891844924, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6161926795022782 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 21140, 23587, 6602 ], "rel_ids": [ 1767287, 504208, 243603 ], "PDP": 1.1322419351886301e-05, "percent_of_DWPC": 0.25510429500733645, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6130871989981891 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 8673, 23587, 6602 ], "rel_ids": [ 325297, 42241, 243603 ], "PDP": 1.1322419351886301e-05, "percent_of_DWPC": 0.25510429500733645, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6130871989981891 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 1735, 27277, 6602 ], "rel_ids": [ 215325, 596499, 694619 ], "PDP": 1.124628022090986e-05, "percent_of_DWPC": 0.2533888118825235, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.608964411712738 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 39959, 4002, 6602 ], "rel_ids": [ 2137837, 1937412, 470162 ], "PDP": 1.1204690047912853e-05, "percent_of_DWPC": 0.2524517478653824, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6067123839547007 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 41596, 14414, 6602 ], "rel_ids": [ 2013407, 1245605, 1062975 ], "PDP": 1.112591516375342e-05, "percent_of_DWPC": 0.2506768788499163, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6024468757112997 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 10435, 38528, 6602 ], "rel_ids": [ 1085914, 361170, 2159342 ], "PDP": 1.1125355741092895e-05, "percent_of_DWPC": 0.2506642745540509, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6024165840517758 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 3718, 29897, 6602 ], "rel_ids": [ 1918935, 607692, 725145 ], "PDP": 1.1115894445090989e-05, "percent_of_DWPC": 0.2504511030426088, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.6019042730973386 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 15827, 27277, 6602 ], "rel_ids": [ 2067176, 1766394, 694619 ], "PDP": 1.1027885058029225e-05, "percent_of_DWPC": 0.24846817236828445, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5971387343090004 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 26435, 23587, 6602 ], "rel_ids": [ 859153, 2141456, 243603 ], "PDP": 1.0997305844167463e-05, "percent_of_DWPC": 0.2477791951672427, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5954829287791558 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 44623, 23587, 6602 ], "rel_ids": [ 1443537, 847508, 243603 ], "PDP": 1.0895003101148973e-05, "percent_of_DWPC": 0.24547422232319233, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5899434322971969 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 5057, 23587, 6602 ], "rel_ids": [ 1775221, 2168159, 243603 ], "PDP": 1.0895003101148973e-05, "percent_of_DWPC": 0.24547422232319233, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5899434322971969 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 36407, 23126, 6602 ], "rel_ids": [ 672983, 1573536, 1908160 ], "PDP": 1.0775404603452504e-05, "percent_of_DWPC": 0.2427795605649073, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5834674040139922 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 24349, 38528, 6602 ], "rel_ids": [ 676868, 2249983, 2159342 ], "PDP": 1.0772079376471463e-05, "percent_of_DWPC": 0.2427046402092506, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5832873493779218 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 3423, 23587, 6602 ], "rel_ids": [ 830364, 322731, 243603 ], "PDP": 1.0698680658812956e-05, "percent_of_DWPC": 0.24105090106209592, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5793129501951345 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 31631, 10333, 6602 ], "rel_ids": [ 717289, 1541194, 1577078 ], "PDP": 1.069506923286457e-05, "percent_of_DWPC": 0.24096953238620594, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5791173984362503 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 42219, 10333, 6602 ], "rel_ids": [ 43539, 211133, 1577078 ], "PDP": 1.069506923286457e-05, "percent_of_DWPC": 0.24096953238620594, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5791173984362503 }, { "metapath": "CbGeAlD", "node_ids": [ 17054, 23704, 10333, 6602 ], "rel_ids": [ 274375, 424181, 1577078 ], "PDP": 1.069506923286457e-05, "percent_of_DWPC": 0.24096953238620594, "PC": 484, "DWPC": 0.004438349166783211, "score": 0.5791173984362503 } ], "nodes": { "1735": { "neo4j_id": 1735, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4704, "chromosome": "12", "name": "NDUFA9", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 9, 39kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4704" }, "metanode": "Gene" }, "2517": { "neo4j_id": 2517, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 55967, "chromosome": "12", "name": "NDUFA12", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 12", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/55967" }, "metanode": "Gene" }, "3423": { "neo4j_id": 3423, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4716, "chromosome": "16", "name": "NDUFB10", "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 10, 22kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4716" }, "metanode": "Gene" }, "3718": { "neo4j_id": 3718, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4695, "chromosome": "5", "name": "NDUFA2", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 2, 8kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4695" }, "metanode": "Gene" }, "4002": { "neo4j_id": 4002, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0002369", "mesh_id": "D000311", "name": "adrenal gland", "source": "Uberon", "bto_id": "BTO:0000047", "url": "http://purl.obolibrary.org/obo/UBERON_0002369" }, "metanode": "Anatomy" }, "5057": { "neo4j_id": 5057, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4712, "chromosome": "9", "name": "NDUFB6", "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 6, 17kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4712" }, "metanode": "Gene" }, "6602": { "neo4j_id": 6602, "node_label": "Disease", "properties": { "license": "CC BY 3.0", "identifier": "DOID:1612", "name": "breast cancer", "source": "Disease Ontology", "url": "http://purl.obolibrary.org/obo/DOID_1612" }, "metanode": "Disease" }, "6708": { "neo4j_id": 6708, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4724, "chromosome": "5", "name": "NDUFS4", "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 4, 18kDa (NADH-coenzyme Q reductase)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4724" }, "metanode": "Gene" }, "7351": { "neo4j_id": 7351, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4538, "chromosome": "MT", "name": "ND4", "description": "NADH dehydrogenase, subunit 4 (complex I)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4538" }, "metanode": "Gene" }, "7673": { "neo4j_id": 7673, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 54539, "chromosome": "X", "name": "NDUFB11", "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 11, 17.3kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/54539" }, "metanode": "Gene" }, "8422": { "neo4j_id": 8422, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4720, "chromosome": "1", "name": "NDUFS2", "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 2, 49kDa (NADH-coenzyme Q reductase)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4720" }, "metanode": "Gene" }, "8673": { "neo4j_id": 8673, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 91942, "chromosome": "5", "name": "NDUFAF2", "description": "NADH dehydrogenase (ubiquinone) complex I, assembly factor 2", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/91942" }, "metanode": "Gene" }, "9289": { "neo4j_id": 9289, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4729, "chromosome": "18", "name": "NDUFV2", "description": "NADH dehydrogenase (ubiquinone) flavoprotein 2, 24kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4729" }, "metanode": "Gene" }, "10333": { "neo4j_id": 10333, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0000474", "mesh_id": "D005836", "name": "female reproductive system", "source": "Uberon", "bto_id": "BTO:0000083", "url": "http://purl.obolibrary.org/obo/UBERON_0000474" }, "metanode": "Anatomy" }, "10435": { "neo4j_id": 10435, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4711, "chromosome": "3", "name": "NDUFB5", "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 5, 16kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4711" }, "metanode": "Gene" }, "11807": { "neo4j_id": 11807, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4728, "chromosome": "11", "name": "NDUFS8", "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 8, 23kDa (NADH-coenzyme Q reductase)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4728" }, "metanode": "Gene" }, "13810": { "neo4j_id": 13810, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4719, "chromosome": "2", "name": "NDUFS1", "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 1, 75kDa (NADH-coenzyme Q reductase)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4719" }, "metanode": "Gene" }, "14414": { "neo4j_id": 14414, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0000483", "mesh_id": "D004848", "name": "epithelium", "source": "Uberon", "bto_id": "BTO:0000416", "url": "http://purl.obolibrary.org/obo/UBERON_0000483" }, "metanode": "Anatomy" }, "15219": { "neo4j_id": 15219, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0000922", "mesh_id": "D004622", "name": "embryo", "source": "Uberon", "bto_id": "BTO:0000379", "url": "http://purl.obolibrary.org/obo/UBERON_0000922" }, "metanode": "Anatomy" }, "15519": { "neo4j_id": 15519, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4715, "chromosome": "8", "name": "NDUFB9", "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 9, 22kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4715" }, "metanode": "Gene" }, "15827": { "neo4j_id": 15827, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4694, "chromosome": "X", "name": "NDUFA1", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 1, 7.5kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4694" }, "metanode": "Gene" }, "17054": { "neo4j_id": 17054, "node_label": "Compound", "properties": { "license": "CC BY-NC 4.0", "identifier": "DB00331", "inchikey": "InChIKey=XZWYZXLIPXDOLR-UHFFFAOYSA-N", "inchi": "InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8)", "name": "Metformin", "source": "DrugBank", "url": "http://www.drugbank.ca/drugs/DB00331" }, "metanode": "Compound" }, "17819": { "neo4j_id": 17819, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4541, "chromosome": "MT", "name": "ND6", "description": "NADH dehydrogenase, subunit 6 (complex I)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4541" }, "metanode": "Gene" }, "18668": { "neo4j_id": 18668, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 25915, "chromosome": "3", "name": "NDUFAF3", "description": "NADH dehydrogenase (ubiquinone) complex I, assembly factor 3", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/25915" }, "metanode": "Gene" }, "18905": { "neo4j_id": 18905, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4723, "chromosome": "11", "name": "NDUFV1", "description": "NADH dehydrogenase (ubiquinone) flavoprotein 1, 51kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4723" }, "metanode": "Gene" }, "19170": { "neo4j_id": 19170, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0001911", "mesh_id": "D008321", "name": "mammary gland", "source": "Uberon", "bto_id": "BTO:0000817", "url": "http://purl.obolibrary.org/obo/UBERON_0001911" }, "metanode": "Anatomy" }, "20934": { "neo4j_id": 20934, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4698, "chromosome": "7", "name": "NDUFA5", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 5", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4698" }, "metanode": "Gene" }, "21140": { "neo4j_id": 21140, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4709, "chromosome": "2", "name": "NDUFB3", "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 3, 12kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4709" }, "metanode": "Gene" }, "21757": { "neo4j_id": 21757, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4702, "chromosome": "9", "name": "NDUFA8", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 8, 19kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4702" }, "metanode": "Gene" }, "22305": { "neo4j_id": 22305, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4731, "chromosome": "21", "name": "NDUFV3", "description": "NADH dehydrogenase (ubiquinone) flavoprotein 3, 10kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4731" }, "metanode": "Gene" }, "22615": { "neo4j_id": 22615, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4710, "chromosome": "3", "name": "NDUFB4", "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 4, 15kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4710" }, "metanode": "Gene" }, "23126": { "neo4j_id": 23126, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0000995", "mesh_id": "D014599", "name": "uterus", "source": "Uberon", "bto_id": "BTO:0001424", "url": "http://purl.obolibrary.org/obo/UBERON_0000995" }, "metanode": "Anatomy" }, "23587": { "neo4j_id": 23587, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0001295", "mesh_id": "D004717", "name": "endometrium", "source": "Uberon", "bto_id": "BTO:0001422", "url": "http://purl.obolibrary.org/obo/UBERON_0001295" }, "metanode": "Anatomy" }, "23704": { "neo4j_id": 23704, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4537, "chromosome": "MT", "name": "ND3", "description": "NADH dehydrogenase, subunit 3 (complex I)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4537" }, "metanode": "Gene" }, "24349": { "neo4j_id": 24349, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4706, "chromosome": "16", "name": "NDUFAB1", "description": "NADH dehydrogenase (ubiquinone) 1, alpha/beta subcomplex, 1, 8kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4706" }, "metanode": "Gene" }, "26016": { "neo4j_id": 26016, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4718, "chromosome": "11", "name": "NDUFC2", "description": "NADH dehydrogenase (ubiquinone) 1, subcomplex unknown, 2, 14.5kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4718" }, "metanode": "Gene" }, "26435": { "neo4j_id": 26435, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 126328, "chromosome": "19", "name": "NDUFA11", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 11, 14.7kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/126328" }, "metanode": "Gene" }, "26852": { "neo4j_id": 26852, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4700, "chromosome": "22", "name": "NDUFA6", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 6, 14kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4700" }, "metanode": "Gene" }, "27277": { "neo4j_id": 27277, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0000992", "mesh_id": "D010053", "name": "female gonad", "source": "Uberon", "bto_id": "BTO:0000975", "url": "http://purl.obolibrary.org/obo/UBERON_0000992" }, "metanode": "Anatomy" }, "27716": { "neo4j_id": 27716, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4714, "chromosome": "10", "name": "NDUFB8", "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 8, 19kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4714" }, "metanode": "Gene" }, "29376": { "neo4j_id": 29376, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4726, "chromosome": "5", "name": "NDUFS6", "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 6, 13kDa (NADH-coenzyme Q reductase)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4726" }, "metanode": "Gene" }, "29816": { "neo4j_id": 29816, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 222962, "chromosome": "7", "name": "SLC29A4", "description": "solute carrier family 29 (equilibrative nucleoside transporter), member 4", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/222962" }, "metanode": "Gene" }, "29897": { "neo4j_id": 29897, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0001013", "mesh_id": "D000273", "name": "adipose tissue", "source": "Uberon", "bto_id": "BTO:0001487", "url": "http://purl.obolibrary.org/obo/UBERON_0001013" }, "metanode": "Anatomy" }, "29987": { "neo4j_id": 29987, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4540, "chromosome": "MT", "name": "ND5", "description": "NADH dehydrogenase, subunit 5 (complex I)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4540" }, "metanode": "Gene" }, "31043": { "neo4j_id": 31043, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4722, "chromosome": "11", "name": "NDUFS3", "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 3, 30kDa (NADH-coenzyme Q reductase)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4722" }, "metanode": "Gene" }, "31337": { "neo4j_id": 31337, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4701, "chromosome": "19", "name": "NDUFA7", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 7, 14.5kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4701" }, "metanode": "Gene" }, "31631": { "neo4j_id": 31631, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4536, "chromosome": "MT", "name": "ND2", "description": "MTND2", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4536" }, "metanode": "Gene" }, "31661": { "neo4j_id": 31661, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 51103, "chromosome": "15", "name": "NDUFAF1", "description": "NADH dehydrogenase (ubiquinone) complex I, assembly factor 1", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/51103" }, "metanode": "Gene" }, "33038": { "neo4j_id": 33038, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4697, "chromosome": "7", "name": "NDUFA4", "description": "NDUFA4, mitochondrial complex associated", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4697" }, "metanode": "Gene" }, "34133": { "neo4j_id": 34133, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 51079, "chromosome": "19", "name": "NDUFA13", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 13", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/51079" }, "metanode": "Gene" }, "36407": { "neo4j_id": 36407, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4705, "chromosome": "2", "name": "NDUFA10", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 10, 42kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4705" }, "metanode": "Gene" }, "37620": { "neo4j_id": 37620, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0002030", "mesh_id": "D009558", "name": "nipple", "source": "Uberon", "bto_id": "BTO:0000821", "url": "http://purl.obolibrary.org/obo/UBERON_0002030" }, "metanode": "Anatomy" }, "38142": { "neo4j_id": 38142, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4717, "chromosome": "4", "name": "NDUFC1", "description": "NADH dehydrogenase (ubiquinone) 1, subcomplex unknown, 1, 6kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4717" }, "metanode": "Gene" }, "38528": { "neo4j_id": 38528, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0002097", "mesh_id": "D012867", "name": "skin of body", "source": "Uberon", "bto_id": "BTO:0001253", "url": "http://purl.obolibrary.org/obo/UBERON_0002097" }, "metanode": "Anatomy" }, "39867": { "neo4j_id": 39867, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4713, "chromosome": "19", "name": "NDUFB7", "description": "NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 7, 18kDa", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4713" }, "metanode": "Gene" }, "39959": { "neo4j_id": 39959, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 56901, "chromosome": "12", "name": "NDUFA4L2", "description": "NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 4-like 2", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/56901" }, "metanode": "Gene" }, "40665": { "neo4j_id": 40665, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 5564, "chromosome": "12", "name": "PRKAB1", "description": "protein kinase, AMP-activated, beta 1 non-catalytic subunit", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/5564" }, "metanode": "Gene" }, "41596": { "neo4j_id": 41596, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4725, "chromosome": "1", "name": "NDUFS5", "description": "NADH dehydrogenase (ubiquinone) Fe-S protein 5, 15kDa (NADH-coenzyme Q reductase)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4725" }, "metanode": "Gene" }, "42219": { "neo4j_id": 42219, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 4539, "chromosome": "MT", "name": "ND4L", "description": "NADH dehydrogenase, subunit 4L (complex I)", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/4539" }, "metanode": "Gene" }, "43573": { "neo4j_id": 43573, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0000007", "mesh_id": "D010902", "name": "pituitary gland", "source": "Uberon", "bto_id": "BTO:0001073", "url": "http://purl.obolibrary.org/obo/UBERON_0000007" }, "metanode": "Anatomy" }, "44623": { "neo4j_id": 44623, "node_label": "Gene", "properties": { "license": "CC0 1.0", "identifier": 29078, "chromosome": "6", "name": "NDUFAF4", "description": "NADH dehydrogenase (ubiquinone) complex I, assembly factor 4", "source": "Entrez Gene", "url": "http://identifiers.org/ncbigene/29078" }, "metanode": "Gene" }, "46503": { "neo4j_id": 46503, "node_label": "Anatomy", "properties": { "license": "CC BY 3.0", "identifier": "UBERON:0002368", "mesh_id": "D004702", "name": "endocrine gland", "source": "Uberon", "bto_id": "BTO:0001488", "url": "http://purl.obolibrary.org/obo/UBERON_0002368" }, "metanode": "Anatomy" } }, "relationships": { "6777": { "neo4j_id": 6777, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 29897, "target_neo4j_id": 29816, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "23365": { "neo4j_id": 23365, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 19170, "target_neo4j_id": 36407, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "37480": { "neo4j_id": 37480, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 11807, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "38048": { "neo4j_id": 38048, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 29897, "target_neo4j_id": 15827, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "42241": { "neo4j_id": 42241, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23587, "target_neo4j_id": 8673, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "43539": { "neo4j_id": 43539, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 42219, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "45383": { "neo4j_id": 45383, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 26435, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "60349": { "neo4j_id": 60349, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 3423, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "64252": { "neo4j_id": 64252, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 41596, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "88976": { "neo4j_id": 88976, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 46503, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "140243": { "neo4j_id": 140243, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 40665, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "161980": { "neo4j_id": 161980, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 2517, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "162636": { "neo4j_id": 162636, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 18668, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "172888": { "neo4j_id": 172888, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 1735, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "181319": { "neo4j_id": 181319, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 18668, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "211133": { "neo4j_id": 211133, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 42219, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "215325": { "neo4j_id": 215325, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 1735, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "241741": { "neo4j_id": 241741, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 10435, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "243603": { "neo4j_id": 243603, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 23587, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "258736": { "neo4j_id": 258736, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 4002, "target_neo4j_id": 34133, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "266076": { "neo4j_id": 266076, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23126, "target_neo4j_id": 3718, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "269349": { "neo4j_id": 269349, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 4002, "target_neo4j_id": 31337, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "274375": { "neo4j_id": 274375, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 23704, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "283049": { "neo4j_id": 283049, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 26852, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "319063": { "neo4j_id": 319063, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 15827, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "320117": { "neo4j_id": 320117, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 3423, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "322731": { "neo4j_id": 322731, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23587, "target_neo4j_id": 3423, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "323154": { "neo4j_id": 323154, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 1735, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "323902": { "neo4j_id": 323902, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 29987, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "325297": { "neo4j_id": 325297, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 8673, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "326702": { "neo4j_id": 326702, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 7351, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "350512": { "neo4j_id": 350512, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23126, "target_neo4j_id": 22305, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "361170": { "neo4j_id": 361170, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 10435, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "365434": { "neo4j_id": 365434, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 4002, "target_neo4j_id": 9289, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "387355": { "neo4j_id": 387355, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 31337, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "424181": { "neo4j_id": 424181, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 23704, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "433145": { "neo4j_id": 433145, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 8422, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "434117": { "neo4j_id": 434117, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 17819, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "436986": { "neo4j_id": 436986, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 39867, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "457065": { "neo4j_id": 457065, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 26852, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "470162": { "neo4j_id": 470162, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 4002, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "487612": { "neo4j_id": 487612, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 34133, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "488342": { "neo4j_id": 488342, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 15219, "target_neo4j_id": 17819, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "500489": { "neo4j_id": 500489, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 43573, "target_neo4j_id": 39959, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "504208": { "neo4j_id": 504208, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23587, "target_neo4j_id": 21140, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "527650": { "neo4j_id": 527650, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 26016, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "547502": { "neo4j_id": 547502, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 29376, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "555093": { "neo4j_id": 555093, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 22305, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "566487": { "neo4j_id": 566487, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 37620, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "571130": { "neo4j_id": 571130, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 33038, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "596499": { "neo4j_id": 596499, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 27277, "target_neo4j_id": 1735, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "607692": { "neo4j_id": 607692, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 29897, "target_neo4j_id": 3718, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "607731": { "neo4j_id": 607731, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 40665, "properties": { "license": "CC BY-NC 4.0", "pubmed_ids": [ "12086935", "12890675", "12960015", "14500570", "14502105", "14871885", "17307971", "19428322" ], "sources": [ "DrugBank (target)" ], "unbiased": false, "actions": [ "inducer" ] }, "kind": "binds", "directed": false }, "620180": { "neo4j_id": 620180, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 2517, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "624100": { "neo4j_id": 624100, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 14414, "target_neo4j_id": 15519, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "642610": { "neo4j_id": 642610, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 29897, "target_neo4j_id": 39959, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "661188": { "neo4j_id": 661188, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 19170, "target_neo4j_id": 26435, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "672983": { "neo4j_id": 672983, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 36407, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "676868": { "neo4j_id": 676868, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 24349, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "677987": { "neo4j_id": 677987, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 39959, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "694619": { "neo4j_id": 694619, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 27277, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "698091": { "neo4j_id": 698091, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 20934, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "717289": { "neo4j_id": 717289, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 31631, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "719635": { "neo4j_id": 719635, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 19170, "target_neo4j_id": 29816, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "725145": { "neo4j_id": 725145, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 29897, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "752475": { "neo4j_id": 752475, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 21140, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "793041": { "neo4j_id": 793041, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 5057, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "802699": { "neo4j_id": 802699, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 15519, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "807298": { "neo4j_id": 807298, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 31043, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "816748": { "neo4j_id": 816748, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 29897, "target_neo4j_id": 9289, "properties": { "sources": [ "Bgee", "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "819459": { "neo4j_id": 819459, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 15219, "target_neo4j_id": 15519, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "830364": { "neo4j_id": 830364, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 3423, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "847508": { "neo4j_id": 847508, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23587, "target_neo4j_id": 44623, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "859153": { "neo4j_id": 859153, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 26435, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "878902": { "neo4j_id": 878902, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 6708, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "888397": { "neo4j_id": 888397, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 20934, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "953581": { "neo4j_id": 953581, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 34133, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "965220": { "neo4j_id": 965220, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 27716, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "976117": { "neo4j_id": 976117, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 34133, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "989112": { "neo4j_id": 989112, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 36407, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1026720": { "neo4j_id": 1026720, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 22615, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1030017": { "neo4j_id": 1030017, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 24349, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1030045": { "neo4j_id": 1030045, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 19170, "target_neo4j_id": 11807, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1059219": { "neo4j_id": 1059219, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 38142, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1061430": { "neo4j_id": 1061430, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 9289, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1062975": { "neo4j_id": 1062975, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 14414, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "1067367": { "neo4j_id": 1067367, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 29816, "properties": { "license": "CC BY-NC 4.0", "pubmed_ids": [ "17600084" ], "sources": [ "DrugBank (transporter)" ], "unbiased": false, "actions": [ "substrate" ] }, "kind": "binds", "directed": false }, "1084245": { "neo4j_id": 1084245, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 7673, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1085845": { "neo4j_id": 1085845, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 15219, "target_neo4j_id": 20934, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1085914": { "neo4j_id": 1085914, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 10435, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1094217": { "neo4j_id": 1094217, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 14414, "target_neo4j_id": 24349, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1165243": { "neo4j_id": 1165243, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 44623, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1190352": { "neo4j_id": 1190352, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 29897, "target_neo4j_id": 31337, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1210521": { "neo4j_id": 1210521, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 46503, "target_neo4j_id": 18668, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1244972": { "neo4j_id": 1244972, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 8422, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1245605": { "neo4j_id": 1245605, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 14414, "target_neo4j_id": 41596, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1326397": { "neo4j_id": 1326397, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 9289, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1339826": { "neo4j_id": 1339826, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 39959, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1343672": { "neo4j_id": 1343672, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 19170, "target_neo4j_id": 44623, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1357836": { "neo4j_id": 1357836, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 11807, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1436358": { "neo4j_id": 1436358, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 15219, "target_neo4j_id": 13810, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1436843": { "neo4j_id": 1436843, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 14414, "target_neo4j_id": 2517, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1438257": { "neo4j_id": 1438257, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 15219, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "1438618": { "neo4j_id": 1438618, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 21757, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1443537": { "neo4j_id": 1443537, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 44623, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1447777": { "neo4j_id": 1447777, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 19170, "target_neo4j_id": 26016, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1456404": { "neo4j_id": 1456404, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 23704, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1476346": { "neo4j_id": 1476346, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 46503, "target_neo4j_id": 22305, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1506873": { "neo4j_id": 1506873, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 5057, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1523521": { "neo4j_id": 1523521, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 7351, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1530044": { "neo4j_id": 1530044, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 6708, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1541194": { "neo4j_id": 1541194, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 31631, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1573536": { "neo4j_id": 1573536, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23126, "target_neo4j_id": 36407, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1577078": { "neo4j_id": 1577078, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 10333, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "1589083": { "neo4j_id": 1589083, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 18905, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1589332": { "neo4j_id": 1589332, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 46503, "target_neo4j_id": 29376, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1607178": { "neo4j_id": 1607178, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 17819, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1625991": { "neo4j_id": 1625991, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 15219, "target_neo4j_id": 22615, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1639938": { "neo4j_id": 1639938, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 29987, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1642812": { "neo4j_id": 1642812, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 22615, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1652601": { "neo4j_id": 1652601, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 15219, "target_neo4j_id": 33038, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1658481": { "neo4j_id": 1658481, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 31631, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1661805": { "neo4j_id": 1661805, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 29376, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1670120": { "neo4j_id": 1670120, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 15219, "target_neo4j_id": 7673, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1707833": { "neo4j_id": 1707833, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 8673, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1709191": { "neo4j_id": 1709191, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 33038, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1746928": { "neo4j_id": 1746928, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 20934, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1751586": { "neo4j_id": 1751586, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 46503, "target_neo4j_id": 31337, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false }, "1766394": { "neo4j_id": 1766394, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 27277, "target_neo4j_id": 15827, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1767287": { "neo4j_id": 1767287, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 21140, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1775221": { "neo4j_id": 1775221, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 5057, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1794493": { "neo4j_id": 1794493, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 21757, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1826359": { "neo4j_id": 1826359, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 31661, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1834534": { "neo4j_id": 1834534, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 18905, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1845118": { "neo4j_id": 1845118, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 15519, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1882278": { "neo4j_id": 1882278, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 26016, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1890475": { "neo4j_id": 1890475, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 27716, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1908160": { "neo4j_id": 1908160, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 23126, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "1918935": { "neo4j_id": 1918935, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 3718, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "1937412": { "neo4j_id": 1937412, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 4002, "target_neo4j_id": 39959, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1953705": { "neo4j_id": 1953705, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 7673, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "1956363": { "neo4j_id": 1956363, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 43573, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "1972878": { "neo4j_id": 1972878, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23587, "target_neo4j_id": 31661, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2004930": { "neo4j_id": 2004930, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 10333, "target_neo4j_id": 22305, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2012117": { "neo4j_id": 2012117, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 13810, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2013407": { "neo4j_id": 2013407, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 41596, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "2067176": { "neo4j_id": 2067176, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 15827, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "2071089": { "neo4j_id": 2071089, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 38142, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "2137837": { "neo4j_id": 2137837, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 39959, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "2141456": { "neo4j_id": 2141456, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23587, "target_neo4j_id": 26435, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2159342": { "neo4j_id": 2159342, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 38528, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "2166487": { "neo4j_id": 2166487, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 39867, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2168159": { "neo4j_id": 2168159, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 23587, "target_neo4j_id": 5057, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2170388": { "neo4j_id": 2170388, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 31661, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2177866": { "neo4j_id": 2177866, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 37620, "target_neo4j_id": 31043, "properties": { "sources": [ "Bgee" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2198007": { "neo4j_id": 2198007, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 13810, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2203445": { "neo4j_id": 2203445, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 42219, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": true }, "kind": "expresses", "directed": false }, "2235886": { "neo4j_id": 2235886, "rel_type": "BINDS_CbG", "source_neo4j_id": 17054, "target_neo4j_id": 13810, "properties": { "license": "CC BY 4.0", "urls": [ "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1431" ], "sources": [ "DrugCentral (ChEMBL)" ], "unbiased": false, "actions": [ "inhibitor" ] }, "kind": "binds", "directed": false }, "2237783": { "neo4j_id": 2237783, "rel_type": "LOCALIZES_DlA", "source_neo4j_id": 6602, "target_neo4j_id": 19170, "properties": { "license": "CC0 1.0", "unbiased": false, "source": "MEDLINE cooccurrence" }, "kind": "localizes", "directed": false }, "2249983": { "neo4j_id": 2249983, "rel_type": "EXPRESSES_AeG", "source_neo4j_id": 38528, "target_neo4j_id": 24349, "properties": { "license": "CC BY 4.0", "sources": [ "TISSUES" ], "unbiased": false }, "kind": "expresses", "directed": false } } }